From 0b3a2120dc1e94a966e621fb0fb201d0d0b9ed78 Mon Sep 17 00:00:00 2001 From: John Fallows Date: Tue, 12 Dec 2023 18:17:36 -0800 Subject: [PATCH 01/16] Update CHANGELOG.md --- CHANGELOG.md | 15 +++++++++++++++ 1 file changed, 15 insertions(+) diff --git a/CHANGELOG.md b/CHANGELOG.md index 4897e617cc..dc5b6a3850 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -1,5 +1,20 @@ # Changelog +## [0.9.62](https://github.com/aklivity/zilla/tree/0.9.62) (2023-12-13) + +[Full Changelog](https://github.com/aklivity/zilla/compare/0.9.61...0.9.62) + +**Closed issues:** + +- MQTT sessions don't show up in Redpanda [\#585](https://github.com/aklivity/zilla/issues/585) + +**Merged pull requests:** + +- Reinitiate initialId and replyId on mqtt session reconnection [\#636](https://github.com/aklivity/zilla/pull/636) ([akrambek](https://github.com/akrambek)) +- Support ability to connect to specific kafka cluster node hostname [\#633](https://github.com/aklivity/zilla/pull/633) ([akrambek](https://github.com/akrambek)) +- Zpm install instrument [\#632](https://github.com/aklivity/zilla/pull/632) ([jfallows](https://github.com/jfallows)) +- Bump alpine from 3.18.5 to 3.19.0 in /cloud/docker-image/src/main/docker/release [\#626](https://github.com/aklivity/zilla/pull/626) ([dependabot[bot]](https://github.com/apps/dependabot)) + ## [0.9.61](https://github.com/aklivity/zilla/tree/0.9.61) (2023-12-10) [Full Changelog](https://github.com/aklivity/zilla/compare/0.9.60...0.9.61) From 3b99bb146f1b7934de6a4c32bb75d393cbfb5a42 Mon Sep 17 00:00:00 2001 From: Dave Voutila Date: Wed, 13 Dec 2023 13:04:54 -0500 Subject: [PATCH 02/16] Fix java.util.MissingFormatArgumentException when using Kafka debugging. (#639) --- .../kafka/internal/stream/KafkaClientProduceFactory.java | 9 +++++++-- 1 file changed, 7 insertions(+), 2 deletions(-) diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientProduceFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientProduceFactory.java index a813fa89d7..b2fb009d15 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientProduceFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientProduceFactory.java @@ -1313,6 +1313,8 @@ private void onNetworkBegin( stream.doApplicationBeginIfNecessary(traceId, authorization, topic, partitionId); } + private long networkBytesReceived; + private void onNetworkData( DataFW data) { @@ -1324,6 +1326,7 @@ private void onNetworkData( assert acknowledge <= sequence; assert sequence >= replySeq; + networkBytesReceived += Math.max(data.length(), 0); authorization = data.authorization(); replySeq = sequence + data.reserved(); @@ -1385,7 +1388,8 @@ private void onNetworkAbort( if (KafkaConfiguration.DEBUG) { - System.out.format("[client] %s[%s] PRODUCE aborted (%d bytes)\n", topic, partitionId); + System.out.format("[client] %s[%s] PRODUCE aborted (%d bytes)\n", + topic, partitionId, network, networkBytesReceived); } state = KafkaState.closedReply(state); @@ -1400,7 +1404,8 @@ private void onNetworkReset( if (KafkaConfiguration.DEBUG) { - System.out.format("[client] %s[%d] PRODUCE reset (%d bytes)\n", topic, partitionId); + System.out.format("[client] %s[%d] PRODUCE reset (%d bytes)\n", + topic, partitionId, networkBytesReceived); } state = KafkaState.closedInitial(state); From 3478bc532d8a89d9d34b96dcbeec70d1707e1007 Mon Sep 17 00:00:00 2001 From: AJ Danelz Date: Thu, 14 Dec 2023 13:30:47 -0500 Subject: [PATCH 03/16] Json schema errors (#638) * fix schema errors * remove invalid props and disable vault * Correct the array of objects and title * use deprecated instead of deleting --- .../otlp/schema/otlp.schema.patch.json | 10 ++--- .../grpc/schema/grpc.schema.patch.json | 1 + .../grpc/schema/kafka.grpc.schema.patch.json | 26 +++++------ .../kafka/schema/kafka.schema.patch.json | 6 ++- .../kafka/schema/mqtt.kafka.schema.patch.json | 43 +++++++++++-------- 5 files changed, 47 insertions(+), 39 deletions(-) diff --git a/incubator/exporter-otlp.spec/src/main/scripts/io/aklivity/zilla/specs/exporter/otlp/schema/otlp.schema.patch.json b/incubator/exporter-otlp.spec/src/main/scripts/io/aklivity/zilla/specs/exporter/otlp/schema/otlp.schema.patch.json index 2a4f12b536..3c06e6b4d7 100644 --- a/incubator/exporter-otlp.spec/src/main/scripts/io/aklivity/zilla/specs/exporter/otlp/schema/otlp.schema.patch.json +++ b/incubator/exporter-otlp.spec/src/main/scripts/io/aklivity/zilla/specs/exporter/otlp/schema/otlp.schema.patch.json @@ -90,12 +90,12 @@ ], "additionalProperties": false }, - "required": - [ - "options" - ], "additionalProperties": false - } + }, + "required": + [ + "options" + ] } } } diff --git a/specs/binding-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/grpc/schema/grpc.schema.patch.json b/specs/binding-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/grpc/schema/grpc.schema.patch.json index 9951d74743..b1b14db7d9 100644 --- a/specs/binding-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/grpc/schema/grpc.schema.patch.json +++ b/specs/binding-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/grpc/schema/grpc.schema.patch.json @@ -31,6 +31,7 @@ { "enum": [ "server", "client"] }, + "vault": false, "options": { "properties": diff --git a/specs/binding-kafka-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/grpc/schema/kafka.grpc.schema.patch.json b/specs/binding-kafka-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/grpc/schema/kafka.grpc.schema.patch.json index 3fd783ad61..61dc8be8d0 100644 --- a/specs/binding-kafka-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/grpc/schema/kafka.grpc.schema.patch.json +++ b/specs/binding-kafka-grpc.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/grpc/schema/kafka.grpc.schema.patch.json @@ -170,19 +170,19 @@ "type": "string" } }, - "additionalProperties": false - }, - "required": - [ - "scheme", - "authority" - ] - } - }, - "required": - [ - "with" - ] + "additionalProperties": false, + "required": + [ + "scheme", + "authority" + ] + } + }, + "required": + [ + "with" + ] + } }, "exit": false }, diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/schema/kafka.schema.patch.json b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/schema/kafka.schema.patch.json index f05d23d283..be4715ed50 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/schema/kafka.schema.patch.json +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/schema/kafka.schema.patch.json @@ -77,7 +77,8 @@ "deltaType": { "type": "string", - "enum": [ "none", "json_patch" ] + "enum": [ "none", "json_patch" ], + "deprecated": true }, "key": { @@ -230,7 +231,8 @@ "groupId": { "title": "groupId", - "type": "string" + "type": "string", + "deprecated": true } }, "additionalProperties": false diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/schema/mqtt.kafka.schema.patch.json b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/schema/mqtt.kafka.schema.patch.json index 3bc637ff87..716f9584e4 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/schema/mqtt.kafka.schema.patch.json +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/schema/mqtt.kafka.schema.patch.json @@ -109,11 +109,15 @@ "type": "array", "items": { - "topic": + "properties": { - "title": "Topic", - "type": "string" - } + "topic": + { + "title": "Topic", + "type": "string" + } + }, + "additionalProperties": false } } } @@ -123,15 +127,19 @@ { "publish": { - "title": "Subscribe", + "title": "Publish", "type": "array", "items": { - "topic": + "properties": { - "title": "Topic", - "type": "string" - } + "topic": + { + "title": "Topic", + "type": "string" + } + }, + "additionalProperties": false } } } @@ -141,18 +149,15 @@ }, "with": { - "items": + "properties": { - "properties": + "messages": { - "messages": - { - "title": "Messages Topic", - "type": "string" - } - }, - "additionalProperties": false - } + "title": "Messages Topic", + "type": "string" + } + }, + "additionalProperties": false } }, "required": From 6097caa6f96a1fcb154ae8b4af19680c7b60e9ab Mon Sep 17 00:00:00 2001 From: Attila Kreiner Date: Thu, 14 Dec 2023 22:13:09 +0100 Subject: [PATCH 04/16] Add jumbograms and proxy extension parsing to dump command (#635) --- incubator/command-dump/pom.xml | 14 + .../internal/airline/ZillaDumpCommand.java | 223 ++++-- incubator/command-dump/src/main/lua/zilla.lua | 418 ----------- .../main/resources/META-INF/zilla/pcap.idl | 9 +- .../command/dump/internal/airline/zilla.lua | 656 ++++++++++++++++++ .../expected_dump_with_kafka_filter.pcap | Bin 228 -> 236 bytes .../expected_dump_without_filter.pcap | Bin 2076 -> 2148 bytes 7 files changed, 845 insertions(+), 475 deletions(-) delete mode 100644 incubator/command-dump/src/main/lua/zilla.lua create mode 100644 incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua diff --git a/incubator/command-dump/pom.xml b/incubator/command-dump/pom.xml index 1a22886e53..fc19d097e1 100644 --- a/incubator/command-dump/pom.xml +++ b/incubator/command-dump/pom.xml @@ -91,6 +91,11 @@ org.apache.maven.plugins maven-failsafe-plugin + + org.apache.maven.plugins + maven-resources-plugin + 3.3.1 + org.jacoco jacoco-maven-plugin @@ -137,5 +142,14 @@ + + + src/main/resources + true + + **/zilla.lua + + + diff --git a/incubator/command-dump/src/main/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommand.java b/incubator/command-dump/src/main/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommand.java index b98a35b2e6..4315b4ef5c 100644 --- a/incubator/command-dump/src/main/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommand.java +++ b/incubator/command-dump/src/main/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommand.java @@ -21,14 +21,16 @@ import static java.nio.file.StandardOpenOption.WRITE; import static java.util.concurrent.TimeUnit.MILLISECONDS; import static org.agrona.LangUtil.rethrowUnchecked; +import static org.agrona.concurrent.ringbuffer.RecordDescriptor.HEADER_LENGTH; -import java.io.IOException; +import java.io.InputStream; import java.nio.ByteBuffer; import java.nio.channels.WritableByteChannel; import java.nio.charset.StandardCharsets; import java.nio.file.Files; import java.nio.file.Path; import java.nio.file.Paths; +import java.nio.file.StandardCopyOption; import java.util.ArrayList; import java.util.List; import java.util.Properties; @@ -60,6 +62,7 @@ import io.aklivity.zilla.runtime.command.dump.internal.airline.spy.RingBufferSpy; import io.aklivity.zilla.runtime.command.dump.internal.types.Flyweight; import io.aklivity.zilla.runtime.command.dump.internal.types.IPv6HeaderFW; +import io.aklivity.zilla.runtime.command.dump.internal.types.IPv6JumboHeaderFW; import io.aklivity.zilla.runtime.command.dump.internal.types.PcapGlobalHeaderFW; import io.aklivity.zilla.runtime.command.dump.internal.types.PcapPacketHeaderFW; import io.aklivity.zilla.runtime.command.dump.internal.types.TcpFlag; @@ -90,7 +93,8 @@ public final class ZillaDumpCommand extends ZillaCommand private static final long MIN_PARK_NS = MILLISECONDS.toNanos(1L); private static final int MAX_YIELDS = 30; private static final int MAX_SPINS = 20; - private static final int BUFFER_SLOT_CAPACITY = 64 * 1024; + private static final int WRITE_BUFFER_SLOT_CAPACITY = 64 * 1024; + private static final int PATCH_BUFFER_SLOT_CAPACITY = 64 * 1024 + 85; private static final int LABELS_BUFFER_SLOT_CAPACITY = 4 * 128; private static final long PCAP_GLOBAL_MAGIC = 2712847316L; @@ -99,10 +103,15 @@ public final class ZillaDumpCommand extends ZillaCommand private static final int PCAP_GLOBAL_SIZE = 24; private static final int PCAP_LINK_TYPE_IPV6 = 1; - private static final byte[] PSEUDO_ETHERNET_FRAME = BitUtil.fromHex("2052454356002053454e440086dd"); - private static final int PSEUDO_IPV6_PREFIX = 1629561669; - private static final short PSEUDO_NEXT_HEADER_AND_HOP_LIMIT = 0x0640; + private static final byte[] ETHERNET_FRAME = BitUtil.fromHex("2052454356002053454e440086dd"); + + private static final int IPV6_PREFIX = 0x61212345; + private static final byte IPV6_NEXT_HEADER_TCP = 0x06; + private static final byte IPV6_NEXT_HEADER_JUMBO = 0x00; + private static final byte IPV6_HOP_LIMIT = 0x40; private static final long IPV6_LOCAL_ADDRESS = 0xfe80L << 48; + private static final int IPV6_JUMBO_PREFIX = 0x0600c204; + private static final int IPV6_JUMBO_THRESHOLD = 0xffff; private static final int PCAP_HEADER_OFFSET = 0; private static final int PCAP_HEADER_SIZE = 16; @@ -115,6 +124,8 @@ public final class ZillaDumpCommand extends ZillaCommand private static final int IPV6_HEADER_OFFSET = ETHER_HEADER_LIMIT; private static final int IPV6_HEADER_SIZE = 40; private static final int IPV6_HEADER_LIMIT = IPV6_HEADER_OFFSET + IPV6_HEADER_SIZE; + private static final int IPV6_JUMBO_HEADER_OFFSET = IPV6_HEADER_LIMIT; + private static final int IPV6_JUMBO_HEADER_SIZE = 8; private static final int TCP_HEADER_OFFSET = IPV6_HEADER_LIMIT; private static final int TCP_HEADER_SIZE = 20; @@ -122,7 +133,9 @@ public final class ZillaDumpCommand extends ZillaCommand private static final int ZILLA_HEADER_OFFSET = TCP_HEADER_LIMIT; private static final int ZILLA_PROTOCOL_TYPE_OFFSET = ZILLA_HEADER_OFFSET + 4; - private static final int ZILLA_HEADER_SIZE = 8; + private static final int ZILLA_WORKER_OFFSET = ZILLA_PROTOCOL_TYPE_OFFSET + 4; + private static final int ZILLA_OFFSET_OFFSET = ZILLA_WORKER_OFFSET + 4; + private static final int ZILLA_HEADER_SIZE = 16; private static final int ZILLA_HEADER_LIMIT = ZILLA_HEADER_OFFSET + ZILLA_HEADER_SIZE; private static final int TYPE_ID_INDEX = 0; @@ -149,8 +162,13 @@ public final class ZillaDumpCommand extends ZillaCommand description = "Dump specific namespaced bindings only, e.g example.http0,example.kafka0") public List bindings = new ArrayList<>(); - @Option(name = {"-o", "--output"}, - description = "PCAP output filename", + @Option(name = {"-i", "--install"}, + description = "Install Zilla dissector to Wireshark plugin directory", + typeConverterProvider = ZillaDumpCommandPathConverterProvider.class) + public Path pluginDirectory; + + @Option(name = {"-w", "--write"}, + description = "Write output to PCAP file", typeConverterProvider = ZillaDumpCommandPathConverterProvider.class) public Path output; @@ -168,6 +186,11 @@ public final class ZillaDumpCommand extends ZillaCommand hidden = true) public String propertiesPath; + @Option(name = "-e", + description = "Show exception traces", + hidden = true) + public boolean exceptions; + boolean continuous = true; private final FrameFW frameRO = new FrameFW(); @@ -190,6 +213,7 @@ public final class ZillaDumpCommand extends ZillaCommand private final FlushFW.Builder flushRW = new FlushFW.Builder(); private final ChallengeFW.Builder challengeRW = new ChallengeFW.Builder(); private final IPv6HeaderFW.Builder ipv6HeaderRW = new IPv6HeaderFW.Builder(); + private final IPv6JumboHeaderFW.Builder ipv6JumboHeaderRW = new IPv6JumboHeaderFW.Builder(); private final TcpHeaderFW.Builder tcpHeaderRW = new TcpHeaderFW.Builder(); private final MutableDirectBuffer patchBuffer; private final MutableDirectBuffer writeBuffer; @@ -198,13 +222,37 @@ public final class ZillaDumpCommand extends ZillaCommand public ZillaDumpCommand() { - this.patchBuffer = new UnsafeBuffer(ByteBuffer.allocate(BUFFER_SLOT_CAPACITY)); - this.writeBuffer = new UnsafeBuffer(ByteBuffer.allocate(BUFFER_SLOT_CAPACITY)); + this.patchBuffer = new UnsafeBuffer(ByteBuffer.allocate(PATCH_BUFFER_SLOT_CAPACITY)); + this.writeBuffer = new UnsafeBuffer(ByteBuffer.allocate(WRITE_BUFFER_SLOT_CAPACITY)); } @Override public void run() { + if (pluginDirectory != null) + { + try + { + InputStream is = getClass().getResourceAsStream("zilla.lua"); + Files.createDirectories(pluginDirectory); + Path target = pluginDirectory.resolve("zilla.lua"); + Files.copy(is, target, StandardCopyOption.REPLACE_EXISTING); + if (verbose) + { + System.out.printf("Copied Wireshark plugin to the directory: %s%n", pluginDirectory); + } + } + catch (Exception ex) + { + System.out.printf("Failed to copy the Wireshark plugin to the directory: %s%n", pluginDirectory); + if (exceptions) + { + ex.printStackTrace(); + } + rethrowUnchecked(ex); + } + } + Properties props = new Properties(); props.setProperty(ENGINE_DIRECTORY.name(), ".zilla/engine"); @@ -215,9 +263,13 @@ public void run() { props.load(Files.newInputStream(path)); } - catch (IOException ex) + catch (Exception ex) { - System.out.println("Failed to load properties: " + path); + System.out.printf("Failed to load properties: %s%n", path); + if (exceptions) + { + ex.printStackTrace(); + } rethrowUnchecked(ex); } } @@ -252,6 +304,7 @@ public void run() { final RingBufferSpy[] streamBuffers = files .filter(this::isStreamsFile) + .sorted() .peek(this::onDiscovered) .map(this::createStreamBuffer) .collect(Collectors.toList()) @@ -260,8 +313,11 @@ public void run() final IdleStrategy idleStrategy = new BackoffIdleStrategy(MAX_SPINS, MAX_YIELDS, MIN_PARK_NS, MAX_PARK_NS); final BindingsLayoutReader bindings = BindingsLayoutReader.builder().directory(directory).build(); - final DumpHandler dumpHandler = new DumpHandler(filter, labels::lookupLabel, bindings.bindings()::get, writer); - final MessagePredicate spyHandler = dumpHandler::handleFrame; + final DumpHandler[] dumpHandlers = new DumpHandler[streamBufferCount]; + for (int i = 0; i < streamBufferCount; i++) + { + dumpHandlers[i] = new DumpHandler(i, filter, labels::lookupLabel, bindings.bindings()::get, writer); + } final MutableDirectBuffer buffer = writeBuffer; encodePcapGlobal(buffer); @@ -275,13 +331,18 @@ public void run() for (int i = 0; i < streamBufferCount; i++) { final RingBufferSpy streamBuffer = streamBuffers[i]; + MessagePredicate spyHandler = dumpHandlers[i]::handleFrame; workCount += streamBuffer.spy(spyHandler, 1); } idleStrategy.idle(workCount); } while (workCount != exitWorkCount); } - catch (IOException ex) + catch (Exception ex) { + if (exceptions) + { + ex.printStackTrace(); + } rethrowUnchecked(ex); } } @@ -319,7 +380,7 @@ private void onDiscovered( { if (verbose) { - System.out.printf("Discovered: %s\n", path); + System.out.printf("Discovered: %s%n", path); } } @@ -351,9 +412,13 @@ private void writePcapOutput( byteBuf.limit(offset + length); writer.write(byteBuf); } - catch (IOException ex) + catch (Exception ex) { - System.out.println("Could not write to file. Reason: " + ex.getMessage()); + System.out.printf("Could not write to file. Reason: %s%n", ex.getMessage()); + if (exceptions) + { + ex.printStackTrace(); + } rethrowUnchecked(ex); } } @@ -372,6 +437,7 @@ private static int localId( private final class DumpHandler { + private final int worker; private final LongPredicate allowedBinding; private final WritableByteChannel writer; private final IntFunction lookupLabel; @@ -385,11 +451,13 @@ private final class DumpHandler private long nextTimestamp = Long.MAX_VALUE; private DumpHandler( + int worker, LongPredicate allowedBinding, IntFunction lookupLabel, Function lookupBindingInfo, WritableByteChannel writer) { + this.worker = worker; this.allowedBinding = allowedBinding; this.lookupLabel = lookupLabel; this.lookupBindingInfo = lookupBindingInfo; @@ -471,14 +539,15 @@ private void onBegin( { if (allowedBinding.test(begin.routedId())) { + int offset = begin.offset() - HEADER_LENGTH; final BeginFW newBegin = beginRW.wrap(patchBuffer, 0, begin.sizeof()).set(begin).build(); final ExtensionFW extension = newBegin.extension().get(extensionRO::tryWrap); patchExtension(patchBuffer, extension, BeginFW.FIELD_OFFSET_EXTENSION); final boolean initial = begin.streamId() % 2 != 0; short tcpFlags = initial ? PSH_ACK_SYN : PSH_ACK; - writeFrame(BeginFW.TYPE_ID, newBegin.originId(), newBegin.routedId(), newBegin.streamId(), newBegin.timestamp(), - newBegin, tcpFlags); + writeFrame(BeginFW.TYPE_ID, worker, offset, newBegin.originId(), newBegin.routedId(), newBegin.streamId(), + newBegin.timestamp(), newBegin, tcpFlags); } } @@ -487,12 +556,14 @@ private void onData( { if (allowedBinding.test(data.routedId())) { + int offset = data.offset() - HEADER_LENGTH; final DataFW newData = dataRW.wrap(patchBuffer, 0, data.sizeof()).set(data).build(); final ExtensionFW extension = newData.extension().get(extensionRO::tryWrap); - patchExtension(patchBuffer, extension, DataFW.FIELD_OFFSET_EXTENSION); + int extensionOffset = DataFW.FIELD_OFFSET_PAYLOAD + Math.max(newData.length(), 0) + DataFW.FIELD_OFFSET_EXTENSION; + patchExtension(patchBuffer, extension, extensionOffset); - writeFrame(DataFW.TYPE_ID, newData.originId(), newData.routedId(), newData.streamId(), newData.timestamp(), - newData, PSH_ACK); + writeFrame(DataFW.TYPE_ID, worker, offset, newData.originId(), newData.routedId(), newData.streamId(), + newData.timestamp(), newData, PSH_ACK); } } @@ -501,12 +572,13 @@ private void onEnd( { if (allowedBinding.test(end.routedId())) { + int offset = end.offset() - HEADER_LENGTH; final EndFW newEnd = endRW.wrap(patchBuffer, 0, end.sizeof()).set(end).build(); final ExtensionFW extension = newEnd.extension().get(extensionRO::tryWrap); patchExtension(patchBuffer, extension, EndFW.FIELD_OFFSET_EXTENSION); - writeFrame(EndFW.TYPE_ID, newEnd.originId(), newEnd.routedId(), newEnd.streamId(), newEnd.timestamp(), - newEnd, PSH_ACK_FIN); + writeFrame(EndFW.TYPE_ID, worker, offset, newEnd.originId(), newEnd.routedId(), newEnd.streamId(), + newEnd.timestamp(), newEnd, PSH_ACK_FIN); } } @@ -515,12 +587,13 @@ private void onAbort( { if (allowedBinding.test(abort.routedId())) { + int offset = abort.offset() - HEADER_LENGTH; final AbortFW newAbort = abortRW.wrap(patchBuffer, 0, abort.sizeof()).set(abort).build(); final ExtensionFW extension = newAbort.extension().get(extensionRO::tryWrap); patchExtension(patchBuffer, extension, AbortFW.FIELD_OFFSET_EXTENSION); - writeFrame(AbortFW.TYPE_ID, newAbort.originId(), newAbort.routedId(), newAbort.streamId(), newAbort.timestamp(), - newAbort, PSH_ACK_FIN); + writeFrame(AbortFW.TYPE_ID, worker, offset, newAbort.originId(), newAbort.routedId(), newAbort.streamId(), + newAbort.timestamp(), newAbort, PSH_ACK_FIN); } } @@ -529,8 +602,9 @@ private void onWindow( { if (allowedBinding.test(window.routedId())) { - writeFrame(WindowFW.TYPE_ID, window.originId(), window.routedId(), window.streamId(), window.timestamp(), window, - PSH_ACK); + int offset = window.offset() - HEADER_LENGTH; + writeFrame(WindowFW.TYPE_ID, worker, offset, window.originId(), window.routedId(), window.streamId(), + window.timestamp(), window, PSH_ACK); } } @@ -539,12 +613,13 @@ private void onReset( { if (allowedBinding.test(reset.routedId())) { + int offset = reset.offset() - HEADER_LENGTH; final ResetFW newReset = resetRW.wrap(patchBuffer, 0, reset.sizeof()).set(reset).build(); final ExtensionFW extension = newReset.extension().get(extensionRO::tryWrap); patchExtension(patchBuffer, extension, ResetFW.FIELD_OFFSET_EXTENSION); - writeFrame(ResetFW.TYPE_ID, newReset.originId(), newReset.routedId(), newReset.streamId(), newReset.timestamp(), - newReset, PSH_ACK_FIN); + writeFrame(ResetFW.TYPE_ID, worker, offset, newReset.originId(), newReset.routedId(), newReset.streamId(), + newReset.timestamp(), newReset, PSH_ACK_FIN); } } @@ -553,12 +628,13 @@ private void onFlush( { if (allowedBinding.test(flush.routedId())) { + int offset = flush.offset() - HEADER_LENGTH; final FlushFW newFlush = flushRW.wrap(patchBuffer, 0, flush.sizeof()).set(flush).build(); final ExtensionFW extension = newFlush.extension().get(extensionRO::tryWrap); patchExtension(patchBuffer, extension, FlushFW.FIELD_OFFSET_EXTENSION); - writeFrame(FlushFW.TYPE_ID, newFlush.originId(), newFlush.routedId(), newFlush.streamId(), newFlush.timestamp(), - newFlush, PSH_ACK); + writeFrame(FlushFW.TYPE_ID, worker, offset, newFlush.originId(), newFlush.routedId(), newFlush.streamId(), + newFlush.timestamp(), newFlush, PSH_ACK); } } @@ -567,8 +643,9 @@ private void onSignal( { if (allowedBinding.test(signal.routedId())) { - writeFrame(SignalFW.TYPE_ID, signal.originId(), signal.routedId(), signal.streamId(), signal.timestamp(), signal, - PSH_ACK); + int offset = signal.offset() - HEADER_LENGTH; + writeFrame(SignalFW.TYPE_ID, worker, offset, signal.originId(), signal.routedId(), signal.streamId(), + signal.timestamp(), signal, PSH_ACK); } } @@ -577,12 +654,13 @@ private void onChallenge( { if (allowedBinding.test(challenge.routedId())) { + int offset = challenge.offset() - HEADER_LENGTH; final ChallengeFW newChallenge = challengeRW.wrap(patchBuffer, 0, challenge.sizeof()).set(challenge).build(); final ExtensionFW extension = newChallenge.extension().get(extensionRO::tryWrap); patchExtension(patchBuffer, extension, ChallengeFW.FIELD_OFFSET_EXTENSION); - writeFrame(ChallengeFW.TYPE_ID, newChallenge.originId(), newChallenge.routedId(), newChallenge.streamId(), - newChallenge.timestamp(), newChallenge, PSH_ACK); + writeFrame(ChallengeFW.TYPE_ID, worker, offset, newChallenge.originId(), newChallenge.routedId(), + newChallenge.streamId(), newChallenge.timestamp(), newChallenge, PSH_ACK); } } @@ -634,6 +712,8 @@ private byte[] resolveLabelAsBytes( private void writeFrame( int frameTypeId, + int worker, + int offset, long originId, long routedId, long streamId, @@ -644,22 +724,24 @@ private void writeFrame( final int labelsLength = encodeZillaLabels(labelsBuffer, originId, routedId); final int tcpSegmentLength = ZILLA_HEADER_SIZE + labelsLength + frame.sizeof(); final int ipv6Length = TCP_HEADER_SIZE + tcpSegmentLength; - final int pcapLength = ETHER_HEADER_SIZE + IPV6_HEADER_SIZE + ipv6Length; + final boolean jumbo = ipv6Length > IPV6_JUMBO_THRESHOLD; + final int ipv6JumboLength = jumbo ? IPV6_JUMBO_HEADER_SIZE : 0; + final int pcapLength = ETHER_HEADER_SIZE + IPV6_HEADER_SIZE + ipv6Length + ipv6JumboLength; encodePcapHeader(writeBuffer, pcapLength, timestamp); encodeEtherHeader(writeBuffer); - encodeIpv6Header(writeBuffer, streamId ^ 1L, streamId, ipv6Length); + encodeIpv6Header(writeBuffer, jumbo, streamId ^ 1L, streamId, ipv6Length); final boolean initial = streamId % 2 != 0; final long seq = sequence.get(streamId); final long ack = sequence.get(streamId ^ 1L); sequence.put(streamId, sequence.get(streamId) + tcpSegmentLength); - encodeTcpHeader(writeBuffer, initial, seq, ack, tcpFlags); + encodeTcpHeader(writeBuffer, ipv6JumboLength, initial, seq, ack, tcpFlags); final int protocolTypeId = resolveProtocolTypeId(originId, routedId); - encodeZillaHeader(writeBuffer, frameTypeId, protocolTypeId); + encodeZillaHeader(writeBuffer, ipv6JumboLength, frameTypeId, protocolTypeId, worker, offset); - writePcapOutput(writer, writeBuffer, PCAP_HEADER_OFFSET, ZILLA_HEADER_LIMIT); + writePcapOutput(writer, writeBuffer, PCAP_HEADER_OFFSET, ZILLA_HEADER_LIMIT + ipv6JumboLength); writePcapOutput(writer, labelsBuffer, 0, labelsLength); writePcapOutput(writer, frame.buffer(), frame.offset(), frame.sizeof()); } @@ -704,28 +786,52 @@ private void encodePcapHeader( private void encodeEtherHeader( MutableDirectBuffer buffer) { - buffer.putBytes(ETHER_HEADER_OFFSET, PSEUDO_ETHERNET_FRAME); + buffer.putBytes(ETHER_HEADER_OFFSET, ETHERNET_FRAME); } private void encodeIpv6Header( MutableDirectBuffer buffer, + boolean jumbo, long source, long destination, int payloadLength) { - ipv6HeaderRW.wrap(buffer, IPV6_HEADER_OFFSET, buffer.capacity()) - .prefix(PSEUDO_IPV6_PREFIX) - .payload_length((short) payloadLength) - .next_header_and_hop_limit(PSEUDO_NEXT_HEADER_AND_HOP_LIMIT) - .src_addr_part1(IPV6_LOCAL_ADDRESS) - .src_addr_part2(source) - .dst_addr_part1(IPV6_LOCAL_ADDRESS) - .dst_addr_part2(destination) - .build(); + long addrPart1 = IPV6_LOCAL_ADDRESS | worker; + if (jumbo) + { + ipv6HeaderRW.wrap(buffer, IPV6_HEADER_OFFSET, buffer.capacity()) + .prefix(IPV6_PREFIX) + .payload_length((short) 0) + .next_header(IPV6_NEXT_HEADER_JUMBO) + .hop_limit(IPV6_HOP_LIMIT) + .src_addr_part1(addrPart1) + .src_addr_part2(source) + .dst_addr_part1(addrPart1) + .dst_addr_part2(destination) + .build(); + ipv6JumboHeaderRW.wrap(buffer, IPV6_JUMBO_HEADER_OFFSET, buffer.capacity()) + .prefix(IPV6_JUMBO_PREFIX) + .payload_length(payloadLength + IPV6_JUMBO_HEADER_SIZE) + .build(); + } + else + { + ipv6HeaderRW.wrap(buffer, IPV6_HEADER_OFFSET, buffer.capacity()) + .prefix(IPV6_PREFIX) + .payload_length((short) payloadLength) + .next_header(IPV6_NEXT_HEADER_TCP) + .hop_limit(IPV6_HOP_LIMIT) + .src_addr_part1(addrPart1) + .src_addr_part2(source) + .dst_addr_part1(addrPart1) + .dst_addr_part2(destination) + .build(); + } } private void encodeTcpHeader( MutableDirectBuffer buffer, + int ipv6JumboLength, boolean initial, long sequence, long acknowledge, @@ -735,7 +841,7 @@ private void encodeTcpHeader( short sourcePort = initial ? TCP_SRC_PORT : TCP_DEST_PORT; short destPort = initial ? TCP_DEST_PORT : TCP_SRC_PORT; - tcpHeaderRW.wrap(buffer, TCP_HEADER_OFFSET, buffer.capacity()) + tcpHeaderRW.wrap(buffer, TCP_HEADER_OFFSET + ipv6JumboLength, buffer.capacity()) .src_port(sourcePort) .dst_port(destPort) .sequence_number((int) sequence) @@ -749,11 +855,16 @@ private void encodeTcpHeader( private void encodeZillaHeader( MutableDirectBuffer buffer, + int ipv6JumboLength, int frameTypeId, - int protocolTypeId) + int protocolTypeId, + int worker, + int offset) { - buffer.putInt(ZILLA_HEADER_OFFSET, frameTypeId); - buffer.putInt(ZILLA_PROTOCOL_TYPE_OFFSET, protocolTypeId); + buffer.putInt(ZILLA_HEADER_OFFSET + ipv6JumboLength, frameTypeId); + buffer.putInt(ZILLA_PROTOCOL_TYPE_OFFSET + ipv6JumboLength, protocolTypeId); + buffer.putInt(ZILLA_WORKER_OFFSET + ipv6JumboLength, worker); + buffer.putInt(ZILLA_OFFSET_OFFSET + ipv6JumboLength, offset); } private int encodeZillaLabels( diff --git a/incubator/command-dump/src/main/lua/zilla.lua b/incubator/command-dump/src/main/lua/zilla.lua deleted file mode 100644 index fc5d06ac36..0000000000 --- a/incubator/command-dump/src/main/lua/zilla.lua +++ /dev/null @@ -1,418 +0,0 @@ ---[[ - - Copyright 2021-2023 Aklivity Inc - - Licensed under the Aklivity Community License (the "License"); you may not use - this file except in compliance with the License. You may obtain a copy of the - License at - - https://www.aklivity.io/aklivity-community-license/ - - Unless required by applicable law or agreed to in writing, software - distributed under the License is distributed on an "AS IS" BASIS, WITHOUT - WARRANTIES OF ANY KIND, either express or implied. See the License for the - specific language governing permissions and limitations under the License. - -]] -zilla_protocol = Proto("Zilla", "Zilla Frames") - -HEADER_OFFSET = 0 -LABELS_OFFSET = 8 - -BEGIN_ID = 0x00000001 -DATA_ID = 0x00000002 -END_ID = 0x00000003 -ABORT_ID = 0x00000004 -FLUSH_ID = 0x00000005 -RESET_ID = 0x40000001 -WINDOW_ID = 0x40000002 -SIGNAL_ID = 0x40000003 -CHALLENGE_ID = 0x40000004 - -AMQP_ID = 0x112dc182 -GRPC_ID = 0xf9c7583a -HTTP_ID = 0x8ab62046 -KAFKA_ID = 0x084b20e1 -MQTT_ID = 0xd0d41a76 -PROXY_ID = 0x8dcea850 -TLS_ID = 0x99f321bc - -local flags_types = { - [0] = "Not set", - [1] = "Set" -} - -local fields = { - -- header - frame_type_id = ProtoField.uint32("zilla.frame_type_id", "Frame Type ID", base.HEX), - frame_type = ProtoField.string("zilla.frame_type", "Frame Type", base.NONE), - protocol_type_id = ProtoField.uint32("zilla.protocol_type_id", "Protocol Type ID", base.HEX), - protocol_type = ProtoField.string("zilla.protocol_type", "Protocol Type", base.NONE), - stream_type_id = ProtoField.uint32("zilla.stream_type_id", "Stream Type ID", base.HEX), - stream_type = ProtoField.string("zilla.stream_type", "Stream Type", base.NONE), - - -- labels - origin_namespace = ProtoField.string("zilla.origin_namespace", "Origin Namespace", base.STRING), - origin_binding = ProtoField.string("zilla.origin_binding", "Origin Binding", base.STRING), - routed_namespace = ProtoField.string("zilla.routed_namespace", "Routed Namespace", base.STRING), - routed_binding = ProtoField.string("zilla.routed_binding", "Routed Binding", base.STRING), - - -- all frames - origin_id = ProtoField.uint64("zilla.origin_id", "Origin ID", base.HEX), - routed_id = ProtoField.uint64("zilla.routed_id", "Routed ID", base.HEX), - stream_id = ProtoField.uint64("zilla.stream_id", "Stream ID", base.HEX), - direction = ProtoField.string("zilla.direction", "Direction", base.NONE), - initial_id = ProtoField.uint64("zilla.initial_id", "Initial ID", base.HEX), - reply_id = ProtoField.uint64("zilla.reply_id", "Reply ID", base.HEX), - sequence = ProtoField.int64("zilla.sequence", "Sequence", base.DEC), - acknowledge = ProtoField.int64("zilla.acknowledge", "Acknowledge", base.DEC), - maximum = ProtoField.int32("zilla.maximum", "Maximum", base.DEC), - timestamp = ProtoField.uint64("zilla.timestamp", "Timestamp", base.HEX), - trace_id = ProtoField.uint64("zilla.trace_id", "Trace ID", base.HEX), - authorization = ProtoField.uint64("zilla.authorization", "Authorization", base.HEX), - - -- almost all frames - extension = ProtoField.bytes("zilla.extension", "Extension", base.NONE), - - -- begin frame - affinity = ProtoField.uint64("zilla.affinity", "Affinity", base.HEX), - - -- data frame - flags = ProtoField.uint8("zilla.flags", "Flags", base.HEX), - flags_fin = ProtoField.uint8("zilla.flags_fin", "FIN", base.DEC, flags_types, 0x01), - flags_init = ProtoField.uint8("zilla.flags_init", "INIT", base.DEC, flags_types, 0x02), - flags_incomplete = ProtoField.uint8("zilla.flags_incomplete", "INCOMPLETE", base.DEC, flags_types, 0x04), - flags_skip = ProtoField.uint8("zilla.flags_skip", "SKIP", base.DEC, flags_types, 0x08), - budget_id = ProtoField.uint64("zilla.budget_id", "Budget ID", base.HEX), - reserved = ProtoField.int32("zilla.reserved", "Reserved", base.DEC), - length = ProtoField.int32("zilla.length", "Length", base.DEC), - progress = ProtoField.int64("zilla.progress", "Progress", base.DEC), - progress_maximum = ProtoField.string("zilla.progress_maximum", "Progress/Maximum", base.NONE), - payload = ProtoField.protocol("zilla.payload", "Payload", base.HEX), - - -- window frame - padding = ProtoField.int32("zilla.padding", "Padding", base.DEC), - minimum = ProtoField.int32("zilla.minimum", "Minimum", base.DEC), - capabilities = ProtoField.uint8("zilla.capabilities", "Capabilities", base.HEX), - - -- signal frame - cancel_id = ProtoField.uint64("zilla.cancel_id", "Cancel ID", base.HEX), - signal_id = ProtoField.int32("zilla.signal_id", "Signal ID", base.DEC), - context_id = ProtoField.int32("zilla.context_id", "Context ID", base.DEC), -} - -zilla_protocol.fields = fields; - -function zilla_protocol.dissector(buffer, pinfo, tree) - if buffer:len() == 0 then return end - - local subtree = tree:add(zilla_protocol, buffer(), "Zilla Frame") - local slices = {} - - -- header - slices.frame_type_id = buffer(HEADER_OFFSET, 4) - local frame_type_id = slices.frame_type_id:le_uint() - local frame_type = resolve_frame_type(frame_type_id) - subtree:add_le(fields.frame_type_id, slices.frame_type_id) - subtree:add(fields.frame_type, frame_type) - - slices.protocol_type_id = buffer(HEADER_OFFSET + 4, 4) - local protocol_type_id = slices.protocol_type_id:le_uint() - local protocol_type = resolve_type(protocol_type_id) - subtree:add_le(fields.protocol_type_id, slices.protocol_type_id) - subtree:add(fields.protocol_type, protocol_type) - - -- labels - slices.labels_length = buffer(LABELS_OFFSET, 4) - local labels_length = slices.labels_length:le_uint() - slices.labels = buffer(LABELS_OFFSET + 4, labels_length) - - -- origin id - local frame_offset = LABELS_OFFSET + labels_length - slices.origin_id = buffer(frame_offset + 4, 8) - subtree:add_le(fields.origin_id, slices.origin_id) - - local label_offset = LABELS_OFFSET + 4; - local origin_namespace_length = buffer(label_offset, 4):le_uint() - label_offset = label_offset + 4 - slices.origin_namespace = buffer(label_offset, origin_namespace_length) - label_offset = label_offset + origin_namespace_length - if (origin_namespace_length > 0) then - subtree:add(fields.origin_namespace, slices.origin_namespace) - end - - local origin_binding_length = buffer(label_offset, 4):le_uint() - label_offset = label_offset + 4 - slices.origin_binding = buffer(label_offset, origin_binding_length) - label_offset = label_offset + origin_binding_length - if (origin_binding_length > 0) then - subtree:add(fields.origin_binding, slices.origin_binding) - end - - -- routed id - slices.routed_id = buffer(frame_offset + 12, 8) - subtree:add_le(fields.routed_id, slices.routed_id) - - local routed_namespace_length = buffer(label_offset, 4):le_uint() - label_offset = label_offset + 4 - slices.routed_namespace = buffer(label_offset, routed_namespace_length) - label_offset = label_offset + routed_namespace_length - if (routed_namespace_length > 0) then - subtree:add(fields.routed_namespace, slices.routed_namespace) - end - - local routed_binding_length = buffer(label_offset, 4):le_uint() - label_offset = label_offset + 4 - slices.routed_binding = buffer(label_offset, routed_binding_length) - label_offset = label_offset + routed_binding_length - if (routed_binding_length > 0) then - subtree:add(fields.routed_binding, slices.routed_binding) - end - - -- stream id - slices.stream_id = buffer(frame_offset + 20, 8) - subtree:add_le(fields.stream_id, slices.stream_id) - local stream_id = slices.stream_id:le_uint64(); - local direction - local initial_id - local reply_id - if stream_id == UInt64(0) then - direction = "" - else - if (stream_id % 2) == UInt64(0) then - direction = "REP" - initial_id = stream_id + UInt64(1) - reply_id = stream_id - else - direction = "INI" - initial_id = stream_id - reply_id = stream_id - UInt64(1) - end - subtree:add(fields.initial_id, initial_id) - subtree:add(fields.reply_id, reply_id) - end - subtree:add(fields.direction, direction) - - -- more frame properties - slices.sequence = buffer(frame_offset + 28, 8) - subtree:add_le(fields.sequence, slices.sequence) - slices.acknowledge = buffer(frame_offset + 36, 8) - subtree:add_le(fields.acknowledge, slices.acknowledge) - slices.maximum = buffer(frame_offset + 44, 4) - subtree:add_le(fields.maximum, slices.maximum) - slices.timestamp = buffer(frame_offset + 48, 8) - subtree:add_le(fields.timestamp, slices.timestamp) - slices.trace_id = buffer(frame_offset + 56, 8) - subtree:add_le(fields.trace_id, slices.trace_id) - slices.authorization = buffer(frame_offset + 64, 8) - subtree:add_le(fields.authorization, slices.authorization) - - pinfo.cols.protocol = zilla_protocol.name - local info = "ZILLA " .. frame_type .. " " .. direction - if protocol_type and protocol_type ~= "" then - info = info .. " p=" .. protocol_type - end - pinfo.cols.info:set(info) - - -- begin - if frame_type_id == BEGIN_ID then - slices.affinity = buffer(frame_offset + 72, 8) - subtree:add_le(fields.affinity, slices.affinity) - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 80) - end - - -- data - if frame_type_id == DATA_ID then - slices.flags = buffer(frame_offset + 72, 1) - local flags_label = string.format("Flags: 0x%02x", slices.flags:le_uint()) - local flagsSubtree = subtree:add(zilla_protocol, buffer(), flags_label) - flagsSubtree:add_le(fields.flags_fin, slices.flags) - flagsSubtree:add_le(fields.flags_init, slices.flags) - flagsSubtree:add_le(fields.flags_incomplete, slices.flags) - flagsSubtree:add_le(fields.flags_skip, slices.flags) - slices.budget_id = buffer(frame_offset + 73, 8) - subtree:add_le(fields.budget_id, slices.budget_id) - slices.reserved = buffer(frame_offset + 81, 4) - subtree:add_le(fields.reserved, slices.reserved) - - local sequence = slices.sequence:le_int64(); - local acknowledge = slices.acknowledge:le_int64(); - local maximum = slices.maximum:le_int(); - local reserved = slices.reserved:le_int(); - local progress = sequence - acknowledge + reserved; - local progress_maximum = progress .. "/" .. maximum - subtree:add(fields.progress, progress) - subtree:add(fields.progress_maximum, progress_maximum) - pinfo.cols.info:set(info .. " [" .. progress_maximum .. "]") - - local payloadSubtree = subtree:add(zilla_protocol, buffer(), "Payload") - slices.length = buffer(frame_offset + 85, 4) - local length = slices.length:le_int() - slices.payload = buffer(frame_offset + 89, length) - payloadSubtree:add_le(fields.length, slices.length) - payloadSubtree:add(fields.payload, slices.payload) - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 89 + length) - - local dissector = resolve_dissector(protocol_type, slices.payload:tvb()) - if dissector then - dissector:call(slices.payload:tvb(), pinfo, tree) - end - end - - -- end - if frame_type_id == END_ID then - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 72) - end - - -- abort - if frame_type_id == ABORT_ID then - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 72) - end - - -- flush - if frame_type_id == FLUSH_ID then - slices.budget_id = buffer(frame_offset + 72, 8) - subtree:add_le(fields.budget_id, slices.budget_id) - slices.reserved = buffer(frame_offset + 80, 4) - subtree:add_le(fields.reserved, slices.reserved) - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 84) - end - - -- reset - if frame_type_id == RESET_ID then - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 72) - end - - -- window - if frame_type_id == WINDOW_ID then - slices.budget_id = buffer(frame_offset + 72, 8) - subtree:add_le(fields.budget_id, slices.budget_id) - slices.padding = buffer(frame_offset + 80, 4) - subtree:add_le(fields.padding, slices.padding) - slices.minimum = buffer(frame_offset + 84, 4) - subtree:add_le(fields.minimum, slices.minimum) - slices.capabilities = buffer(frame_offset + 88, 1) - subtree:add_le(fields.capabilities, slices.capabilities) - - local sequence = slices.sequence:le_int64(); - local acknowledge = slices.acknowledge:le_int64(); - local maximum = slices.maximum:le_int(); - local progress = sequence - acknowledge; - local progress_maximum = progress .. "/" .. maximum - subtree:add(fields.progress, progress) - subtree:add(fields.progress_maximum, progress_maximum) - - pinfo.cols.info:set(info .. " [" .. progress_maximum .. "]") - end - - -- signal - if frame_type_id == SIGNAL_ID then - slices.cancel_id = buffer(frame_offset + 72, 8) - subtree:add_le(fields.cancel_id, slices.cancel_id) - slices.signal_id = buffer(frame_offset + 80, 4) - subtree:add_le(fields.signal_id, slices.signal_id) - slices.context_id = buffer(frame_offset + 84, 4) - subtree:add_le(fields.context_id, slices.context_id) - - local payloadSubtree = subtree:add(zilla_protocol, buffer(), "Payload") - slices.length = buffer(frame_offset + 88, 4) - local length = slices.length:le_int() - slices.payload = buffer(frame_offset + 92, length) - payloadSubtree:add_le(fields.length, slices.length) - payloadSubtree:add(fields.payload, slices.payload) - end - - -- challenge - if frame_type_id == CHALLENGE_ID then - handle_extension(buffer, slices, subtree, pinfo, info, frame_offset + 72) - end -end - -function resolve_frame_type(frame_type_id) - local frame_type = "" - if frame_type_id == BEGIN_ID then frame_type = "BEGIN" - elseif frame_type_id == DATA_ID then frame_type = "DATA" - elseif frame_type_id == END_ID then frame_type = "END" - elseif frame_type_id == ABORT_ID then frame_type = "ABORT" - elseif frame_type_id == FLUSH_ID then frame_type = "FLUSH" - elseif frame_type_id == RESET_ID then frame_type = "RESET" - elseif frame_type_id == WINDOW_ID then frame_type = "WINDOW" - elseif frame_type_id == SIGNAL_ID then frame_type = "SIGNAL" - elseif frame_type_id == CHALLENGE_ID then frame_type = "CHALLENGE" - end - return frame_type -end - -function handle_extension(buffer, slices, subtree, pinfo, info, offset) - if buffer:len() > offset then - local extensionSubtree = subtree:add(zilla_protocol, buffer(), "Extension") - slices.stream_type_id = buffer(offset, 4) - extensionSubtree:add(fields.stream_type_id, slices.stream_type_id) - - local stream_type_id = slices.stream_type_id:le_uint(); - local stream_type = resolve_type(stream_type_id) - extensionSubtree:add(fields.stream_type, stream_type) - - slices.extension = buffer(offset) - extensionSubtree:add(fields.extension, slices.extension) - - if stream_type and stream_type ~= "" then - pinfo.cols.info:set(info .. " s=" .. stream_type) - end - end -end - -function resolve_type(type_id) - local type = "" - if type_id == AMQP_ID then type = "amqp" - elseif type_id == GRPC_ID then type = "grpc" - elseif type_id == HTTP_ID then type = "http" - elseif type_id == KAFKA_ID then type = "kafka" - elseif type_id == MQTT_ID then type = "mqtt" - elseif type_id == PROXY_ID then type = "proxy" - elseif type_id == TLS_ID then type = "tls" - end - return type -end - -function resolve_dissector(protocol_type, payload) - local dissector - if protocol_type == "amqp" then dissector = Dissector.get("amqp") - elseif protocol_type == "http" then dissector = resolve_http_dissector(payload) - elseif protocol_type == "kafka" then dissector = Dissector.get("kafka") - elseif protocol_type == "mqtt" then dissector = Dissector.get("mqtt") - elseif protocol_type == "tls" then dissector = Dissector.get("tls") - end - return dissector -end - -function resolve_http_dissector(payload) - if payload:range(0, 3):int() + 9 == payload:len() then - return Dissector.get("http2") - elseif payload:range(0, 3):string() == "PRI" then - return Dissector.get("http2") - elseif payload:range(0, 4):string() == "HTTP" then - return Dissector.get("http") - elseif payload:range(0, 3):string() == "GET" then - return Dissector.get("http") - elseif payload:range(0, 4):string() == "POST" then - return Dissector.get("http") - elseif payload:range(0, 3):string() == "PUT" then - return Dissector.get("http") - elseif payload:range(0, 6):string() == "DELETE" then - return Dissector.get("http") - elseif payload:range(0, 4):string() == "HEAD" then - return Dissector.get("http") - elseif payload:range(0, 7):string() == "OPTIONS" then - return Dissector.get("http") - elseif payload:range(0, 5):string() == "TRACE" then - return Dissector.get("http") - elseif payload:range(0, 7):string() == "CONNECT" then - return Dissector.get("http") - else - return nil - end -end - -local data_dissector = DissectorTable.get("tcp.port") -data_dissector:add(7114, zilla_protocol) diff --git a/incubator/command-dump/src/main/resources/META-INF/zilla/pcap.idl b/incubator/command-dump/src/main/resources/META-INF/zilla/pcap.idl index fdc017d8f2..7b3089f255 100644 --- a/incubator/command-dump/src/main/resources/META-INF/zilla/pcap.idl +++ b/incubator/command-dump/src/main/resources/META-INF/zilla/pcap.idl @@ -39,13 +39,20 @@ scope pcap { int32 prefix; /* Version + Traffic class + Flow label = 32 bit */ int16 payload_length; - int16 next_header_and_hop_limit; + int8 next_header; + int8 hop_limit; int64 src_addr_part1; int64 src_addr_part2; int64 dst_addr_part1; int64 dst_addr_part2; } + struct IPv6JumboHeader + { + int32 prefix; /* Next Header + Header Ext Length + Option Type + Option Data Length */ + int32 payload_length; + } + struct TcpHeader { int16 src_port; diff --git a/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua b/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua new file mode 100644 index 0000000000..aa03292610 --- /dev/null +++ b/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua @@ -0,0 +1,656 @@ +--[[ + + Copyright 2021-2023 Aklivity Inc + + Licensed under the Aklivity Community License (the "License"); you may not use + this file except in compliance with the License. You may obtain a copy of the + License at + + https://www.aklivity.io/aklivity-community-license/ + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, WITHOUT + WARRANTIES OF ANY KIND, either express or implied. See the License for the + specific language governing permissions and limitations under the License. + +]] + +local zilla_version = "@version@" +if zilla_version == string.format("@%s@", "version") or zilla_version == "develop-SNAPSHOT" then + zilla_version = "dev" +end + +local zilla_info = { + version = zilla_version, + author = "Aklivity, Inc.", + repository = "https://github.com/aklivity/zilla", + description = "Dissector for the internal protocol of Zilla" +} +set_plugin_info(zilla_info) + +local zilla_protocol = Proto("Zilla", "Zilla Frames") + +HEADER_OFFSET = 0 +LABELS_OFFSET = 16 + +BEGIN_ID = 0x00000001 +DATA_ID = 0x00000002 +END_ID = 0x00000003 +ABORT_ID = 0x00000004 +FLUSH_ID = 0x00000005 +RESET_ID = 0x40000001 +WINDOW_ID = 0x40000002 +SIGNAL_ID = 0x40000003 +CHALLENGE_ID = 0x40000004 + +AMQP_ID = 0x112dc182 +GRPC_ID = 0xf9c7583a +HTTP_ID = 0x8ab62046 +KAFKA_ID = 0x084b20e1 +MQTT_ID = 0xd0d41a76 +PROXY_ID = 0x8dcea850 +TLS_ID = 0x99f321bc + +local flags_types = { + [0] = "Not set", + [1] = "Set" +} + +local ext_proxy_address_family_types = { + [0] = "INET", + [1] = "INET4", + [2] = "INET6", + [3] = "UNIX", + [4] = "NONE", +} + +local ext_proxy_address_protocol_types = { + [0] = "STREAM", + [1] = "DATAGRAM", +} + +local ext_proxy_info_types = { + [0x01] = "ALPN", + [0x02] = "AUTHORITY", + [0x05] = "IDENTITY", + [0x20] = "SECURE", + [0x30] = "NAMESPACE", +} + +local ext_proxy_secure_info_types = { + [0x21] = "VERSION", + [0x22] = "NAME", + [0x23] = "CIPHER", + [0x24] = "SIGNATURE", + [0x25] = "KEY", +} + +local fields = { + -- header + frame_type_id = ProtoField.uint32("zilla.frame_type_id", "Frame Type ID", base.HEX), + frame_type = ProtoField.string("zilla.frame_type", "Frame Type", base.NONE), + protocol_type_id = ProtoField.uint32("zilla.protocol_type_id", "Protocol Type ID", base.HEX), + protocol_type = ProtoField.string("zilla.protocol_type", "Protocol Type", base.NONE), + stream_type_id = ProtoField.uint32("zilla.stream_type_id", "Stream Type ID", base.HEX), + stream_type = ProtoField.string("zilla.stream_type", "Stream Type", base.NONE), + worker = ProtoField.uint32("zilla.worker", "Worker", base.DEC), + offset = ProtoField.uint32("zilla.offset", "Offset", base.HEX), + + -- labels + origin_namespace = ProtoField.string("zilla.origin_namespace", "Origin Namespace", base.STRING), + origin_binding = ProtoField.string("zilla.origin_binding", "Origin Binding", base.STRING), + routed_namespace = ProtoField.string("zilla.routed_namespace", "Routed Namespace", base.STRING), + routed_binding = ProtoField.string("zilla.routed_binding", "Routed Binding", base.STRING), + + -- all frames + origin_id = ProtoField.uint64("zilla.origin_id", "Origin ID", base.HEX), + routed_id = ProtoField.uint64("zilla.routed_id", "Routed ID", base.HEX), + stream_id = ProtoField.uint64("zilla.stream_id", "Stream ID", base.HEX), + direction = ProtoField.string("zilla.direction", "Direction", base.NONE), + initial_id = ProtoField.uint64("zilla.initial_id", "Initial ID", base.HEX), + reply_id = ProtoField.uint64("zilla.reply_id", "Reply ID", base.HEX), + sequence = ProtoField.int64("zilla.sequence", "Sequence", base.DEC), + acknowledge = ProtoField.int64("zilla.acknowledge", "Acknowledge", base.DEC), + maximum = ProtoField.int32("zilla.maximum", "Maximum", base.DEC), + timestamp = ProtoField.uint64("zilla.timestamp", "Timestamp", base.HEX), + trace_id = ProtoField.uint64("zilla.trace_id", "Trace ID", base.HEX), + authorization = ProtoField.uint64("zilla.authorization", "Authorization", base.HEX), + + -- begin frame + affinity = ProtoField.uint64("zilla.affinity", "Affinity", base.HEX), + + -- data frame + flags = ProtoField.uint8("zilla.flags", "Flags", base.HEX), + flags_fin = ProtoField.uint8("zilla.flags_fin", "FIN", base.DEC, flags_types, 0x01), + flags_init = ProtoField.uint8("zilla.flags_init", "INIT", base.DEC, flags_types, 0x02), + flags_incomplete = ProtoField.uint8("zilla.flags_incomplete", "INCOMPLETE", base.DEC, flags_types, 0x04), + flags_skip = ProtoField.uint8("zilla.flags_skip", "SKIP", base.DEC, flags_types, 0x08), + budget_id = ProtoField.uint64("zilla.budget_id", "Budget ID", base.HEX), + reserved = ProtoField.int32("zilla.reserved", "Reserved", base.DEC), + payload_length = ProtoField.int32("zilla.payload_length", "Length", base.DEC), + progress = ProtoField.int64("zilla.progress", "Progress", base.DEC), + progress_maximum = ProtoField.string("zilla.progress_maximum", "Progress/Maximum", base.NONE), + payload = ProtoField.protocol("zilla.payload", "Payload", base.HEX), + + -- window frame + padding = ProtoField.int32("zilla.padding", "Padding", base.DEC), + minimum = ProtoField.int32("zilla.minimum", "Minimum", base.DEC), + capabilities = ProtoField.uint8("zilla.capabilities", "Capabilities", base.HEX), + + -- signal frame + cancel_id = ProtoField.uint64("zilla.cancel_id", "Cancel ID", base.HEX), + signal_id = ProtoField.int32("zilla.signal_id", "Signal ID", base.DEC), + context_id = ProtoField.int32("zilla.context_id", "Context ID", base.DEC), + + -- proxy extension + -- address + ext_proxy_address_family = ProtoField.uint8("zilla.proxy_ext.address_family", "Family", base.DEC, + ext_proxy_address_family_types), + ext_proxy_address_protocol = ProtoField.uint8("zilla.proxy_ext.address_protocol", "Protocol", base.DEC, + ext_proxy_address_protocol_types), + ext_proxy_address_inet_source_port = ProtoField.uint16("zilla.proxy_ext.address_inet_source_port", "Source Port", + base.DEC), + ext_proxy_address_inet_destination_port = ProtoField.uint16("zilla.proxy_ext.address_inet_destination_port", + "Destination Port", base.DEC), + ext_proxy_address_inet_source = ProtoField.string("zilla.proxy_ext.address_inet_source", "Source", base.NONE), + ext_proxy_address_inet_destination = ProtoField.string("zilla.proxy_ext.address_inet_destination", "Destination", + base.NONE), + ext_proxy_address_inet4_source = ProtoField.new("Source", "zilla.proxy_ext.address_inet4_source", ftypes.IPv4), + ext_proxy_address_inet4_destination = ProtoField.new("Destination", "zilla.proxy_ext.address_inet4_destination", + ftypes.IPv4), + ext_proxy_address_inet6_source = ProtoField.new("Source", "zilla.proxy_ext.address_inet6_source", ftypes.IPv6), + ext_proxy_address_inet6_destination = ProtoField.new("Destination", "zilla.proxy_ext.address_inet6_destination", + ftypes.IPv6), + ext_proxy_address_unix_source = ProtoField.string("zilla.proxy_ext.address_unix_source", "Source", base.NONE), + ext_proxy_address_unix_destination = ProtoField.string("zilla.proxy_ext.address_unix_destination", "Destination", + base.NONE), + -- info + ext_proxy_info_array_length = ProtoField.uint8("zilla.proxy_ext.info_array_length", "Length", base.DEC), + ext_proxy_info_array_size = ProtoField.uint8("zilla.proxy_ext.info_array_size", "Size", base.DEC), + ext_proxy_info_type = ProtoField.uint8("zilla.proxy_ext.info_type", "Type", base.HEX, ext_proxy_info_types), + ext_proxy_info_length = ProtoField.uint16("zilla.proxy_ext.info_length", "Length", base.DEC), + ext_proxy_info_alpn = ProtoField.string("zilla.proxy_ext.info_alpn", "Value", base.NONE), + ext_proxy_info_authority = ProtoField.string("zilla.proxy_ext.info_authority", "Value", base.NONE), + ext_proxy_info_identity = ProtoField.bytes("zilla.proxy_ext.info_identity", "Value", base.NONE), + ext_proxy_info_namespace = ProtoField.string("zilla.proxy_ext.info_namespace", "Value", base.NONE), + ext_proxy_info_secure = ProtoField.string("zilla.proxy_ext.info_secure", "Value", base.NONE), + ext_proxy_info_secure_type = ProtoField.uint8("zilla.proxy_ext.info_secure_type", "Secure Type", base.HEX, + ext_proxy_secure_info_types), +} + +zilla_protocol.fields = fields; + +function zilla_protocol.dissector(buffer, pinfo, tree) + if buffer:len() == 0 then return end + local subtree = tree:add(zilla_protocol, buffer(), "Zilla Frame") + + -- header + local slice_frame_type_id = buffer(HEADER_OFFSET, 4) + local frame_type_id = slice_frame_type_id:le_uint() + local frame_type = resolve_frame_type(frame_type_id) + subtree:add_le(fields.frame_type_id, slice_frame_type_id) + subtree:add(fields.frame_type, frame_type) + + local slice_protocol_type_id = buffer(HEADER_OFFSET + 4, 4) + local protocol_type_id = slice_protocol_type_id:le_uint() + local protocol_type = resolve_type(protocol_type_id) + subtree:add_le(fields.protocol_type_id, slice_protocol_type_id) + subtree:add(fields.protocol_type, protocol_type) + + local slice_worker = buffer(HEADER_OFFSET + 8, 4) + local slice_offset = buffer(HEADER_OFFSET + 12, 4) + subtree:add_le(fields.worker, slice_worker) + subtree:add_le(fields.offset, slice_offset) + + -- labels + local slice_labels_length = buffer(LABELS_OFFSET, 4) + local labels_length = slice_labels_length:le_uint() + + -- origin id + local frame_offset = LABELS_OFFSET + labels_length + local slice_origin_id = buffer(frame_offset + 4, 8) + subtree:add_le(fields.origin_id, slice_origin_id) + + local label_offset = LABELS_OFFSET + 4; + local origin_namespace_length = buffer(label_offset, 4):le_uint() + label_offset = label_offset + 4 + local slice_origin_namespace = buffer(label_offset, origin_namespace_length) + label_offset = label_offset + origin_namespace_length + if (origin_namespace_length > 0) then + subtree:add(fields.origin_namespace, slice_origin_namespace) + end + + local origin_binding_length = buffer(label_offset, 4):le_uint() + label_offset = label_offset + 4 + local slice_origin_binding = buffer(label_offset, origin_binding_length) + label_offset = label_offset + origin_binding_length + if (origin_binding_length > 0) then + subtree:add(fields.origin_binding, slice_origin_binding) + end + + -- routed id + local slice_routed_id = buffer(frame_offset + 12, 8) + subtree:add_le(fields.routed_id, slice_routed_id) + + local routed_namespace_length = buffer(label_offset, 4):le_uint() + label_offset = label_offset + 4 + slice_routed_namespace = buffer(label_offset, routed_namespace_length) + label_offset = label_offset + routed_namespace_length + if (routed_namespace_length > 0) then + subtree:add(fields.routed_namespace, slice_routed_namespace) + end + + local routed_binding_length = buffer(label_offset, 4):le_uint() + label_offset = label_offset + 4 + local slice_routed_binding = buffer(label_offset, routed_binding_length) + label_offset = label_offset + routed_binding_length + if (routed_binding_length > 0) then + subtree:add(fields.routed_binding, slice_routed_binding) + end + + -- stream id + local slice_stream_id = buffer(frame_offset + 20, 8) + local stream_id = slice_stream_id:le_uint64(); + subtree:add_le(fields.stream_id, slice_stream_id) + local direction + local initial_id + local reply_id + if stream_id == UInt64(0) then + direction = "" + else + if (stream_id % 2) == UInt64(0) then + direction = "REP" + initial_id = stream_id + UInt64(1) + reply_id = stream_id + else + direction = "INI" + initial_id = stream_id + reply_id = stream_id - UInt64(1) + end + subtree:add(fields.initial_id, initial_id) + subtree:add(fields.reply_id, reply_id) + end + subtree:add(fields.direction, direction) + + -- more frame properties + local slice_sequence = buffer(frame_offset + 28, 8) + local sequence = slice_sequence:le_int64(); + local slice_acknowledge = buffer(frame_offset + 36, 8) + local acknowledge = slice_acknowledge:le_int64(); + local slice_maximum = buffer(frame_offset + 44, 4) + local maximum = slice_maximum:le_int(); + local slice_timestamp = buffer(frame_offset + 48, 8) + local slice_trace_id = buffer(frame_offset + 56, 8) + local slice_authorization = buffer(frame_offset + 64, 8) + subtree:add_le(fields.sequence, slice_sequence) + subtree:add_le(fields.acknowledge, slice_acknowledge) + subtree:add_le(fields.maximum, slice_maximum) + subtree:add_le(fields.timestamp, slice_timestamp) + subtree:add_le(fields.trace_id, slice_trace_id) + subtree:add_le(fields.authorization, slice_authorization) + + pinfo.cols.protocol = zilla_protocol.name + local info = string.format("ZILLA %s %s", frame_type, direction) + if protocol_type and protocol_type ~= "" then + info = string.format("%s p=%s", info, protocol_type) + end + pinfo.cols.info:set(info) + + -- begin + if frame_type_id == BEGIN_ID then + local slice_affinity = buffer(frame_offset + 72, 8) + subtree:add_le(fields.affinity, slice_affinity) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 80) + end + + -- data + if frame_type_id == DATA_ID then + local slice_flags = buffer(frame_offset + 72, 1) + local flags_label = string.format("Flags: 0x%02x", slice_flags:le_uint()) + local flags_subtree = subtree:add(zilla_protocol, slice_flags, flags_label) + flags_subtree:add_le(fields.flags_fin, slice_flags) + flags_subtree:add_le(fields.flags_init, slice_flags) + flags_subtree:add_le(fields.flags_incomplete, slice_flags) + flags_subtree:add_le(fields.flags_skip, slice_flags) + + local slice_budget_id = buffer(frame_offset + 73, 8) + local slice_reserved = buffer(frame_offset + 81, 4) + local reserved = slice_reserved:le_int(); + local progress = sequence - acknowledge + reserved; + local progress_maximum = string.format("%s/%s", progress, maximum) + subtree:add_le(fields.budget_id, slice_budget_id) + subtree:add_le(fields.reserved, slice_reserved) + subtree:add(fields.progress, progress) + subtree:add(fields.progress_maximum, progress_maximum) + pinfo.cols.info:set(string.format("%s [%s]", info, progress_maximum)) + + local slice_payload_length = buffer(frame_offset + 85, 4) + local payload_length = math.max(slice_payload_length:le_int(), 0) + local slice_payload = buffer(frame_offset + 89, payload_length) + local payload_subtree = subtree:add(zilla_protocol, slice_payload, "Payload") + payload_subtree:add_le(fields.payload_length, slice_payload_length) + if (payload_length > 0) then + payload_subtree:add(fields.payload, slice_payload) + end + + handle_extension(buffer, subtree, pinfo, info, frame_offset + 89 + payload_length) + + local dissector = resolve_dissector(protocol_type, slice_payload:tvb()) + if dissector then + dissector:call(slice_payload:tvb(), pinfo, tree) + end + end + + -- end + if frame_type_id == END_ID then + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + end + + -- abort + if frame_type_id == ABORT_ID then + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + end + + -- flush + if frame_type_id == FLUSH_ID then + local slice_budget_id = buffer(frame_offset + 72, 8) + local slice_reserved = buffer(frame_offset + 80, 4) + subtree:add_le(fields.budget_id, slice_budget_id) + subtree:add_le(fields.reserved, slice_reserved) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 84) + end + + -- reset + if frame_type_id == RESET_ID then + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + end + + -- window + if frame_type_id == WINDOW_ID then + local slice_budget_id = buffer(frame_offset + 72, 8) + local slice_padding = buffer(frame_offset + 80, 4) + local slice_minimum = buffer(frame_offset + 84, 4) + local slice_capabilities = buffer(frame_offset + 88, 1) + subtree:add_le(fields.budget_id, slice_budget_id) + subtree:add_le(fields.padding, slice_padding) + subtree:add_le(fields.minimum, slice_minimum) + subtree:add_le(fields.capabilities, slice_capabilities) + + local progress = sequence - acknowledge; + local progress_maximum = string.format("%s/%s", progress, maximum) + subtree:add(fields.progress, progress) + subtree:add(fields.progress_maximum, progress_maximum) + + pinfo.cols.info:set(string.format("%s [%s]", info, progress_maximum)) + end + + -- signal + if frame_type_id == SIGNAL_ID then + local slice_cancel_id = buffer(frame_offset + 72, 8) + local slice_signal_id = buffer(frame_offset + 80, 4) + local slice_context_id = buffer(frame_offset + 84, 4) + subtree:add_le(fields.cancel_id, slice_cancel_id) + subtree:add_le(fields.signal_id, slice_signal_id) + subtree:add_le(fields.context_id, slice_context_id) + + local slice_payload_length = buffer(frame_offset + 88, 4) + local payload_length = math.max(slice_payload_length:le_int(), 0) + local slice_payload = buffer(frame_offset + 92, payload_length) + local payload_subtree = subtree:add(zilla_protocol, slice_payload, "Payload") + payload_subtree:add_le(fields.payload_length, slice_payload_length) + if (payload_length > 0) then + payload_subtree:add(fields.payload, slice_payload) + end + end + + -- challenge + if frame_type_id == CHALLENGE_ID then + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + end +end + +function resolve_frame_type(frame_type_id) + local frame_type = "" + if frame_type_id == BEGIN_ID then frame_type = "BEGIN" + elseif frame_type_id == DATA_ID then frame_type = "DATA" + elseif frame_type_id == END_ID then frame_type = "END" + elseif frame_type_id == ABORT_ID then frame_type = "ABORT" + elseif frame_type_id == FLUSH_ID then frame_type = "FLUSH" + elseif frame_type_id == RESET_ID then frame_type = "RESET" + elseif frame_type_id == WINDOW_ID then frame_type = "WINDOW" + elseif frame_type_id == SIGNAL_ID then frame_type = "SIGNAL" + elseif frame_type_id == CHALLENGE_ID then frame_type = "CHALLENGE" + end + return frame_type +end + +function resolve_type(type_id) + local type = "" + if type_id == AMQP_ID then type = "amqp" + elseif type_id == GRPC_ID then type = "grpc" + elseif type_id == HTTP_ID then type = "http" + elseif type_id == KAFKA_ID then type = "kafka" + elseif type_id == MQTT_ID then type = "mqtt" + elseif type_id == PROXY_ID then type = "proxy" + elseif type_id == TLS_ID then type = "tls" + end + return type +end + +function resolve_dissector(protocol_type, payload) + local dissector + if protocol_type == "amqp" then dissector = Dissector.get("amqp") + elseif protocol_type == "http" then dissector = resolve_http_dissector(payload) + elseif protocol_type == "kafka" then dissector = Dissector.get("kafka") + elseif protocol_type == "mqtt" then dissector = Dissector.get("mqtt") + elseif protocol_type == "tls" then dissector = Dissector.get("tls") + end + return dissector +end + +function resolve_http_dissector(payload) + if payload:range(0, 3):int() + 9 == payload:len() then + return Dissector.get("http2") + elseif payload:range(0, 3):string() == "PRI" then + return Dissector.get("http2") + elseif payload:range(0, 4):string() == "HTTP" then + return Dissector.get("http") + elseif payload:range(0, 3):string() == "GET" then + return Dissector.get("http") + elseif payload:range(0, 4):string() == "POST" then + return Dissector.get("http") + elseif payload:range(0, 3):string() == "PUT" then + return Dissector.get("http") + elseif payload:range(0, 6):string() == "DELETE" then + return Dissector.get("http") + elseif payload:range(0, 4):string() == "HEAD" then + return Dissector.get("http") + elseif payload:range(0, 7):string() == "OPTIONS" then + return Dissector.get("http") + elseif payload:range(0, 5):string() == "TRACE" then + return Dissector.get("http") + elseif payload:range(0, 7):string() == "CONNECT" then + return Dissector.get("http") + else + return nil + end +end + +function handle_extension(buffer, subtree, pinfo, info, offset) + if buffer:len() > offset then + local slice_stream_type_id = buffer(offset, 4) + local stream_type_id = slice_stream_type_id:le_uint(); + local stream_type = resolve_type(stream_type_id) + local extension_label = string.format("Extension: %s", stream_type) + local slice_extension = buffer(offset) + local extension_subtree = subtree:add(zilla_protocol, slice_extension, extension_label) + extension_subtree:add(fields.stream_type_id, slice_stream_type_id) + extension_subtree:add(fields.stream_type, stream_type) + + if stream_type_id == PROXY_ID then + handle_proxy_extension(buffer, extension_subtree, offset + 4) + end + + if stream_type and stream_type ~= "" then + pinfo.cols.info:set(string.format("%s s=%s", info, stream_type)) + end + end +end + +function handle_proxy_extension(buffer, extension_subtree, offset) + -- address + local slice_address_family = buffer(offset, 1) + local address_family_id = slice_address_family:le_int() + local address_family = ext_proxy_address_family_types[address_family_id] + local address_subtree_label = string.format("Address: %s", address_family) + local info_offset + if address_family == "INET" then + local slice_protocol = buffer(offset + 1, 1) + local source_length = buffer(offset + 2, 2):le_int() + local slice_source = buffer(offset + 4, source_length) + local destination_length = buffer(offset + 4 + source_length, 2):le_int() + local slice_destination = buffer(offset + 6 + source_length, destination_length) + local slice_source_port = buffer(offset + 6 + source_length + destination_length, 2) + local slice_destination_port = buffer(offset + 8 + source_length + destination_length, 2) + local length = 10 + source_length + destination_length + local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) + address_subtree:add(fields.ext_proxy_address_family, slice_address_family) + address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) + address_subtree:add(fields.ext_proxy_address_inet_source, slice_source) + address_subtree:add_le(fields.ext_proxy_address_inet_source_port, slice_source_port) + address_subtree:add(fields.ext_proxy_address_inet_destination, slice_destination) + address_subtree:add_le(fields.ext_proxy_address_inet_destination_port, slice_destination_port) + info_offset = offset + length + elseif address_family == "INET4" then + local slice_protocol = buffer(offset + 1, 1) + local slice_source = buffer(offset + 2, 4) + local slice_destination = buffer(offset + 6, 4) + local slice_source_port = buffer(offset + 10, 2) + local slice_destination_port = buffer(offset + 12, 2) + local length = 14; + local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) + address_subtree:add(fields.ext_proxy_address_family, slice_address_family) + address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) + address_subtree:add(fields.ext_proxy_address_inet4_source, slice_source) + address_subtree:add_le(fields.ext_proxy_address_inet_source_port, slice_source_port) + address_subtree:add(fields.ext_proxy_address_inet4_destination, slice_destination) + address_subtree:add_le(fields.ext_proxy_address_inet_destination_port, slice_destination_port) + info_offset = offset + length + elseif address_family == "INET6" then + local slice_protocol = buffer(offset + 1, 1) + local slice_source = buffer(offset + 2, 16) + local slice_destination = buffer(offset + 18, 16) + local slice_source_port = buffer(offset + 34, 2) + local slice_destination_port = buffer(offset + 36, 2) + local length = 38; + local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) + address_subtree:add(fields.ext_proxy_address_family, slice_address_family) + address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) + address_subtree:add(fields.ext_proxy_address_inet6_source, slice_source) + address_subtree:add_le(fields.ext_proxy_address_inet_source_port, slice_source_port) + address_subtree:add(fields.ext_proxy_address_inet6_destination, slice_destination) + address_subtree:add_le(fields.ext_proxy_address_inet_destination_port, slice_destination_port) + info_offset = offset + length; + elseif address_family == "UNIX" then + local slice_protocol = buffer(offset + 1, 1) + local slice_source = buffer(offset + 2, 108) + local slice_destination = buffer(offset + 110, 108) + local length = 218 + local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) + address_subtree:add(fields.ext_proxy_address_family, slice_address_family) + address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) + address_subtree:add(fields.ext_proxy_address_unix_source, slice_source) + address_subtree:add(fields.ext_proxy_address_unix_destination, slice_destination) + info_offset = offset + length + elseif address_family == "NONE" then + local length = 1 + local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) + address_subtree:add(fields.ext_proxy_address_family, slice_address_family) + info_offset = offset + length + end + + -- info + local slice_info_array_length = buffer(info_offset, 4) + local slice_info_array_size = buffer(info_offset + 4, 4) + local info_array_length = slice_info_array_length:le_int() + local info_array_size = slice_info_array_size:le_int() + local length = 8 + local label = string.format("Info (%d items)", info_array_size) + local info_array_subtree = extension_subtree:add(zilla_protocol, buffer(info_offset, length), label) + info_array_subtree:add_le(fields.ext_proxy_info_array_length, slice_info_array_length) + info_array_subtree:add_le(fields.ext_proxy_info_array_size, slice_info_array_size) + local item_offset = info_offset + length + for i = 1, info_array_size do + local slice_type_id = buffer(item_offset, 1) + local type_id = slice_type_id:le_int() + local type = ext_proxy_info_types[type_id] + local label_format = "Info: %s: %s" + item_offset = item_offset + 1 + if type == "ALPN" then + local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 1) + add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, + slice_length, slice_text, fields.ext_proxy_info_type, fields.ext_proxy_info_length, fields.ext_proxy_info_alpn) + item_offset = item_offset + item_length + elseif type == "AUTHORITY" then + local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 2) + add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, + slice_length, slice_text, fields.ext_proxy_info_type, fields.ext_proxy_info_length, fields.ext_proxy_info_authority) + item_offset = item_offset + item_length + elseif type == "IDENTITY" then + local item_length, slice_length, slice_bytes = dissect_length_value(buffer, item_offset, 2) + local label = string.format("Info: %s: 0x%s", type, slice_bytes:bytes()) + local subtree = extension_subtree:add(zilla_protocol, buffer(item_offset - 1, item_length + 1), label) + subtree:add(fields.ext_proxy_info_type, slice_type_id) + subtree:add_le(fields.ext_proxy_info_length, slice_length) + subtree:add(fields.ext_proxy_info_identity, slice_bytes) + item_offset = item_offset + item_length + elseif type == "SECURE" then + local slice_secure_type_id = buffer(item_offset, 1) + local secure_type_id = slice_secure_type_id:le_int(); + local secure_type = ext_proxy_secure_info_types[secure_type_id] + item_offset = item_offset + 1 + local length_length + if secure_type == "VERSION" or secure_type == "CIPHER" or secure_type == "SIGNATURE" or secure_type == "KEY" then + length_length = 1 + elseif secure_type == "NAME" then + length_length = 2 + end + local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, length_length) + local label = string.format("Info: %s: %s: %s", type, secure_type, slice_text:string()) + local subtree = extension_subtree:add(zilla_protocol, buffer(item_offset - 1, item_length + 1), label) + subtree:add(fields.ext_proxy_info_type, slice_type_id) + subtree:add(fields.ext_proxy_info_secure_type, slice_secure_type_id) + subtree:add_le(fields.ext_proxy_info_length, slice_length) + subtree:add(fields.ext_proxy_info_secure, slice_text) + item_offset = item_offset + item_length + elseif type == "NAMESPACE" then + local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 2) + add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, + slice_length, slice_text, fields.ext_proxy_info_type, fields.ext_proxy_info_length, fields.ext_proxy_info_namespace) + item_offset = item_offset + item_length + end + end +end + +function dissect_length_value(buffer, item_offset, length_length) + local slice_length = buffer(item_offset, length_length) + local length = slice_length:le_int() + local slice_value = buffer(item_offset + length_length, length) + local item_length = length + length_length + return item_length, slice_length, slice_value +end + +function add_string_as_subtree(buffer, tree, label_format, slice_type_id, slice_length, slice_text, field_type, field_length, + field_text) + local type_id = slice_type_id:le_int() + local type = ext_proxy_info_types[type_id] + local text = slice_text:string() + local label = string.format(label_format, type, text) + local subtree = tree:add(zilla_protocol, buffer, label) + subtree:add(field_type, slice_type_id) + subtree:add_le(field_length, slice_length) + subtree:add(field_text, slice_text) +end + +local data_dissector = DissectorTable.get("tcp.port") +data_dissector:add(7114, zilla_protocol) diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_with_kafka_filter.pcap b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_with_kafka_filter.pcap index 3db223755505a2c1a0bf2b687a47ea398c695bca..96e66fe158f709217bacf49f944e3c76719bea7a 100644 GIT binary patch delta 44 zcmaFD_=a(Uvg8p428JUFL9WhW3<|-nel84ccM}zrT^af&+SsuIF^Z>CI%J;IQah`$Yg|b85ni}*}D{iT%E%h6oOs-To~H!CMqhsGPJNc{A)l` z2h@eeXOKRHkPnc6Sb}UcNLB!$gx0KmKnwO^@ks}UPZ-dA0(3OoF9iWom_CUB8ZCn6 zevqn?)Z!ADFwE!ZG)$gE`Up_{5iGvx!|)9&nr~R(egPVREnYSN#ifv(1M>+RP%Jw! zEj!TwCdmY3fcygq5d;mBCy_o3RDT$YpL#L;ge$ET08J=?`3dMc2bc>ufX<|2T7y~3 za2&`wj>St8F}#E;(SZ`sOKe`s0D6hei4Nv1Mpt0GyJC8aksrfbxMJ!h(5#P0-hvs; zaDs+0#SFIv$Y=uM0RP|+1$_mNkdOdc9sVqpfQYcBSDA6y-NzBZH zOZcSbrI%z_DHs}Yae1WXIz_9 zpk-Pa)B($|2^h$mFawsM1|wi`q*lf!z<~V_APFhwkUiT0qOvPP+vF>Zc8pS!0~v)U>oFxt?gpycjYVDSBz6rUh76!=PJjf&bS4G{ zhlzFh6Blqw?gxtR$D*rqay7H2a1K!RCbBLD2B4d&ByAZO7;Q0iF|q^g;%B%C)b$Xq zYhrc$F32WSA;rZ}L^xl#G>#!)V0NSJ>!gzy$fk_9h0b~=%Q*i)tw_Ozg From fc3460dd30a6235303a94772fb1a4bcfac22b539 Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Thu, 14 Dec 2023 18:32:07 -0800 Subject: [PATCH 05/16] Bump github/codeql-action from 2 to 3 (#643) Bumps [github/codeql-action](https://github.com/github/codeql-action) from 2 to 3. - [Release notes](https://github.com/github/codeql-action/releases) - [Changelog](https://github.com/github/codeql-action/blob/main/CHANGELOG.md) - [Commits](https://github.com/github/codeql-action/compare/v2...v3) --- updated-dependencies: - dependency-name: github/codeql-action dependency-type: direct:production update-type: version-update:semver-major ... Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> --- .github/workflows/codeql.yml | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/.github/workflows/codeql.yml b/.github/workflows/codeql.yml index d790178a93..8dc3602146 100644 --- a/.github/workflows/codeql.yml +++ b/.github/workflows/codeql.yml @@ -50,7 +50,7 @@ jobs: # Initializes the CodeQL tools for scanning. - name: Initialize CodeQL - uses: github/codeql-action/init@v2 + uses: github/codeql-action/init@v3 with: languages: ${{ matrix.language }} # If you wish to specify custom queries, you can do so here or in a config file. @@ -73,7 +73,7 @@ jobs: # Autobuild attempts to build any compiled languages (C/C++, C#, Go, Java, or Swift). # If this step fails, then you should remove it and run the build manually (see below) - name: Autobuild - uses: github/codeql-action/autobuild@v2 + uses: github/codeql-action/autobuild@v3 # ℹ️ Command-line programs to run using the OS shell. # 📚 See https://docs.github.com/en/actions/using-workflows/workflow-syntax-for-github-actions#jobsjob_idstepsrun @@ -86,6 +86,6 @@ jobs: # ./location_of_script_within_repo/buildscript.sh - name: Perform CodeQL Analysis - uses: github/codeql-action/analyze@v2 + uses: github/codeql-action/analyze@v3 with: category: "/language:${{matrix.language}}" From a4f90130273eb366d13f617dac3bac096f3d9e9c Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Thu, 14 Dec 2023 18:32:32 -0800 Subject: [PATCH 06/16] Bump ubuntu in /cloud/docker-image/src/main/docker/incubator (#608) Bumps ubuntu from jammy-20230916 to jammy-20231128. --- updated-dependencies: - dependency-name: ubuntu dependency-type: direct:production ... Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> --- cloud/docker-image/src/main/docker/incubator/Dockerfile | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/cloud/docker-image/src/main/docker/incubator/Dockerfile b/cloud/docker-image/src/main/docker/incubator/Dockerfile index ad2dbcdc06..3d25d90186 100644 --- a/cloud/docker-image/src/main/docker/incubator/Dockerfile +++ b/cloud/docker-image/src/main/docker/incubator/Dockerfile @@ -27,7 +27,7 @@ RUN cat zpm.json.template | env VERSION=${project.version} envsubst > zpm.json RUN ./zpmw install --debug --exclude-remote-repositories RUN ./zpmw clean --keep-image -FROM ubuntu:jammy-20230916 +FROM ubuntu:jammy-20231128 ENV ZILLA_VERSION ${project.version} From 6ca39e80993eb2a3bcfe56d3f24dbf269f7b0028 Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Thu, 14 Dec 2023 18:33:15 -0800 Subject: [PATCH 07/16] Bump ubuntu in /cloud/docker-image/src/main/docker/release (#607) Bumps ubuntu from jammy-20230916 to jammy-20231128. --- updated-dependencies: - dependency-name: ubuntu dependency-type: direct:production ... Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> --- cloud/docker-image/src/main/docker/release/Dockerfile | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/cloud/docker-image/src/main/docker/release/Dockerfile b/cloud/docker-image/src/main/docker/release/Dockerfile index ad2dbcdc06..3d25d90186 100644 --- a/cloud/docker-image/src/main/docker/release/Dockerfile +++ b/cloud/docker-image/src/main/docker/release/Dockerfile @@ -27,7 +27,7 @@ RUN cat zpm.json.template | env VERSION=${project.version} envsubst > zpm.json RUN ./zpmw install --debug --exclude-remote-repositories RUN ./zpmw clean --keep-image -FROM ubuntu:jammy-20230916 +FROM ubuntu:jammy-20231128 ENV ZILLA_VERSION ${project.version} From 6033778598043cc03838dc471835bda3d39f336c Mon Sep 17 00:00:00 2001 From: bmaidics Date: Mon, 18 Dec 2023 21:12:09 +0100 Subject: [PATCH 08/16] Mqtt-kakfa will message bugfixes (#644) --- .../stream/MqttKafkaSessionFactory.java | 7 ++++++ .../stream/MqttKafkaSubscribeFactory.java | 17 ++++--------- .../internal/stream/MqttServerFactory.java | 24 +++++-------------- .../client.rpt | 3 ++- .../server.rpt | 2 ++ .../client.rpt | 1 + .../server.rpt | 1 + .../client.rpt | 1 + .../server.rpt | 1 + 9 files changed, 25 insertions(+), 32 deletions(-) diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java index 5f0613beaa..2adf5487e3 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java @@ -205,6 +205,7 @@ public class MqttKafkaSessionFactory implements MqttKafkaStreamFactory private final InstanceId instanceId; private final boolean willAvailable; private final int reconnectDelay; + private final Int2ObjectHashMap qosLevels; private String serverRef; private int reconnectAttempt; @@ -246,6 +247,10 @@ public MqttKafkaSessionFactory( this.sessionExpiryIds = new Object2LongHashMap<>(-1); this.instanceId = instanceId; this.reconnectDelay = config.willStreamReconnectDelay(); + this.qosLevels = new Int2ObjectHashMap<>(); + this.qosLevels.put(0, new String16FW("0")); + this.qosLevels.put(1, new String16FW("1")); + this.qosLevels.put(2, new String16FW("2")); } @Override @@ -2069,6 +2074,8 @@ private void sendWill( will.properties().forEach(property -> addHeader(property.key(), property.value())); + addHeader(helper.kafkaQosHeaderName, qosLevels.get(will.qos())); + kafkaDataEx = kafkaDataExRW .wrap(extBuffer, 0, extBuffer.capacity()) .typeId(kafkaTypeId) diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java index 5a0374be62..89123b909f 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java @@ -1907,7 +1907,6 @@ protected void doKafkaConsumerFlush( final MqttOffsetStateFlags state = offsetCommit.state; final int packetId = offsetCommit.packetId; - boolean shouldClose = false; if (qos == MqttQoS.EXACTLY_ONCE.value() && state == MqttOffsetStateFlags.COMPLETE) { final IntArrayList incompletes = incompletePacketIds.get(offset.partitionId); @@ -1923,11 +1922,6 @@ protected void doKafkaConsumerFlush( incompletePacketIds.computeIfAbsent(offset.partitionId, c -> new IntArrayList()).add(packetId); } - if (unAckedPackets == 0 && incompletePacketIds.isEmpty()) - { - shouldClose = true; - } - final int correlationId = state == MqttOffsetStateFlags.INCOMPLETE ? packetId : -1; final KafkaFlushExFW kafkaFlushEx = @@ -1949,12 +1943,6 @@ protected void doKafkaConsumerFlush( doFlush(kafka, originId, routedId, initialId, initialSeq, initialAck, initialMax, traceId, authorization, budgetId, reserved, kafkaFlushEx); - - if (shouldClose) - { - mqtt.retainedSubscriptionIds.clear(); - doKafkaEnd(traceId, authorization); - } } private void doKafkaFlush( @@ -2299,7 +2287,10 @@ private void onKafkaFlush( .subscribe(b -> b.packetId((int) correlationId)).build(); mqtt.doMqttFlush(traceId, authorization, budgetId, reserved, mqttSubscribeFlushEx); } - unAckedPackets--; + else + { + unAckedPackets--; + } } else { diff --git a/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java b/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java index 97a49edfe1..9b00d29252 100644 --- a/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java +++ b/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java @@ -2893,19 +2893,18 @@ private int onDecodeConnectWillMessage( reasonCode = RETAIN_NOT_SUPPORTED; break decode; } - payload.willRetain = (byte) RETAIN_FLAG; } - if (payload.willQos > maximumQos) + final int flags = connectFlags; + final int willFlags = decodeWillFlags(flags); + final int willQos = decodeWillQos(flags); + + if (willQos > maximumQos) { reasonCode = QOS_NOT_SUPPORTED; break decode; } - final int flags = connectFlags; - final int willFlags = decodeWillFlags(flags); - final int willQos = decodeWillQos(flags); - if (willFlagSet) { final MqttDataExFW.Builder sessionDataExBuilder = @@ -6299,8 +6298,7 @@ private static int decodeWillQos( int willQos = 0; if (isSetWillQos(flags)) { - //TODO shift by 3? - willQos = (flags & WILL_QOS_MASK) >>> 2; + willQos = (flags & WILL_QOS_MASK) >>> 3; } return willQos; } @@ -6418,8 +6416,6 @@ private final class MqttConnectPayload { private byte reasonCode = SUCCESS; private MqttPropertiesFW willProperties; - private byte willQos; - private byte willRetain; private String16FW willTopic; private BinaryFW willPayload; private String16FW username; @@ -6436,8 +6432,6 @@ private MqttConnectPayload reset() { this.reasonCode = SUCCESS; this.willProperties = null; - this.willQos = 0; - this.willRetain = 0; this.willTopic = null; this.willPayload = null; this.username = null; @@ -6494,12 +6488,6 @@ private int decode( break; } - final byte qos = (byte) ((flags & WILL_QOS_MASK) >>> 3); - if (qos != 0) - { - willQos = (byte) (qos << 1); - } - if (willTopic == null || willTopic.asString().isEmpty()) { reasonCode = MALFORMED_PACKET; diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/client.rpt index faaec76f1d..e602fe552f 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/client.rpt @@ -462,9 +462,9 @@ write zilla:data.ext ${kafka:dataEx() .key("obituaries") .header("zilla:filter", "obituaries") .header("zilla:format", "TEXT") + .header("zilla:qos", "0") .build() .build()} - write "client-1 disconnected abruptly" write flush @@ -498,6 +498,7 @@ write zilla:data.ext ${kafka:dataEx() .key("obituaries") .header("zilla:filter", "obituaries") .header("zilla:format", "TEXT") + .header("zilla:qos", "0") .build() .build()} diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/server.rpt index bae6ac1947..280c8eac75 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will.retain/server.rpt @@ -463,6 +463,7 @@ read zilla:data.ext ${kafka:matchDataEx() .key("obituaries") .header("zilla:filter", "obituaries") .header("zilla:format", "TEXT") + .header("zilla:qos", "0") .build() .build()} read "client-1 disconnected abruptly" @@ -495,6 +496,7 @@ read zilla:data.ext ${kafka:matchDataEx() .key("obituaries") .header("zilla:filter", "obituaries") .header("zilla:format", "TEXT") + .header("zilla:qos", "0") .build() .build()} read "client-1 disconnected abruptly" diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt index cb20e66539..1f33e2a94e 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt @@ -474,6 +474,7 @@ write zilla:data.ext ${kafka:dataEx() .header("zilla:reply-filter", "responses") .header("zilla:reply-filter", "client1") .header("zilla:correlation-id", "info") + .header("zilla:qos", "0") .build() .build()} diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt index 68a08801fc..f2e9fcf615 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt @@ -473,6 +473,7 @@ read zilla:data.ext ${kafka:matchDataEx() .header("zilla:reply-filter", "responses") .header("zilla:reply-filter", "client1") .header("zilla:correlation-id", "info") + .header("zilla:qos", "0") .build() .build()} read "client-1 disconnected abruptly" diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/client.rpt index 1d8e0ba4ec..39cef5e1a5 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/client.rpt @@ -460,6 +460,7 @@ write zilla:data.ext ${kafka:dataEx() .key("obituaries") .header("zilla:filter", "obituaries") .header("zilla:format", "TEXT") + .header("zilla:qos", "0") .build() .build()} diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/server.rpt index 3a75ce6250..41d9f2f33c 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.takeover.deliver.will/server.rpt @@ -466,6 +466,7 @@ read zilla:data.ext ${kafka:matchDataEx() .key("obituaries") .header("zilla:filter", "obituaries") .header("zilla:format", "TEXT") + .header("zilla:qos", "0") .build() .build()} read "client-1 disconnected abruptly" From bd3f54637a1a520dd5abeef85d42027bab9a5e04 Mon Sep 17 00:00:00 2001 From: bmaidics Date: Tue, 19 Dec 2023 02:22:16 +0100 Subject: [PATCH 09/16] Improve server sent DISCONNECT reasonCodes (#634) --- .../stream/MqttKafkaSessionFactory.java | 46 +++++++++++- .../stream/MqttKafkaSessionProxyIT.java | 36 ++++++++++ .../internal/stream/MqttServerFactory.java | 46 ++++++++---- .../internal/stream/server/v5/SessionIT.java | 20 ++++++ .../client.rpt | 72 +++++++++++++++++++ .../server.rpt | 70 ++++++++++++++++++ .../client.rpt | 72 +++++++++++++++++++ .../server.rpt | 70 ++++++++++++++++++ .../client.rpt | 72 +++++++++++++++++++ .../server.rpt | 70 ++++++++++++++++++ .../client.rpt | 34 +++++++++ .../server.rpt | 34 +++++++++ .../client.rpt | 35 +++++++++ .../server.rpt | 35 +++++++++ .../client.rpt | 34 +++++++++ .../server.rpt | 34 +++++++++ .../binding/mqtt/internal/MqttFunctions.java | 7 ++ .../main/resources/META-INF/zilla/mqtt.idl | 1 + .../client.rpt | 51 +++++++++++++ .../server.rpt | 52 ++++++++++++++ .../client.rpt | 49 +++++++++++++ .../server.rpt | 50 +++++++++++++ .../client.rpt | 43 +++++++++++ .../server.rpt | 44 ++++++++++++ .../client.rpt | 38 ++++++++++ .../server.rpt | 39 ++++++++++ .../mqtt/internal/MqttFunctionsTest.java | 2 + .../mqtt/streams/application/SessionIT.java | 18 +++++ .../mqtt/streams/network/v5/SessionIT.java | 18 +++++ 29 files changed, 1177 insertions(+), 15 deletions(-) create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/server.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/client.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/server.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/client.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/server.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/client.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/server.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/client.rpt create mode 100644 specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/server.rpt diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java index 2adf5487e3..19ff8861fe 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java @@ -32,6 +32,7 @@ import org.agrona.DirectBuffer; import org.agrona.MutableDirectBuffer; +import org.agrona.collections.Int2IntHashMap; import org.agrona.collections.Int2ObjectHashMap; import org.agrona.collections.IntHashSet; import org.agrona.collections.Long2ObjectHashMap; @@ -133,6 +134,33 @@ public class MqttKafkaSessionFactory implements MqttKafkaStreamFactory private static final int MQTT_KAFKA_CAPABILITIES = RETAIN_AVAILABLE_MASK | WILDCARD_AVAILABLE_MASK | SUBSCRIPTION_IDS_AVAILABLE_MASK; public static final String GROUPID_SESSION_SUFFIX = "session"; + public static final Int2IntHashMap MQTT_REASON_CODES; + public static final Int2ObjectHashMap MQTT_REASONS; + public static final int GROUP_AUTH_FAILED_ERROR_CODE = 30; + public static final int INVALID_DESCRIBE_CONFIG_ERROR_CODE = 35; + public static final int INVALID_SESSION_TIMEOUT_ERROR_CODE = 26; + public static final int MQTT_NOT_AUTHORIZED = 0x87; + public static final int MQTT_IMPLEMENTATION_SPECIFIC_ERROR = 0x83; + public static final String MQTT_INVALID_SESSION_TIMEOUT_REASON = "Invalid session expiry interval"; + private static final String16FW EMPTY_STRING = new String16FW(""); + + static + { + final Int2IntHashMap reasonCodes = new Int2IntHashMap(MQTT_IMPLEMENTATION_SPECIFIC_ERROR); + + reasonCodes.put(GROUP_AUTH_FAILED_ERROR_CODE, MQTT_NOT_AUTHORIZED); + + MQTT_REASON_CODES = reasonCodes; + } + + static + { + final Int2ObjectHashMap reasons = new Int2ObjectHashMap<>(); + + reasons.put(INVALID_SESSION_TIMEOUT_ERROR_CODE, new String16FW(MQTT_INVALID_SESSION_TIMEOUT_REASON)); + + MQTT_REASONS = reasons; + } private final BeginFW beginRO = new BeginFW(); private final DataFW dataRO = new DataFW(); @@ -172,6 +200,7 @@ public class MqttKafkaSessionFactory implements MqttKafkaStreamFactory private final KafkaDataExFW.Builder kafkaDataExRW = new KafkaDataExFW.Builder(); private final KafkaFlushExFW.Builder kafkaFlushExRW = new KafkaFlushExFW.Builder(); private final MqttBeginExFW.Builder mqttSessionBeginExRW = new MqttBeginExFW.Builder(); + private final MqttResetExFW.Builder mqttSessionResetExRW = new MqttResetExFW.Builder(); private final String16FW binaryFormat = new String16FW(MqttPayloadFormat.BINARY.name()); private final String16FW textFormat = new String16FW(MqttPayloadFormat.TEXT.name()); @@ -3307,10 +3336,25 @@ private void onKafkaReset( final long sequence = reset.sequence(); final long acknowledge = reset.acknowledge(); final long traceId = reset.traceId(); + final OctetsFW extension = reset.extension(); assert acknowledge <= sequence; - delegate.doMqttReset(traceId, EMPTY_OCTETS); + + final KafkaResetExFW kafkaResetEx = extension.get(kafkaResetExRO::tryWrap); + final int error = kafkaResetEx != null ? kafkaResetEx.error() : -1; + + Flyweight mqttResetEx = EMPTY_OCTETS; + if (error != -1) + { + mqttResetEx = + mqttSessionResetExRW.wrap(sessionExtBuffer, 0, sessionExtBuffer.capacity()) + .typeId(mqttTypeId) + .reasonCode(MQTT_REASON_CODES.get(error)) + .reason(MQTT_REASONS.get(error)) + .build(); + } + delegate.doMqttReset(traceId, mqttResetEx); } private void doKafkaReset( diff --git a/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionProxyIT.java b/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionProxyIT.java index 272167bab1..6ca3220c13 100644 --- a/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionProxyIT.java +++ b/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionProxyIT.java @@ -26,6 +26,7 @@ import static java.util.concurrent.TimeUnit.SECONDS; import static org.junit.rules.RuleChain.outerRule; +import org.junit.Ignore; import org.junit.Rule; import org.junit.Test; import org.junit.rules.DisableOnDebug; @@ -200,6 +201,41 @@ public void shouldGroupStreamReceiveServerSentReset() throws Exception k3po.finish(); } + @Ignore("k3po no extension with rejection") + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/session.group.reset.not.authorized/client", + "${kafka}/session.group.reset.not.authorized/server"}) + public void shouldGroupStreamReceiveResetNotAuthorized() throws Exception + { + k3po.finish(); + } + + @Ignore("k3po no extension with rejection") + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/session.group.reset.invalid.session.timeout/client", + "${kafka}/session.group.reset.invalid.session.timeout/server"}) + public void shouldGroupStreamReceiveResetInvalidSessionTimeout() throws Exception + { + k3po.finish(); + } + + @Ignore("k3po no extension with rejection") + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/session.group.reset.invalid.describe.config/client", + "${kafka}/session.group.reset.invalid.describe.config/server"}) + public void shouldGroupStreamReceiveResetInvalidDescribeConfig() throws Exception + { + k3po.finish(); + } @Test @Configuration("proxy.yaml") diff --git a/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java b/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java index 9b00d29252..242658a950 100644 --- a/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java +++ b/runtime/binding-mqtt/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/MqttServerFactory.java @@ -2950,7 +2950,7 @@ private int onDecodeConnectWillMessage( if (reasonCode != BAD_USER_NAME_OR_PASSWORD) { - doEncodeConnack(traceId, authorization, reasonCode, assignedClientId, false, null, version); + doEncodeConnack(traceId, authorization, reasonCode, assignedClientId, false, null, null, version); } if (session != null) @@ -3736,11 +3736,11 @@ private void onDecodeError( { if (connected || reasonCode == SESSION_TAKEN_OVER) { - doEncodeDisconnect(traceId, authorization, reasonCode, null); + doEncodeDisconnect(traceId, authorization, reasonCode, null, null); } else { - doEncodeConnack(traceId, authorization, reasonCode, false, false, null, version); + doEncodeConnack(traceId, authorization, reasonCode, false, false, null, null, version); } } @@ -4205,6 +4205,7 @@ private void doEncodeConnack( boolean assignedClientId, boolean sessionPresent, String16FW serverReference, + String16FW reason, int version) { @@ -4214,10 +4215,10 @@ private void doEncodeConnack( doEncodeConnackV4(traceId, authorization, reasonCode, sessionPresent); break; case 5: - doEncodeConnackV5(traceId, authorization, reasonCode, assignedClientId, sessionPresent, serverReference); + doEncodeConnackV5(traceId, authorization, reasonCode, assignedClientId, sessionPresent, serverReference, reason); break; default: - doEncodeConnackV5(traceId, authorization, reasonCode, assignedClientId, sessionPresent, serverReference); + doEncodeConnackV5(traceId, authorization, reasonCode, assignedClientId, sessionPresent, serverReference, reason); break; } @@ -4248,7 +4249,8 @@ private void doEncodeConnackV5( int reasonCode, boolean assignedClientId, boolean sessionPresent, - String16FW serverReference) + String16FW serverReference, + String16FW reason) { int propertiesSize = 0; @@ -4333,6 +4335,13 @@ private void doEncodeConnackV5( propertiesSize = mqttProperty.limit(); } } + else if (reason != null && reason.length() != -1) + { + mqttProperty = mqttPropertyRW.wrap(propertyBuffer, propertiesSize, propertyBuffer.capacity()) + .reasonString(reason) + .build(); + propertiesSize = mqttProperty.limit(); + } if (serverReference != null) { @@ -4449,12 +4458,20 @@ private void doEncodeDisconnect( long traceId, long authorization, int reasonCode, - String16FW serverReference) + String16FW serverReference, + String16FW reason) { int propertiesSize = 0; MqttPropertyFW mqttProperty; - if (serverReference != null) + if (reason != null && reason.length() != -1) + { + mqttProperty = mqttPropertyRW.wrap(propertyBuffer, propertiesSize, propertyBuffer.capacity()) + .reasonString(reason) + .build(); + propertiesSize = mqttProperty.limit(); + } + else if (serverReference != null) { mqttProperty = mqttPropertyRW.wrap(propertyBuffer, propertiesSize, propertyBuffer.capacity()) .serverReference(serverReference) @@ -4905,12 +4922,11 @@ private void onSessionReset( final OctetsFW extension = reset.extension(); final MqttResetExFW mqttResetEx = extension.get(mqttResetExRO::tryWrap); - - if (mqttResetEx != null) { String16FW serverRef = mqttResetEx.serverRef(); byte reasonCode = (byte) mqttResetEx.reasonCode(); + String16FW reason = mqttResetEx.reason(); boolean serverRefExists = serverRef != null && serverRef.asString() != null; if (reasonCode == SUCCESS) @@ -4922,13 +4938,14 @@ private void onSessionReset( { doCancelConnectTimeout(); doEncodeConnack(traceId, authorization, reasonCode, assignedClientId, - false, serverRefExists ? serverRef : null, version); + false, serverRefExists ? serverRef : null, reason, version); } - else + else if (version == MQTT_PROTOCOL_VERSION_5) { - doEncodeDisconnect(traceId, authorization, reasonCode, serverRefExists ? serverRef : null); + doEncodeDisconnect(traceId, authorization, reasonCode, serverRefExists ? serverRef : null, reason); } } + doNetworkEnd(traceId, authorization); setInitialClosed(); decodeNetwork(traceId); cleanupAbort(traceId); @@ -5019,7 +5036,8 @@ private void onSessionData( sessionPresent = true; } } - doEncodeConnack(traceId, authorization, reasonCode, assignedClientId, sessionPresent, null, version); + doEncodeConnack(traceId, authorization, reasonCode, assignedClientId, sessionPresent, + null, null, version); connected = true; } else diff --git a/runtime/binding-mqtt/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/server/v5/SessionIT.java b/runtime/binding-mqtt/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/server/v5/SessionIT.java index bb5899daa5..b97e80a497 100644 --- a/runtime/binding-mqtt/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/server/v5/SessionIT.java +++ b/runtime/binding-mqtt/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/internal/stream/server/v5/SessionIT.java @@ -244,4 +244,24 @@ public void shouldSubscribeAndPublishToNonDefaultRoute() throws Exception { k3po.finish(); } + + @Test + @Configuration("server.yaml") + @Specification({ + "${net}/session.invalid.session.timeout.after.connack/client", + "${app}/session.invalid.session.timeout.after.connack/server"}) + public void shouldPropagateMqttReasonCodeAndStringAfterConnack() throws Exception + { + k3po.finish(); + } + + @Test + @Configuration("server.yaml") + @Specification({ + "${net}/session.invalid.session.timeout.before.connack/client", + "${app}/session.invalid.session.timeout.before.connack/server"}) + public void shouldPropagateMqttReasonCodeAndStringBeforeConnack() throws Exception + { + k3po.finish(); + } } diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/client.rpt new file mode 100644 index 0000000000..1dbf3d9fd4 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/client.rpt @@ -0,0 +1,72 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("PRODUCE_AND_FETCH") + .topic("mqtt-sessions") + .groupId("mqtt-clients") + .filter() + .key("client-1#migrate") + .headerNot("sender-id", "sender-1") + .build() + .build() + .build()} + +connected + +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .produce() + .deferred(0) + .partition(-1, -1) + .key("client-1#migrate") + .hashKey("client-1") + .header("sender-id", "sender-1") + .build() + .build()} +write zilla:data.empty +write flush +write notify SENT_INIT_MIGRATE + + +connect await SENT_INIT_MIGRATE + "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .group() + .groupId("client-1-session") + .protocol("highlander") + .timeout(1000) + .build() + .build()} + +connected + +read zilla:reset.ext ${kafka:resetEx() + .typeId(zilla:id("kafka")) + .error(35) + .build()} + +write aborted diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/server.rpt new file mode 100644 index 0000000000..9ac10dd099 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.describe.config/server.rpt @@ -0,0 +1,70 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("PRODUCE_AND_FETCH") + .topic("mqtt-sessions") + .groupId("mqtt-clients") + .filter() + .key("client-1#migrate") + .headerNot("sender-id", "sender-1") + .build() + .build() + .build()} + +connected + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .produce() + .deferred(0) + .partition(-1, -1) + .key("client-1#migrate") + .hashKey("client-1") + .header("sender-id", "sender-1") + .build() + .build()} +read zilla:data.empty + + + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .group() + .groupId("client-1-session") + .protocol("highlander") + .timeout(1000) + .build() + .build()} + +connected + +write zilla:reset.ext ${kafka:resetEx() + .typeId(zilla:id("kafka")) + .error(35) + .build()} + +read abort diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/client.rpt new file mode 100644 index 0000000000..bd9cc67716 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/client.rpt @@ -0,0 +1,72 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("PRODUCE_AND_FETCH") + .topic("mqtt-sessions") + .groupId("mqtt-clients") + .filter() + .key("client-1#migrate") + .headerNot("sender-id", "sender-1") + .build() + .build() + .build()} + +connected + +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .produce() + .deferred(0) + .partition(-1, -1) + .key("client-1#migrate") + .hashKey("client-1") + .header("sender-id", "sender-1") + .build() + .build()} +write zilla:data.empty +write flush +write notify SENT_INIT_MIGRATE + + +connect await SENT_INIT_MIGRATE + "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .group() + .groupId("client-1-session") + .protocol("highlander") + .timeout(1000) + .build() + .build()} + +connected + +read zilla:reset.ext ${kafka:resetEx() + .typeId(zilla:id("kafka")) + .error(26) + .build()} + +write aborted diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/server.rpt new file mode 100644 index 0000000000..81bea19f30 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.invalid.session.timeout/server.rpt @@ -0,0 +1,70 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("PRODUCE_AND_FETCH") + .topic("mqtt-sessions") + .groupId("mqtt-clients") + .filter() + .key("client-1#migrate") + .headerNot("sender-id", "sender-1") + .build() + .build() + .build()} + +connected + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .produce() + .deferred(0) + .partition(-1, -1) + .key("client-1#migrate") + .hashKey("client-1") + .header("sender-id", "sender-1") + .build() + .build()} +read zilla:data.empty + + + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .group() + .groupId("client-1-session") + .protocol("highlander") + .timeout(1000) + .build() + .build()} + +connected + +write zilla:reset.ext ${kafka:resetEx() + .typeId(zilla:id("kafka")) + .error(26) + .build()} + +read abort diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/client.rpt new file mode 100644 index 0000000000..09c1567649 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/client.rpt @@ -0,0 +1,72 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("PRODUCE_AND_FETCH") + .topic("mqtt-sessions") + .groupId("mqtt-clients") + .filter() + .key("client-1#migrate") + .headerNot("sender-id", "sender-1") + .build() + .build() + .build()} + +connected + +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .produce() + .deferred(0) + .partition(-1, -1) + .key("client-1#migrate") + .hashKey("client-1") + .header("sender-id", "sender-1") + .build() + .build()} +write zilla:data.empty +write flush +write notify SENT_INIT_MIGRATE + + +connect await SENT_INIT_MIGRATE + "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .group() + .groupId("client-1-session") + .protocol("highlander") + .timeout(1000) + .build() + .build()} + +connected + +read zilla:reset.ext ${kafka:resetEx() + .typeId(zilla:id("kafka")) + .error(30) + .build()} + +write aborted diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/server.rpt new file mode 100644 index 0000000000..edb6577317 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.group.reset.not.authorized/server.rpt @@ -0,0 +1,70 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("PRODUCE_AND_FETCH") + .topic("mqtt-sessions") + .groupId("mqtt-clients") + .filter() + .key("client-1#migrate") + .headerNot("sender-id", "sender-1") + .build() + .build() + .build()} + +connected + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .produce() + .deferred(0) + .partition(-1, -1) + .key("client-1#migrate") + .hashKey("client-1") + .header("sender-id", "sender-1") + .build() + .build()} +read zilla:data.empty + + + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .group() + .groupId("client-1-session") + .protocol("highlander") + .timeout(1000) + .build() + .build()} + +connected + +write zilla:reset.ext ${kafka:resetEx() + .typeId(zilla:id("kafka")) + .error(30) + .build()} + +read abort diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/client.rpt new file mode 100644 index 0000000000..84947bb6d0 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/client.rpt @@ -0,0 +1,34 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .expiry(1) + .clientId("client-1") + .build() + .build()} + +read zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .build()} +connect aborted + + diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/server.rpt new file mode 100644 index 0000000000..798d86209c --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.describe.config/server.rpt @@ -0,0 +1,34 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .expiry(1) + .clientId("client-1") + .build() + .build()} + +write zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .build()} +rejected diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/client.rpt new file mode 100644 index 0000000000..0fa7aebe20 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/client.rpt @@ -0,0 +1,35 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .expiry(1) + .clientId("client-1") + .build() + .build()} + +read zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .reason("Invalid session expiry interval") + .build()} +connect aborted + + diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/server.rpt new file mode 100644 index 0000000000..3b1335a150 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.invalid.session.timeout/server.rpt @@ -0,0 +1,35 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .expiry(1) + .clientId("client-1") + .build() + .build()} + +write zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .reason("Invalid session expiry interval") + .build()} +rejected diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/client.rpt new file mode 100644 index 0000000000..6383f9fd5d --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/client.rpt @@ -0,0 +1,34 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .expiry(1) + .clientId("client-1") + .build() + .build()} + +read zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(135) + .build()} +connect aborted + + diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/server.rpt new file mode 100644 index 0000000000..866d39a084 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/session.group.reset.not.authorized/server.rpt @@ -0,0 +1,34 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .expiry(1) + .clientId("client-1") + .build() + .build()} + +write zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(135) + .build()} +rejected diff --git a/specs/binding-mqtt.spec/src/main/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctions.java b/specs/binding-mqtt.spec/src/main/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctions.java index f48adabfbc..61e1124078 100644 --- a/specs/binding-mqtt.spec/src/main/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctions.java +++ b/specs/binding-mqtt.spec/src/main/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctions.java @@ -773,6 +773,13 @@ public MqttResetExBuilder reasonCode( return this; } + public MqttResetExBuilder reason( + String reason) + { + resetExRW.reason(reason); + return this; + } + public byte[] build() { final MqttResetExFW resetEx = resetExRW.build(); diff --git a/specs/binding-mqtt.spec/src/main/resources/META-INF/zilla/mqtt.idl b/specs/binding-mqtt.spec/src/main/resources/META-INF/zilla/mqtt.idl index aa3fa5e988..9c44728e19 100644 --- a/specs/binding-mqtt.spec/src/main/resources/META-INF/zilla/mqtt.idl +++ b/specs/binding-mqtt.spec/src/main/resources/META-INF/zilla/mqtt.idl @@ -227,6 +227,7 @@ scope mqtt { string16 serverRef = null; uint8 reasonCode = 0; + string16 reason = null; } union MqttFlushEx switch (uint8) extends core::stream::Extension diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/client.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/client.rpt new file mode 100644 index 0000000000..6b7b0ceec6 --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/client.rpt @@ -0,0 +1,51 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +connect "zilla://streams/app0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .clientId("client") + .build() + .build()} + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .flags("CLEAN_START") + .qosMax(2) + .packetSizeMax(66560) + .capabilities("RETAIN", "WILDCARD", "SUBSCRIPTION_IDS", "SHARED_SUBSCRIPTIONS") + .clientId("client") + .build() + .build()} + +connected + +read zilla:data.empty + +read zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .reason("Invalid session expiry interval") + .build()} + +write aborted +read abort + diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/server.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/server.rpt new file mode 100644 index 0000000000..ec97e6429e --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.after.connack/server.rpt @@ -0,0 +1,52 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +accept "zilla://streams/app0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .clientId("client") + .build() + .build()} + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .flags("CLEAN_START") + .qosMax(2) + .packetSizeMax(66560) + .capabilities("RETAIN", "WILDCARD", "SUBSCRIPTION_IDS", "SHARED_SUBSCRIPTIONS") + .clientId("client") + .build() + .build()} + +connected + +write zilla:data.empty + +write zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .reason("Invalid session expiry interval") + .build()} + +read abort +write aborted diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/client.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/client.rpt new file mode 100644 index 0000000000..e4e3a14673 --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/client.rpt @@ -0,0 +1,49 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +connect "zilla://streams/app0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .clientId("client") + .build() + .build()} + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .flags("CLEAN_START") + .qosMax(2) + .packetSizeMax(66560) + .capabilities("RETAIN", "WILDCARD", "SUBSCRIPTION_IDS", "SHARED_SUBSCRIPTIONS") + .clientId("client") + .build() + .build()} + +connected + +read zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .reason("Invalid session expiry interval") + .build()} + +write aborted +read abort + diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/server.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/server.rpt new file mode 100644 index 0000000000..20e60a236f --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/application/session.invalid.session.timeout.before.connack/server.rpt @@ -0,0 +1,50 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +accept "zilla://streams/app0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .session() + .clientId("client") + .build() + .build()} + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .session() + .flags("CLEAN_START") + .qosMax(2) + .packetSizeMax(66560) + .capabilities("RETAIN", "WILDCARD", "SUBSCRIPTION_IDS", "SHARED_SUBSCRIPTIONS") + .clientId("client") + .build() + .build()} + +connected + +write zilla:reset.ext ${mqtt:resetEx() + .typeId(zilla:id("mqtt")) + .reasonCode(131) + .reason("Invalid session expiry interval") + .build()} + +read abort +write aborted diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/client.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/client.rpt new file mode 100644 index 0000000000..0dbe81475a --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/client.rpt @@ -0,0 +1,43 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +connect "zilla://streams/net0" + option zilla:window 8192 + option zilla:transmission "duplex" + option zilla:byteorder "network" + +connected + +write [0x10 0x13] # CONNECT + [0x00 0x04] "MQTT" # protocol name + [0x05] # protocol version + [0x02] # flags = clean start + [0x00 0x3c] # keep alive = 60s + [0x00] # properties = none + [0x00 0x06] "client" # client id + +read [0x20 0x08] # CONNACK + [0x00] # flags = none + [0x00] # reason code + [0x05] # properties + [0x27] 66560 # maximum packet size = 66560 + +read [0xe0 0x24] # DISCONNECT + [0x83] # reason = implementation specific error + [0x22] # properties + [0x1f 0x00 0x1f] "Invalid session expiry interval" # reason string + +read closed diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/server.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/server.rpt new file mode 100644 index 0000000000..0d2cdc0ba0 --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.after.connack/server.rpt @@ -0,0 +1,44 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +accept "zilla://streams/net0" + option zilla:window 8192 + option zilla:transmission "duplex" + option zilla:byteorder "network" + +accepted +connected + +read [0x10 0x13] # CONNECT + [0x00 0x04] "MQTT" # protocol name + [0x05] # protocol version + [0x02] # flags = clean start + [0x00 0x3c] # keep alive = 60s + [0x00] # properties = none + [0x00 0x06] "client" # client id + +write [0x20 0x08] # CONNACK + [0x00] # flags = none + [0x00] # reason code + [0x05] # properties + [0x27] 66560 # maximum packet size = 66560 + +write [0xe0 0x24] # DISCONNECT + [0x83] # reason = implementation specific error + [0x22] # properties + [0x1f 0x00 0x1f] "Invalid session expiry interval" # reason string + +write close diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/client.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/client.rpt new file mode 100644 index 0000000000..22d62d8bbb --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/client.rpt @@ -0,0 +1,38 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +connect "zilla://streams/net0" + option zilla:window 8192 + option zilla:transmission "duplex" + option zilla:byteorder "network" + +connected + +write [0x10 0x13] # CONNECT + [0x00 0x04] "MQTT" # protocol name + [0x05] # protocol version + [0x02] # flags = clean start + [0x00 0x3c] # keep alive = 60s + [0x00] # properties = none + [0x00 0x06] "client" # client id + +read [0x20 0x25] # CONNACK + [0x00] # flags = none + [0x83] # reason code = = implementation specific error + [0x22] # properties + [0x1f 0x00 0x1f] "Invalid session expiry interval" # reason string + +read closed diff --git a/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/server.rpt b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/server.rpt new file mode 100644 index 0000000000..4b86ea54af --- /dev/null +++ b/specs/binding-mqtt.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/session.invalid.session.timeout.before.connack/server.rpt @@ -0,0 +1,39 @@ +# +# Copyright 2021-2023 Aklivity Inc. +# +# Aklivity licenses this file to you under the Apache License, +# version 2.0 (the "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at: +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the +# License for the specific language governing permissions and limitations +# under the License. +# + +accept "zilla://streams/net0" + option zilla:window 8192 + option zilla:transmission "duplex" + option zilla:byteorder "network" + +accepted +connected + +read [0x10 0x13] # CONNECT + [0x00 0x04] "MQTT" # protocol name + [0x05] # protocol version + [0x02] # flags = clean start + [0x00 0x3c] # keep alive = 60s + [0x00] # properties = none + [0x00 0x06] "client" # client id + +write [0x20 0x25] # CONNACK + [0x00] # flags = none + [0x83] # reason code = = implementation specific error + [0x22] # properties + [0x1f 0x00 0x1f] "Invalid session expiry interval" # reason string + +write close diff --git a/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctionsTest.java b/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctionsTest.java index 5f93f65fe5..b40abe4eae 100644 --- a/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctionsTest.java +++ b/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/internal/MqttFunctionsTest.java @@ -1218,12 +1218,14 @@ public void shouldEncodeMqttResetEx() .typeId(0) .serverRef("mqtt-1.example.com:1883") .reasonCode(0) + .reason("test") .build(); DirectBuffer buffer = new UnsafeBuffer(array); MqttResetExFW mqttResetEx = new MqttResetExFW().wrap(buffer, 0, buffer.capacity()); assertEquals(0, mqttResetEx.typeId()); assertEquals("mqtt-1.example.com:1883", mqttResetEx.serverRef().asString()); + assertEquals("test", mqttResetEx.reason().asString()); assertEquals(0, mqttResetEx.reasonCode()); } diff --git a/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/application/SessionIT.java b/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/application/SessionIT.java index 3e136d862f..c1f139f2d6 100644 --- a/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/application/SessionIT.java +++ b/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/application/SessionIT.java @@ -208,4 +208,22 @@ public void shouldSubscribeAndPublishToNonDefaultRoute() throws Exception { k3po.finish(); } + + @Test + @Specification({ + "${app}/session.invalid.session.timeout.after.connack/client", + "${app}/session.invalid.session.timeout.after.connack/server"}) + public void shouldPropagateMqttReasonCodeAndStringAfterConnack() throws Exception + { + k3po.finish(); + } + + @Test + @Specification({ + "${app}/session.invalid.session.timeout.before.connack/client", + "${app}/session.invalid.session.timeout.before.connack/server"}) + public void shouldPropagateMqttReasonCodeAndStringBeforeConnack() throws Exception + { + k3po.finish(); + } } diff --git a/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/SessionIT.java b/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/SessionIT.java index 24b48d162e..a0da7b4841 100644 --- a/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/SessionIT.java +++ b/specs/binding-mqtt.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/streams/network/v5/SessionIT.java @@ -191,4 +191,22 @@ public void shouldSubscribeAndPublishToNonDefaultRoute() throws Exception { k3po.finish(); } + + @Test + @Specification({ + "${net}/session.invalid.session.timeout.after.connack/client", + "${net}/session.invalid.session.timeout.after.connack/server"}) + public void shouldPropagateMqttReasonCodeAndStringAfterConnack() throws Exception + { + k3po.finish(); + } + + @Test + @Specification({ + "${net}/session.invalid.session.timeout.before.connack/client", + "${net}/session.invalid.session.timeout.before.connack/server"}) + public void shouldPropagateMqttReasonCodeAndStringBeforeConnack() throws Exception + { + k3po.finish(); + } } From 27607f08f95eee44c19c6d1920abb21c6a1897f4 Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Mon, 18 Dec 2023 17:41:42 -0800 Subject: [PATCH 10/16] Bump actions/upload-artifact from 3 to 4 (#645) Bumps [actions/upload-artifact](https://github.com/actions/upload-artifact) from 3 to 4. - [Release notes](https://github.com/actions/upload-artifact/releases) - [Commits](https://github.com/actions/upload-artifact/compare/v3...v4) --- updated-dependencies: - dependency-name: actions/upload-artifact dependency-type: direct:production update-type: version-update:semver-major ... Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> --- .github/workflows/build.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/build.yml b/.github/workflows/build.yml index c310bc9e57..c85e92ec20 100644 --- a/.github/workflows/build.yml +++ b/.github/workflows/build.yml @@ -34,7 +34,7 @@ jobs: - name: Build with Maven run: ./mvnw -B -U -nsu -Ddocker.logStdout -Dfailsafe.skipAfterFailureCount=1 -Ddocker.verbose install jacoco:report-aggregate - name: Conditional Artifact Upload - uses: actions/upload-artifact@v3 + uses: actions/upload-artifact@v4 if: failure() with: name: zilla-dump From 5faf7be00d88ba9f2441184454477a47f72046e8 Mon Sep 17 00:00:00 2001 From: Attila Kreiner Date: Fri, 22 Dec 2023 14:46:31 +0100 Subject: [PATCH 11/16] Add end-to-end testing for the `dump` command (#646) --- incubator/command-dump/README.md | 11 + incubator/command-dump/pom.xml | 41 +- .../command/dump/internal/airline/zilla.lua | 202 ++- .../dump/internal/airline/WiresharkIT.java | 137 ++ .../airline/ZillaDumpCommandTest.java | 697 ++++++-- .../command/dump/internal/airline/Dockerfile | 23 + .../dump/internal/airline/engine/bindings | Bin 0 -> 320 bytes .../dump/internal/airline/engine/data0 | Bin 0 -> 8960 bytes .../{engine/data0 => airline/engine/data1} | Bin 8960 -> 8960 bytes .../dump/internal/airline/engine/data2 | Bin 0 -> 8960 bytes .../dump/internal/airline/engine/labels | 25 + .../dump/internal/airline/expected_dump.pcap | Bin 0 -> 9393 bytes .../dump/internal/airline/expected_dump.txt | 1433 +++++++++++++++++ .../airline/expected_filtered_dump.pcap | Bin 0 -> 272 bytes .../airline/expected_filtered_dump.txt | 29 + .../command/dump/internal/engine/bindings | Bin 320 -> 0 bytes .../command/dump/internal/engine/labels | 5 - .../expected_dump_with_kafka_filter.pcap | Bin 236 -> 0 bytes .../expected_dump_without_filter.pcap | Bin 2148 -> 0 bytes 19 files changed, 2427 insertions(+), 176 deletions(-) create mode 100644 incubator/command-dump/README.md create mode 100644 incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/WiresharkIT.java create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/Dockerfile create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/bindings create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data0 rename incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/{engine/data0 => airline/engine/data1} (87%) create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data2 create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/labels create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.pcap create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.pcap create mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.txt delete mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/bindings delete mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/labels delete mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_with_kafka_filter.pcap delete mode 100644 incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_without_filter.pcap diff --git a/incubator/command-dump/README.md b/incubator/command-dump/README.md new file mode 100644 index 0000000000..751d641d9a --- /dev/null +++ b/incubator/command-dump/README.md @@ -0,0 +1,11 @@ +The `dump` command creates a `pcap` file that can be opened by Wireshark using the `zilla.lua` dissector plugin. + +`WiresharkIT` is an integration test that tests the `zilla.lua` dissector by running `tshark` in a docker container. If it doesn't find the image, it builds it on-the-fly, but the process is faster if the `tshark` image is pre-built. + +This is the command to build a multi-arch `tshark` image and push it to a docker repository: + +```bash +cd /incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline +docker buildx create --name container --driver=docker-container +docker buildx build --tag /tshark: --platform linux/arm64/v8,linux/amd64 --builder container --push . +``` diff --git a/incubator/command-dump/pom.xml b/incubator/command-dump/pom.xml index fc19d097e1..943835040a 100644 --- a/incubator/command-dump/pom.xml +++ b/incubator/command-dump/pom.xml @@ -49,11 +49,47 @@ ${project.version} provided + + io.aklivity.zilla + binding-proxy.spec + ${project.version} + test + + + io.aklivity.zilla + binding-http.spec + ${project.version} + test + org.junit.jupiter junit-jupiter-engine test + + org.testcontainers + testcontainers + 1.19.3 + test + + + org.testcontainers + junit-jupiter + 1.19.3 + test + + + org.slf4j + slf4j-api + 1.7.36 + test + + + org.slf4j + slf4j-simple + 1.7.36 + test + @@ -67,8 +103,9 @@ license-maven-plugin - src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/* - src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/* + src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/*.pcap + src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/*.txt + src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/* diff --git a/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua b/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua index aa03292610..4645b8fae5 100644 --- a/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua +++ b/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua @@ -56,7 +56,7 @@ local flags_types = { [1] = "Set" } -local ext_proxy_address_family_types = { +local proxy_ext_address_family_types = { [0] = "INET", [1] = "INET4", [2] = "INET6", @@ -64,12 +64,12 @@ local ext_proxy_address_family_types = { [4] = "NONE", } -local ext_proxy_address_protocol_types = { +local proxy_ext_address_protocol_types = { [0] = "STREAM", [1] = "DATAGRAM", } -local ext_proxy_info_types = { +local proxy_ext_info_types = { [0x01] = "ALPN", [0x02] = "AUTHORITY", [0x05] = "IDENTITY", @@ -77,7 +77,7 @@ local ext_proxy_info_types = { [0x30] = "NAMESPACE", } -local ext_proxy_secure_info_types = { +local proxy_ext_secure_info_types = { [0x21] = "VERSION", [0x22] = "NAME", [0x23] = "CIPHER", @@ -144,38 +144,49 @@ local fields = { -- proxy extension -- address - ext_proxy_address_family = ProtoField.uint8("zilla.proxy_ext.address_family", "Family", base.DEC, - ext_proxy_address_family_types), - ext_proxy_address_protocol = ProtoField.uint8("zilla.proxy_ext.address_protocol", "Protocol", base.DEC, - ext_proxy_address_protocol_types), - ext_proxy_address_inet_source_port = ProtoField.uint16("zilla.proxy_ext.address_inet_source_port", "Source Port", + proxy_ext_address_family = ProtoField.uint8("zilla.proxy_ext.address_family", "Family", base.DEC, + proxy_ext_address_family_types), + proxy_ext_address_protocol = ProtoField.uint8("zilla.proxy_ext.address_protocol", "Protocol", base.DEC, + proxy_ext_address_protocol_types), + proxy_ext_address_inet_source_port = ProtoField.uint16("zilla.proxy_ext.address_inet_source_port", "Source Port", base.DEC), - ext_proxy_address_inet_destination_port = ProtoField.uint16("zilla.proxy_ext.address_inet_destination_port", + proxy_ext_address_inet_destination_port = ProtoField.uint16("zilla.proxy_ext.address_inet_destination_port", "Destination Port", base.DEC), - ext_proxy_address_inet_source = ProtoField.string("zilla.proxy_ext.address_inet_source", "Source", base.NONE), - ext_proxy_address_inet_destination = ProtoField.string("zilla.proxy_ext.address_inet_destination", "Destination", + proxy_ext_address_inet_source = ProtoField.string("zilla.proxy_ext.address_inet_source", "Source", base.NONE), + proxy_ext_address_inet_destination = ProtoField.string("zilla.proxy_ext.address_inet_destination", "Destination", base.NONE), - ext_proxy_address_inet4_source = ProtoField.new("Source", "zilla.proxy_ext.address_inet4_source", ftypes.IPv4), - ext_proxy_address_inet4_destination = ProtoField.new("Destination", "zilla.proxy_ext.address_inet4_destination", + proxy_ext_address_inet4_source = ProtoField.new("Source", "zilla.proxy_ext.address_inet4_source", ftypes.IPv4), + proxy_ext_address_inet4_destination = ProtoField.new("Destination", "zilla.proxy_ext.address_inet4_destination", ftypes.IPv4), - ext_proxy_address_inet6_source = ProtoField.new("Source", "zilla.proxy_ext.address_inet6_source", ftypes.IPv6), - ext_proxy_address_inet6_destination = ProtoField.new("Destination", "zilla.proxy_ext.address_inet6_destination", + proxy_ext_address_inet6_source = ProtoField.new("Source", "zilla.proxy_ext.address_inet6_source", ftypes.IPv6), + proxy_ext_address_inet6_destination = ProtoField.new("Destination", "zilla.proxy_ext.address_inet6_destination", ftypes.IPv6), - ext_proxy_address_unix_source = ProtoField.string("zilla.proxy_ext.address_unix_source", "Source", base.NONE), - ext_proxy_address_unix_destination = ProtoField.string("zilla.proxy_ext.address_unix_destination", "Destination", + proxy_ext_address_unix_source = ProtoField.string("zilla.proxy_ext.address_unix_source", "Source", base.NONE), + proxy_ext_address_unix_destination = ProtoField.string("zilla.proxy_ext.address_unix_destination", "Destination", base.NONE), -- info - ext_proxy_info_array_length = ProtoField.uint8("zilla.proxy_ext.info_array_length", "Length", base.DEC), - ext_proxy_info_array_size = ProtoField.uint8("zilla.proxy_ext.info_array_size", "Size", base.DEC), - ext_proxy_info_type = ProtoField.uint8("zilla.proxy_ext.info_type", "Type", base.HEX, ext_proxy_info_types), - ext_proxy_info_length = ProtoField.uint16("zilla.proxy_ext.info_length", "Length", base.DEC), - ext_proxy_info_alpn = ProtoField.string("zilla.proxy_ext.info_alpn", "Value", base.NONE), - ext_proxy_info_authority = ProtoField.string("zilla.proxy_ext.info_authority", "Value", base.NONE), - ext_proxy_info_identity = ProtoField.bytes("zilla.proxy_ext.info_identity", "Value", base.NONE), - ext_proxy_info_namespace = ProtoField.string("zilla.proxy_ext.info_namespace", "Value", base.NONE), - ext_proxy_info_secure = ProtoField.string("zilla.proxy_ext.info_secure", "Value", base.NONE), - ext_proxy_info_secure_type = ProtoField.uint8("zilla.proxy_ext.info_secure_type", "Secure Type", base.HEX, - ext_proxy_secure_info_types), + proxy_ext_info_array_length = ProtoField.uint8("zilla.proxy_ext.info_array_length", "Length", base.DEC), + proxy_ext_info_array_size = ProtoField.uint8("zilla.proxy_ext.info_array_size", "Size", base.DEC), + proxy_ext_info_type = ProtoField.uint8("zilla.proxy_ext.info_type", "Type", base.HEX, proxy_ext_info_types), + proxy_ext_info_length = ProtoField.uint16("zilla.proxy_ext.info_length", "Length", base.DEC), + proxy_ext_info_alpn = ProtoField.string("zilla.proxy_ext.info_alpn", "Value", base.NONE), + proxy_ext_info_authority = ProtoField.string("zilla.proxy_ext.info_authority", "Value", base.NONE), + proxy_ext_info_identity = ProtoField.bytes("zilla.proxy_ext.info_identity", "Value", base.NONE), + proxy_ext_info_namespace = ProtoField.string("zilla.proxy_ext.info_namespace", "Value", base.NONE), + proxy_ext_info_secure = ProtoField.string("zilla.proxy_ext.info_secure", "Value", base.NONE), + proxy_ext_info_secure_type = ProtoField.uint8("zilla.proxy_ext.info_secure_type", "Secure Type", base.HEX, + proxy_ext_secure_info_types), + + -- http extension + -- headers + http_ext_headers_array_length = ProtoField.uint8("zilla.http_ext.headers_array_length", "Length", base.DEC), + http_ext_headers_array_size = ProtoField.uint8("zilla.http_ext.headers_array_size", "Size", base.DEC), + http_ext_header_name_length = ProtoField.uint8("zilla.http_ext.header_name_length", "Length", base.DEC), + http_ext_header_name = ProtoField.string("zilla.http_ext.header_name", "Name", base.NONE), + http_ext_header_value_length = ProtoField.uint16("zilla.http_ext.header_value_length", "Length", base.DEC), + http_ext_header_value = ProtoField.string("zilla.http_ext.header_value", "Value", base.NONE), + -- promise id + http_ext_promise_id = ProtoField.uint64("zilla.promise_id", "Promise ID", base.HEX), } zilla_protocol.fields = fields; @@ -300,7 +311,7 @@ function zilla_protocol.dissector(buffer, pinfo, tree) if frame_type_id == BEGIN_ID then local slice_affinity = buffer(frame_offset + 72, 8) subtree:add_le(fields.affinity, slice_affinity) - handle_extension(buffer, subtree, pinfo, info, frame_offset + 80) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 80, frame_type_id) end -- data @@ -333,7 +344,7 @@ function zilla_protocol.dissector(buffer, pinfo, tree) payload_subtree:add(fields.payload, slice_payload) end - handle_extension(buffer, subtree, pinfo, info, frame_offset + 89 + payload_length) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 89 + payload_length, frame_type_id) local dissector = resolve_dissector(protocol_type, slice_payload:tvb()) if dissector then @@ -343,12 +354,12 @@ function zilla_protocol.dissector(buffer, pinfo, tree) -- end if frame_type_id == END_ID then - handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72, frame_type_id) end -- abort if frame_type_id == ABORT_ID then - handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72, frame_type_id) end -- flush @@ -357,12 +368,12 @@ function zilla_protocol.dissector(buffer, pinfo, tree) local slice_reserved = buffer(frame_offset + 80, 4) subtree:add_le(fields.budget_id, slice_budget_id) subtree:add_le(fields.reserved, slice_reserved) - handle_extension(buffer, subtree, pinfo, info, frame_offset + 84) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 84, frame_type_id) end -- reset if frame_type_id == RESET_ID then - handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72, frame_type_id) end -- window @@ -405,7 +416,7 @@ function zilla_protocol.dissector(buffer, pinfo, tree) -- challenge if frame_type_id == CHALLENGE_ID then - handle_extension(buffer, subtree, pinfo, info, frame_offset + 72) + handle_extension(buffer, subtree, pinfo, info, frame_offset + 72, frame_type_id) end end @@ -476,7 +487,7 @@ function resolve_http_dissector(payload) end end -function handle_extension(buffer, subtree, pinfo, info, offset) +function handle_extension(buffer, subtree, pinfo, info, offset, frame_type_id) if buffer:len() > offset then local slice_stream_type_id = buffer(offset, 4) local stream_type_id = slice_stream_type_id:le_uint(); @@ -489,6 +500,8 @@ function handle_extension(buffer, subtree, pinfo, info, offset) if stream_type_id == PROXY_ID then handle_proxy_extension(buffer, extension_subtree, offset + 4) + elseif stream_type_id == HTTP_ID then + handle_http_extension(buffer, extension_subtree, offset + 4, frame_type_id) end if stream_type and stream_type ~= "" then @@ -501,7 +514,7 @@ function handle_proxy_extension(buffer, extension_subtree, offset) -- address local slice_address_family = buffer(offset, 1) local address_family_id = slice_address_family:le_int() - local address_family = ext_proxy_address_family_types[address_family_id] + local address_family = proxy_ext_address_family_types[address_family_id] local address_subtree_label = string.format("Address: %s", address_family) local info_offset if address_family == "INET" then @@ -514,12 +527,12 @@ function handle_proxy_extension(buffer, extension_subtree, offset) local slice_destination_port = buffer(offset + 8 + source_length + destination_length, 2) local length = 10 + source_length + destination_length local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) - address_subtree:add(fields.ext_proxy_address_family, slice_address_family) - address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) - address_subtree:add(fields.ext_proxy_address_inet_source, slice_source) - address_subtree:add_le(fields.ext_proxy_address_inet_source_port, slice_source_port) - address_subtree:add(fields.ext_proxy_address_inet_destination, slice_destination) - address_subtree:add_le(fields.ext_proxy_address_inet_destination_port, slice_destination_port) + address_subtree:add(fields.proxy_ext_address_family, slice_address_family) + address_subtree:add(fields.proxy_ext_address_protocol, slice_protocol) + address_subtree:add(fields.proxy_ext_address_inet_source, slice_source) + address_subtree:add_le(fields.proxy_ext_address_inet_source_port, slice_source_port) + address_subtree:add(fields.proxy_ext_address_inet_destination, slice_destination) + address_subtree:add_le(fields.proxy_ext_address_inet_destination_port, slice_destination_port) info_offset = offset + length elseif address_family == "INET4" then local slice_protocol = buffer(offset + 1, 1) @@ -529,12 +542,12 @@ function handle_proxy_extension(buffer, extension_subtree, offset) local slice_destination_port = buffer(offset + 12, 2) local length = 14; local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) - address_subtree:add(fields.ext_proxy_address_family, slice_address_family) - address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) - address_subtree:add(fields.ext_proxy_address_inet4_source, slice_source) - address_subtree:add_le(fields.ext_proxy_address_inet_source_port, slice_source_port) - address_subtree:add(fields.ext_proxy_address_inet4_destination, slice_destination) - address_subtree:add_le(fields.ext_proxy_address_inet_destination_port, slice_destination_port) + address_subtree:add(fields.proxy_ext_address_family, slice_address_family) + address_subtree:add(fields.proxy_ext_address_protocol, slice_protocol) + address_subtree:add(fields.proxy_ext_address_inet4_source, slice_source) + address_subtree:add_le(fields.proxy_ext_address_inet_source_port, slice_source_port) + address_subtree:add(fields.proxy_ext_address_inet4_destination, slice_destination) + address_subtree:add_le(fields.proxy_ext_address_inet_destination_port, slice_destination_port) info_offset = offset + length elseif address_family == "INET6" then local slice_protocol = buffer(offset + 1, 1) @@ -544,12 +557,12 @@ function handle_proxy_extension(buffer, extension_subtree, offset) local slice_destination_port = buffer(offset + 36, 2) local length = 38; local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) - address_subtree:add(fields.ext_proxy_address_family, slice_address_family) - address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) - address_subtree:add(fields.ext_proxy_address_inet6_source, slice_source) - address_subtree:add_le(fields.ext_proxy_address_inet_source_port, slice_source_port) - address_subtree:add(fields.ext_proxy_address_inet6_destination, slice_destination) - address_subtree:add_le(fields.ext_proxy_address_inet_destination_port, slice_destination_port) + address_subtree:add(fields.proxy_ext_address_family, slice_address_family) + address_subtree:add(fields.proxy_ext_address_protocol, slice_protocol) + address_subtree:add(fields.proxy_ext_address_inet6_source, slice_source) + address_subtree:add_le(fields.proxy_ext_address_inet_source_port, slice_source_port) + address_subtree:add(fields.proxy_ext_address_inet6_destination, slice_destination) + address_subtree:add_le(fields.proxy_ext_address_inet_destination_port, slice_destination_port) info_offset = offset + length; elseif address_family == "UNIX" then local slice_protocol = buffer(offset + 1, 1) @@ -557,15 +570,15 @@ function handle_proxy_extension(buffer, extension_subtree, offset) local slice_destination = buffer(offset + 110, 108) local length = 218 local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) - address_subtree:add(fields.ext_proxy_address_family, slice_address_family) - address_subtree:add(fields.ext_proxy_address_protocol, slice_protocol) - address_subtree:add(fields.ext_proxy_address_unix_source, slice_source) - address_subtree:add(fields.ext_proxy_address_unix_destination, slice_destination) + address_subtree:add(fields.proxy_ext_address_family, slice_address_family) + address_subtree:add(fields.proxy_ext_address_protocol, slice_protocol) + address_subtree:add(fields.proxy_ext_address_unix_source, slice_source) + address_subtree:add(fields.proxy_ext_address_unix_destination, slice_destination) info_offset = offset + length elseif address_family == "NONE" then local length = 1 local address_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), address_subtree_label) - address_subtree:add(fields.ext_proxy_address_family, slice_address_family) + address_subtree:add(fields.proxy_ext_address_family, slice_address_family) info_offset = offset + length end @@ -577,37 +590,37 @@ function handle_proxy_extension(buffer, extension_subtree, offset) local length = 8 local label = string.format("Info (%d items)", info_array_size) local info_array_subtree = extension_subtree:add(zilla_protocol, buffer(info_offset, length), label) - info_array_subtree:add_le(fields.ext_proxy_info_array_length, slice_info_array_length) - info_array_subtree:add_le(fields.ext_proxy_info_array_size, slice_info_array_size) + info_array_subtree:add_le(fields.proxy_ext_info_array_length, slice_info_array_length) + info_array_subtree:add_le(fields.proxy_ext_info_array_size, slice_info_array_size) local item_offset = info_offset + length for i = 1, info_array_size do local slice_type_id = buffer(item_offset, 1) local type_id = slice_type_id:le_int() - local type = ext_proxy_info_types[type_id] + local type = proxy_ext_info_types[type_id] local label_format = "Info: %s: %s" item_offset = item_offset + 1 if type == "ALPN" then local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 1) add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, - slice_length, slice_text, fields.ext_proxy_info_type, fields.ext_proxy_info_length, fields.ext_proxy_info_alpn) + slice_length, slice_text, fields.proxy_ext_info_type, fields.proxy_ext_info_length, fields.proxy_ext_info_alpn) item_offset = item_offset + item_length elseif type == "AUTHORITY" then local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 2) add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, - slice_length, slice_text, fields.ext_proxy_info_type, fields.ext_proxy_info_length, fields.ext_proxy_info_authority) + slice_length, slice_text, fields.proxy_ext_info_type, fields.proxy_ext_info_length, fields.proxy_ext_info_authority) item_offset = item_offset + item_length elseif type == "IDENTITY" then local item_length, slice_length, slice_bytes = dissect_length_value(buffer, item_offset, 2) local label = string.format("Info: %s: 0x%s", type, slice_bytes:bytes()) local subtree = extension_subtree:add(zilla_protocol, buffer(item_offset - 1, item_length + 1), label) - subtree:add(fields.ext_proxy_info_type, slice_type_id) - subtree:add_le(fields.ext_proxy_info_length, slice_length) - subtree:add(fields.ext_proxy_info_identity, slice_bytes) + subtree:add(fields.proxy_ext_info_type, slice_type_id) + subtree:add_le(fields.proxy_ext_info_length, slice_length) + subtree:add(fields.proxy_ext_info_identity, slice_bytes) item_offset = item_offset + item_length elseif type == "SECURE" then local slice_secure_type_id = buffer(item_offset, 1) local secure_type_id = slice_secure_type_id:le_int(); - local secure_type = ext_proxy_secure_info_types[secure_type_id] + local secure_type = proxy_ext_secure_info_types[secure_type_id] item_offset = item_offset + 1 local length_length if secure_type == "VERSION" or secure_type == "CIPHER" or secure_type == "SIGNATURE" or secure_type == "KEY" then @@ -618,15 +631,15 @@ function handle_proxy_extension(buffer, extension_subtree, offset) local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, length_length) local label = string.format("Info: %s: %s: %s", type, secure_type, slice_text:string()) local subtree = extension_subtree:add(zilla_protocol, buffer(item_offset - 1, item_length + 1), label) - subtree:add(fields.ext_proxy_info_type, slice_type_id) - subtree:add(fields.ext_proxy_info_secure_type, slice_secure_type_id) - subtree:add_le(fields.ext_proxy_info_length, slice_length) - subtree:add(fields.ext_proxy_info_secure, slice_text) + subtree:add(fields.proxy_ext_info_type, slice_type_id) + subtree:add(fields.proxy_ext_info_secure_type, slice_secure_type_id) + subtree:add_le(fields.proxy_ext_info_length, slice_length) + subtree:add(fields.proxy_ext_info_secure, slice_text) item_offset = item_offset + item_length elseif type == "NAMESPACE" then local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 2) add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, - slice_length, slice_text, fields.ext_proxy_info_type, fields.ext_proxy_info_length, fields.ext_proxy_info_namespace) + slice_length, slice_text, fields.proxy_ext_info_type, fields.proxy_ext_info_length, fields.proxy_ext_info_namespace) item_offset = item_offset + item_length end end @@ -643,7 +656,7 @@ end function add_string_as_subtree(buffer, tree, label_format, slice_type_id, slice_length, slice_text, field_type, field_length, field_text) local type_id = slice_type_id:le_int() - local type = ext_proxy_info_types[type_id] + local type = proxy_ext_info_types[type_id] local text = slice_text:string() local label = string.format(label_format, type, text) local subtree = tree:add(zilla_protocol, buffer, label) @@ -652,5 +665,42 @@ function add_string_as_subtree(buffer, tree, label_format, slice_type_id, slice_ subtree:add(field_text, slice_text) end +function handle_http_extension(buffer, extension_subtree, offset, frame_type_id) + if frame_type_id == BEGIN_ID or frame_type_id == RESET_ID or frame_type_id == CHALLENGE_ID then + dissect_and_add_http_headers(buffer, extension_subtree, offset, "Headers", "Header") + elseif frame_type_id == END_ID then + dissect_and_add_http_headers(buffer, extension_subtree, offset, "Trailers", "Trailer") + elseif frame_type_id == FLUSH_ID then + slice_promise_id = buffer(offset, 8) + extension_subtree:add_le(fields.http_ext_promise_id, slice_promise_id) + dissect_and_add_http_headers(buffer, extension_subtree, offset + 8, "Promises", "Promise") + end +end + +function dissect_and_add_http_headers(buffer, extension_subtree, offset, plural_name, singular_name) + local slice_headers_array_length = buffer(offset, 4) + local slice_headers_array_size = buffer(offset + 4, 4) + local headers_array_length = slice_headers_array_length:le_int() + local headers_array_size = slice_headers_array_size:le_int() + local length = 8 + local label = string.format("%s (%d items)", plural_name, headers_array_size) + local headers_array_subtree = extension_subtree:add(zilla_protocol, buffer(offset, length), label) + headers_array_subtree:add_le(fields.http_ext_headers_array_length, slice_headers_array_length) + headers_array_subtree:add_le(fields.http_ext_headers_array_size, slice_headers_array_size) + local item_offset = offset + length + for i = 1, headers_array_size do + local name_length, slice_name_length, slice_name = dissect_length_value(buffer, item_offset, 1) + local value_offset = item_offset + name_length + local value_length, slice_value_length, slice_value = dissect_length_value(buffer, value_offset, 2) + local label = string.format("%s: %s: %s", singular_name, slice_name:string(), slice_value:string()) + local subtree = extension_subtree:add(zilla_protocol, buffer(item_offset, name_length + value_length), label) + subtree:add_le(fields.http_ext_header_name_length, slice_name_length) + subtree:add(fields.http_ext_header_name, slice_name) + subtree:add_le(fields.http_ext_header_value_length, slice_value_length) + subtree:add(fields.http_ext_header_value, slice_value) + item_offset = item_offset + name_length + value_length + end +end + local data_dissector = DissectorTable.get("tcp.port") data_dissector:add(7114, zilla_protocol) diff --git a/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/WiresharkIT.java b/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/WiresharkIT.java new file mode 100644 index 0000000000..2f1850edf5 --- /dev/null +++ b/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/WiresharkIT.java @@ -0,0 +1,137 @@ +/* + * Copyright 2021-2023 Aklivity Inc + * + * Licensed under the Aklivity Community License (the "License"); you may not use + * this file except in compliance with the License. You may obtain a copy of the + * License at + * + * https://www.aklivity.io/aklivity-community-license/ + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT + * WARRANTIES OF ANY KIND, either express or implied. See the License for the + * specific language governing permissions and limitations under the License. + */ +package io.aklivity.zilla.runtime.command.dump.internal.airline; + +import static org.hamcrest.MatcherAssert.assertThat; +import static org.hamcrest.Matchers.equalTo; +import static org.junit.jupiter.api.TestInstance.Lifecycle.PER_CLASS; + +import java.io.IOException; +import java.io.InputStream; +import java.net.URI; +import java.net.URL; +import java.nio.file.Files; +import java.nio.file.Path; + +import org.junit.jupiter.api.AfterAll; +import org.junit.jupiter.api.BeforeAll; +import org.junit.jupiter.api.Test; +import org.junit.jupiter.api.TestInstance; +import org.testcontainers.containers.Container; +import org.testcontainers.containers.ContainerFetchException; +import org.testcontainers.containers.GenericContainer; +import org.testcontainers.containers.wait.strategy.Wait; +import org.testcontainers.containers.wait.strategy.WaitStrategy; +import org.testcontainers.images.builder.ImageFromDockerfile; +import org.testcontainers.images.builder.Transferable; +import org.testcontainers.utility.DockerImageName; + +@TestInstance(PER_CLASS) +public class WiresharkIT +{ + private static final String TSHARK_DOCKER_IMAGE = "kreinerattila/tshark:4.2.0"; + private static final String COMMAND = "sleep infinity"; + private static final WaitStrategy WAIT_STRATEGY = Wait.forSuccessfulCommand("echo 42"); + + private GenericContainer tshark; + + @BeforeAll + public void setUp() throws IOException + { + try + { + System.out.printf("Starting the container using image %s...%n", TSHARK_DOCKER_IMAGE); + DockerImageName image = DockerImageName.parse(TSHARK_DOCKER_IMAGE); + tshark = new GenericContainer<>(image) + .withCommand(COMMAND) + .waitingFor(WAIT_STRATEGY); + tshark.start(); + } + catch (ContainerFetchException ex) + { + System.out.printf("Image %s was not found, building it now...%n", TSHARK_DOCKER_IMAGE); + ImageFromDockerfile image = new ImageFromDockerfile().withDockerfile(resourceToPath("Dockerfile")); + tshark = new GenericContainer<>(image) + .withCommand(COMMAND) + .waitingFor(WAIT_STRATEGY); + tshark.start(); + } + assert tshark.isRunning(); + System.out.printf("Container %s (%s) is running!%n", tshark.getContainerName(), tshark.getContainerId()); + copyResource("zilla.lua", tshark, "/home/tshark/.local/lib/wireshark/plugins/zilla.lua"); + } + + @AfterAll + public void close() + { + tshark.close(); + } + + @Test + public void shouldMatchExpectedOutput() throws Exception + { + // GIVEN + String pcapFileName = "expected_dump.pcap"; + String containerPath = String.format("/opt/%s", pcapFileName); + copyResource(pcapFileName, tshark, containerPath); + String expectedText = Files.readString(resourceToPath("expected_dump.txt")); + + // WHEN + String protocols = "zilla,http,http2"; + Container.ExecResult result = tshark.execInContainer("tshark", "-O", protocols, "-r", containerPath); + + // THEN + assertThat(result.getExitCode(), equalTo(0)); + assertThat(result.getStdout(), equalTo(expectedText)); + } + + @Test + public void shouldMatchExpectedFilteredOutput() throws Exception + { + // GIVEN + String pcapFileName = "expected_filtered_dump.pcap"; + String containerPath = String.format("/opt/%s", pcapFileName); + copyResource(pcapFileName, tshark, containerPath); + String expectedText = Files.readString(resourceToPath("expected_filtered_dump.txt")); + + // WHEN + Container.ExecResult result = tshark.execInContainer("tshark", "-O", "zilla", "-r", containerPath); + + // THEN + assertThat(result.getExitCode(), equalTo(0)); + assertThat(result.getStdout(), equalTo(expectedText)); + } + + private static Path resourceToPath( + String name) + { + URL resource = WiresharkIT.class.getResource(name); + assert resource != null; + return Path.of(URI.create(resource.toString())); + } + + private static void copyResource( + String resourceName, + GenericContainer container, + String containerPath) throws IOException + { + assert container.isRunning(); + try (InputStream is = WiresharkIT.class.getResourceAsStream(resourceName)) + { + assert is != null; + container.copyFileToContainer(Transferable.of(is.readAllBytes()), containerPath); + } + } +} diff --git a/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java b/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java index 1cd8bb8831..7a87f4a11d 100644 --- a/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java +++ b/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java @@ -15,34 +15,62 @@ package io.aklivity.zilla.runtime.command.dump.internal.airline; import static java.util.Collections.singletonList; -import static org.junit.jupiter.api.Assertions.assertArrayEquals; -import static org.junit.jupiter.api.Assertions.assertEquals; +import static org.hamcrest.MatcherAssert.assertThat; +import static org.hamcrest.Matchers.equalTo; +import static org.junit.jupiter.api.TestInstance.Lifecycle.PER_CLASS; import java.io.File; import java.io.IOException; -import java.nio.charset.StandardCharsets; +import java.io.InputStream; import java.nio.file.Files; +import java.nio.file.Path; import java.nio.file.Paths; import java.util.List; +import org.agrona.BitUtil; +import org.agrona.DirectBuffer; import org.agrona.MutableDirectBuffer; import org.agrona.concurrent.UnsafeBuffer; import org.agrona.concurrent.ringbuffer.RingBuffer; import org.junit.jupiter.api.BeforeAll; import org.junit.jupiter.api.BeforeEach; import org.junit.jupiter.api.Test; +import org.junit.jupiter.api.TestInstance; import org.junit.jupiter.api.io.TempDir; -import io.aklivity.zilla.runtime.command.dump.internal.types.OctetsFW; +import io.aklivity.zilla.runtime.command.dump.internal.types.String8FW; +import io.aklivity.zilla.runtime.command.dump.internal.types.stream.AbortFW; +import io.aklivity.zilla.runtime.command.dump.internal.types.stream.ChallengeFW; import io.aklivity.zilla.runtime.command.dump.internal.types.stream.DataFW; import io.aklivity.zilla.runtime.command.dump.internal.types.stream.EndFW; +import io.aklivity.zilla.runtime.command.dump.internal.types.stream.FlushFW; +import io.aklivity.zilla.runtime.command.dump.internal.types.stream.ResetFW; +import io.aklivity.zilla.runtime.command.dump.internal.types.stream.SignalFW; import io.aklivity.zilla.runtime.engine.internal.layouts.StreamsLayout; +import io.aklivity.zilla.specs.binding.http.internal.HttpFunctions; +import io.aklivity.zilla.specs.binding.proxy.internal.ProxyFunctions; import io.aklivity.zilla.specs.engine.internal.types.stream.BeginFW; import io.aklivity.zilla.specs.engine.internal.types.stream.WindowFW; +@TestInstance(PER_CLASS) public class ZillaDumpCommandTest { - private static String baseDir = "src/test/resources/io/aklivity/zilla/runtime/command/dump/internal"; + private static final int WORKERS = 3; + private static final int STREAMS_CAPACITY = 8 * 1024; + private static final Path ENGINE_PATH = + Path.of("src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine"); + private static final int PROXY_TYPE_ID = 5; + private static final int HTTP_TYPE_ID = 3; + + private final BeginFW.Builder beginRW = new BeginFW.Builder(); + private final DataFW.Builder dataRW = new DataFW.Builder(); + private final EndFW.Builder endRW = new EndFW.Builder(); + private final AbortFW.Builder abortRW = new AbortFW.Builder(); + private final FlushFW.Builder flushRW = new FlushFW.Builder(); + private final ResetFW.Builder resetRW = new ResetFW.Builder(); + private final WindowFW.Builder windowRW = new WindowFW.Builder(); + private final SignalFW.Builder signalRW = new SignalFW.Builder(); + private final ChallengeFW.Builder challengeRW = new ChallengeFW.Builder(); @TempDir private File tempDir; @@ -50,81 +78,124 @@ public class ZillaDumpCommandTest private ZillaDumpCommand command; @BeforeAll - public static void generateStreamsBuffer() + @SuppressWarnings("checkstyle:methodlength") + public void generateStreamsBuffer() throws Exception { - StreamsLayout streamsLayout = new StreamsLayout.Builder() - .path(Paths.get(baseDir, "engine").resolve("data0")) - .streamsCapacity(8 * 1024) - .readonly(false) - .build(); - - RingBuffer streams = streamsLayout.streamsBuffer(); - - MutableDirectBuffer frameBuffer = new UnsafeBuffer(new byte[1024 * 8]); - - BeginFW begin = new BeginFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) + RingBuffer[] streams = new RingBuffer[WORKERS]; + for (int i = 0; i < WORKERS; i++) + { + StreamsLayout streamsLayout = new StreamsLayout.Builder() + .path(ENGINE_PATH.resolve(String.format("data%d", i))) + .streamsCapacity(STREAMS_CAPACITY) + .readonly(false) + .build(); + streams[i] = streamsLayout.streamsBuffer(); + } + MutableDirectBuffer frameBuffer = new UnsafeBuffer(new byte[STREAMS_CAPACITY]); + + // worker 0 + SignalFW signal1 = signalRW.wrap(frameBuffer, 0, frameBuffer.capacity()) .originId(0) .routedId(0) .streamId(0) .sequence(0) .acknowledge(0) .maximum(0) - .affinity(0) + .timestamp(0x0000000000000001L) + .traceId(0x0000000000000001L) + .cancelId(0x0000000000007701L) + .signalId(0x00007702) + .contextId(0x00007703) .build(); + streams[0].write(SignalFW.TYPE_ID, signal1.buffer(), 0, signal1.sizeof()); - streams.write(BeginFW.TYPE_ID, begin.buffer(), 0, begin.sizeof()); - - BeginFW begin2 = new BeginFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) + DirectBuffer helloBuf = new String8FW("Hello World!").value(); + SignalFW signal2 = signalRW.wrap(frameBuffer, 0, frameBuffer.capacity()) .originId(0) - .routedId(1) - .streamId(1) - .sequence(1) + .routedId(0) + .streamId(0) + .sequence(0) .acknowledge(0) .maximum(0) - .affinity(0) + .timestamp(0x0000000000000002L) + .traceId(0x0000000000000000L) + .cancelId(0x0000000000007801L) + .signalId(0x00007802) + .contextId(0x00007803) + .payload(helloBuf, 0, helloBuf.capacity()) .build(); + streams[0].write(SignalFW.TYPE_ID, signal2.buffer(), 0, signal2.sizeof()); - streams.write(BeginFW.TYPE_ID, begin2.buffer(), 0, begin2.sizeof()); - - BeginFW filteredBegin = new BeginFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) - .originId(0) - .routedId(4294967298L) - .streamId(4) - .sequence(4) + BeginFW begin1 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000005L) // INI + .sequence(0) .acknowledge(0) .maximum(0) - .affinity(0) + .timestamp(0x0000000000000003L) + .traceId(0x0000000000000003L) + .affinity(0x0000000000000005L) .build(); + streams[0].write(BeginFW.TYPE_ID, begin1.buffer(), 0, begin1.sizeof()); - streams.write(BeginFW.TYPE_ID, filteredBegin.buffer(), 0, filteredBegin.sizeof()); - - WindowFW window1 = new WindowFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) - .originId(0) - .routedId(0) - .streamId(0) + WindowFW window1 = windowRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000005L) // INI .sequence(0) .acknowledge(0) - .maximum(0) + .maximum(65536) + .timestamp(0x0000000000000004L) + .traceId(0x0000000000000003L) .budgetId(0) .padding(0) .build(); + streams[0].write(WindowFW.TYPE_ID, window1.buffer(), 0, window1.sizeof()); - streams.write(WindowFW.TYPE_ID, window1.buffer(), 0, window1.sizeof()); - - WindowFW window2 = new WindowFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) - .originId(0) - .routedId(1) - .streamId(1) + BeginFW begin2 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP .sequence(1) .acknowledge(0) .maximum(0) + .timestamp(0x0000000000000005L) + .traceId(0x0000000000000003L) + .affinity(0) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin2.buffer(), 0, begin2.sizeof()); + + WindowFW window2 = windowRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(0) + .acknowledge(0) + .maximum(65536) + .timestamp(0x0000000000000006L) + .traceId(0x0000000000000003L) .budgetId(0) .padding(0) .build(); + streams[0].write(WindowFW.TYPE_ID, window2.buffer(), 0, window2.sizeof()); + + BeginFW filteredBegin = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000cL) // north_tls_server + .streamId(0x0000000000000077L) // INI + .sequence(71) + .acknowledge(72) + .maximum(73) + .timestamp(0x0000000000000007L) + .traceId(0x0000000000004202L) + .authorization(0x0000000000004203L) + .affinity(0x0000000000004204L) + .build(); + streams[0].write(BeginFW.TYPE_ID, filteredBegin.buffer(), 0, filteredBegin.sizeof()); - streams.write(WindowFW.TYPE_ID, window2.buffer(), 0, window2.sizeof()); - - String payload = "POST / HTTP/1.1\n" + + String http1request = + "POST / HTTP/1.1\n" + "Host: localhost:8080\n" + "User-Agent: curl/7.85.0\n" + "Accept: */*\n" + @@ -132,60 +203,482 @@ public static void generateStreamsBuffer() "Content-Length: 12\n" + "\n" + "Hello, world"; + DirectBuffer http1requestBuf = new String8FW(http1request).value(); + DataFW data1 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000005L) // INI + .sequence(123) + .acknowledge(456) + .maximum(777) + .timestamp(0x0000000000000008L) + .traceId(0x0000000000000003L) + .budgetId(0x0000000000004205L) + .reserved(0x00004206) + .payload(http1requestBuf, 0, http1requestBuf.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data1.buffer(), 0, data1.sizeof()); - byte[] payloadBytes = payload.getBytes(StandardCharsets.UTF_8); + String http1response = + "HTTP/1.1 200 OK\n" + + "Content-Type: text/plain\n" + + "Content-Length: 13\n" + + "\n" + + "Hello, World!"; + DirectBuffer http1responseBuf = new String8FW(http1response).value(); + DataFW data2 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(123) + .acknowledge(456) + .maximum(777) + .timestamp(0x0000000000000009L) + .traceId(0x0000000000000003L) + .budgetId(0x0000000000004205L) + .reserved(0x00004206) + .payload(http1responseBuf, 0, http1responseBuf.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data2.buffer(), 0, data2.sizeof()); + + ChallengeFW challenge1 = challengeRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(201) + .acknowledge(202) + .maximum(22222) + .timestamp(0x000000000000000aL) + .traceId(0x0000000000000003L) + .authorization(0x0000000000007742L) + .build(); + streams[0].write(ChallengeFW.TYPE_ID, challenge1.buffer(), 0, challenge1.sizeof()); + + // POST https://localhost:7142/ + byte[] h2request = BitUtil.fromHex( + "00002c0104000000018387418aa0e41d139d09b8e85a67847a8825b650c3cb85717f53032a2f2a5f87497ca58ae819aa0f0d023132"); + DirectBuffer h2requestBuf = new UnsafeBuffer(h2request); + DataFW data3 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000005L) // INI + .sequence(123) + .acknowledge(456) + .maximum(777) + .timestamp(0x000000000000000bL) + .traceId(0x0000000000000003L) + .budgetId(0x0000000000004405L) + .reserved(0x00004206) + .payload(h2requestBuf, 0, h2requestBuf.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data3.buffer(), 0, data3.sizeof()); + + // 200 OK + byte[] h2response = BitUtil.fromHex( + "000026010400000001880f2b0a6375726c2f382e312e320f04032a2f2a0f100a746578742f706c61696e0f0d023132"); + DirectBuffer h2responseBuf = new UnsafeBuffer(h2response); + DataFW data4 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(123) + .acknowledge(456) + .maximum(777) + .timestamp(0x000000000000000cL) + .traceId(0x0000000000000003L) + .budgetId(0x0000000000004405L) + .reserved(0x00004206) + .payload(h2responseBuf, 0, h2responseBuf.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data4.buffer(), 0, data4.sizeof()); + + DirectBuffer hello2Buf = new String8FW("Hello World!").value(); + DataFW data5 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(123) + .acknowledge(456) + .maximum(777) + .timestamp(0x000000000000000dL) + .traceId(0x0000000000000003L) + .budgetId(0x0000000000004405L) + .reserved(0x00004206) + .payload(hello2Buf, 0, hello2Buf.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data5.buffer(), 0, data5.sizeof()); + + FlushFW flush1 = flushRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(301) + .acknowledge(302) + .maximum(3344) + .timestamp(0x000000000000000eL) + .traceId(0x0000000000000003L) + .budgetId(0x0000000000003300L) + .reserved(0x00003303) + .build(); + streams[0].write(FlushFW.TYPE_ID, flush1.buffer(), 0, flush1.sizeof()); + + AbortFW abort1 = abortRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000005L) // INI + .sequence(401) + .acknowledge(402) + .maximum(4477) + .timestamp(0x000000000000000fL) + .traceId(0x0000000000000003L) + .build(); + streams[0].write(AbortFW.TYPE_ID, abort1.buffer(), 0, abort1.sizeof()); + + ResetFW reset1 = resetRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000006L) // REP + .sequence(501) + .acknowledge(502) + .maximum(5577) + .timestamp(0x0000000000000010L) + .traceId(0x0000000000000003L) + .build(); + streams[0].write(ResetFW.TYPE_ID, reset1.buffer(), 0, reset1.sizeof()); + + EndFW end1 = endRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000005L) // INI + .sequence(701) + .acknowledge(702) + .maximum(7777) + .timestamp(0x0000000000000011L) + .traceId(0x0000000000000003L) + .build(); + streams[0].write(EndFW.TYPE_ID, end1.buffer(), 0, end1.sizeof()); + + EndFW end2 = endRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000004L) // REP + .sequence(703) + .acknowledge(704) + .maximum(4444) + .timestamp(0x0000000000000012L) + .traceId(0x0000000000000003L) + .build(); + streams[0].write(EndFW.TYPE_ID, end2.buffer(), 0, end2.sizeof()); + + // proxy extension + DirectBuffer proxyBeginEx1 = new UnsafeBuffer(ProxyFunctions.beginEx() + .typeId(PROXY_TYPE_ID) + .addressInet() + .protocol("stream") + .source("192.168.0.77") + .destination("192.168.0.42") + .sourcePort(12345) + .destinationPort(442) + .build() + .build()); + BeginFW begin3 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x0000000900000011L) // south_kafka_client + .routedId(0x0000000900000012L) // south_tcp_client + .streamId(0x0000000000000009L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x00000000000000013L) + .traceId(0x0000000000000009L) + .affinity(0x0000000000000000L) + .extension(proxyBeginEx1, 0, proxyBeginEx1.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin3.buffer(), 0, begin3.sizeof()); + + DirectBuffer proxyBeginEx2 = new UnsafeBuffer(ProxyFunctions.beginEx() + .typeId(PROXY_TYPE_ID) + .addressInet4() + .protocol("stream") + .source("192.168.0.1") + .destination("192.168.0.254") + .sourcePort(32768) + .destinationPort(443) + .build() + .info() + .alpn("alpn") + .authority("authority") + .identity(BitUtil.fromHex("12345678")) + .namespace("namespace") + .secure() + .version("TLSv1.3") + .name("name") + .cipher("cipher") + .signature("signature") + .key("key") + .build() + .build() + .build()); + BeginFW begin4 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x0000000900000011L) // south_kafka_client + .routedId(0x0000000900000012L) // south_tcp_client + .streamId(0x0000000000000009L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x00000000000000014L) + .traceId(0x0000000000000009L) + .affinity(0x0000000000000000L) + .extension(proxyBeginEx2, 0, proxyBeginEx2.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin4.buffer(), 0, begin4.sizeof()); + + DirectBuffer proxyBeginEx3 = new UnsafeBuffer(ProxyFunctions.beginEx() + .typeId(PROXY_TYPE_ID) + .addressInet6() + .protocol("stream") + .source("fd12:3456:789a:1::1") + .destination("fd12:3456:789a:1::fe") + .sourcePort(32768) + .destinationPort(443) + .build() + .build()); + BeginFW begin5 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x0000000900000011L) // south_kafka_client + .routedId(0x0000000900000012L) // south_tcp_client + .streamId(0x0000000000000009L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x00000000000000015L) + .traceId(0x0000000000000009L) + .affinity(0x0000000000000000L) + .extension(proxyBeginEx3, 0, proxyBeginEx3.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin5.buffer(), 0, begin5.sizeof()); + + DirectBuffer proxyBeginEx4 = new UnsafeBuffer(ProxyFunctions.beginEx() + .typeId(PROXY_TYPE_ID) + .addressUnix() + .protocol("datagram") + .source("unix-source") + .destination("unix-destination") + .build() + .build()); + BeginFW begin6 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x0000000900000011L) // south_kafka_client + .routedId(0x0000000900000012L) // south_tcp_client + .streamId(0x0000000000000009L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x00000000000000016L) + .traceId(0x0000000000000009L) + .affinity(0x0000000000000000L) + .extension(proxyBeginEx4, 0, proxyBeginEx4.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin6.buffer(), 0, begin6.sizeof()); + + DirectBuffer proxyBeginEx5 = new UnsafeBuffer(ProxyFunctions.beginEx() + .typeId(PROXY_TYPE_ID) + .addressNone() + .build() + .build()); + BeginFW begin7 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x0000000900000011L) // south_kafka_client + .routedId(0x0000000900000012L) // south_tcp_client + .streamId(0x0000000000000009L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x00000000000000017L) + .traceId(0x0000000000000009L) + .affinity(0x0000000000000000L) + .extension(proxyBeginEx5, 0, proxyBeginEx5.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin7.buffer(), 0, begin7.sizeof()); + + // http extension + DirectBuffer httpBeginEx1 = new UnsafeBuffer(HttpFunctions.beginEx() + .typeId(HTTP_TYPE_ID) + .header(":scheme", "http") + .header(":method", "GET") + .header(":path", "/hello") + .build()); + BeginFW begin8 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000011L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000018L) + .traceId(0x0000000000000011L) + .affinity(0x0000000000000000L) + .extension(httpBeginEx1, 0, httpBeginEx1.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin8.buffer(), 0, begin8.sizeof()); + + DirectBuffer httpChallengeEx1 = new UnsafeBuffer(HttpFunctions.challengeEx() + .typeId(HTTP_TYPE_ID) + .header(":scheme", "http") + .header(":method", "GET") + .header(":path", "/hello") + .build()); + ChallengeFW challenge2 = challengeRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000011L) // INI + .sequence(201) + .acknowledge(202) + .maximum(22222) + .timestamp(0x0000000000000019L) + .traceId(0x0000000000000011L) + .authorization(0x0000000000007742L) + .extension(httpChallengeEx1, 0, httpChallengeEx1.capacity()) + .build(); + streams[0].write(ChallengeFW.TYPE_ID, challenge2.buffer(), 0, challenge2.sizeof()); + + DirectBuffer httpFlushEx1 = new UnsafeBuffer(HttpFunctions.flushEx() + .typeId(HTTP_TYPE_ID) + .promiseId(0x0000000000000042L) + .promise(":scheme", "http") + .promise(":method", "GET") + .promise(":path", "/hello") + .build()); + FlushFW flush2 = flushRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000010L) // REP + .sequence(301) + .acknowledge(302) + .maximum(3344) + .timestamp(0x0000000000000020L) + .traceId(0x0000000000000011L) + .budgetId(0x0000000000000000L) + .reserved(0x00000000) + .extension(httpFlushEx1, 0, httpFlushEx1.capacity()) + .build(); + streams[0].write(FlushFW.TYPE_ID, flush2.buffer(), 0, flush2.sizeof()); + + DirectBuffer httpResetEx1 = new UnsafeBuffer(HttpFunctions.resetEx() + .typeId(HTTP_TYPE_ID) + .header(":scheme", "http") + .header(":method", "GET") + .header(":path", "/hello") + .build()); + ResetFW reset2 = resetRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000010L) // REP + .sequence(501) + .acknowledge(502) + .maximum(5577) + .timestamp(0x0000000000000021L) + .traceId(0x0000000000000011L) + .extension(httpResetEx1, 0, httpResetEx1.capacity()) + .build(); + streams[0].write(ResetFW.TYPE_ID, reset2.buffer(), 0, reset2.sizeof()); + + DirectBuffer httpEndEx1 = new UnsafeBuffer(HttpFunctions.endEx() + .typeId(HTTP_TYPE_ID) + .trailer(":scheme", "http") + .trailer(":method", "GET") + .trailer(":path", "/hello") + .build()); + EndFW end3 = endRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0000000000000011L) // INI + .sequence(742) + .acknowledge(427) + .maximum(60000) + .timestamp(0x0000000000000022L) + .traceId(0x0000000000000011L) + .extension(httpEndEx1, 0, httpEndEx1.capacity()) + .build(); + streams[0].write(EndFW.TYPE_ID, end3.buffer(), 0, end3.sizeof()); - DataFW data1 = new DataFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) + // worker 1 + SignalFW signal3 = signalRW.wrap(frameBuffer, 0, frameBuffer.capacity()) .originId(0) .routedId(0) .streamId(0) .sequence(0) .acknowledge(0) .maximum(0) - .budgetId(0) - .reserved(0) - .payload(new OctetsFW().wrap(new UnsafeBuffer(payloadBytes), 0, payloadBytes.length)) + .timestamp(0x0000000000000001L) + .traceId(0x0100000000000001L) + .cancelId(0x0000000000008801L) + .signalId(0x00008802) + .contextId(0x00008803) .build(); + streams[1].write(SignalFW.TYPE_ID, signal3.buffer(), 0, signal3.sizeof()); - streams.write(DataFW.TYPE_ID, data1.buffer(), 0, data1.sizeof()); - - DataFW data2 = new DataFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) - .originId(0) - .routedId(1) - .streamId(1) - .sequence(1) + BeginFW begin9 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0101000000000005L) // INI + .sequence(0) .acknowledge(0) .maximum(0) - .budgetId(0) - .reserved(0) - .payload(new OctetsFW().wrap(new UnsafeBuffer(payloadBytes), 0, payloadBytes.length)) + .timestamp(0x0000000000000002L) + .traceId(0x0100000000000003L) + .affinity(0x0101000000000005L) .build(); + streams[1].write(BeginFW.TYPE_ID, begin9.buffer(), 0, begin9.sizeof()); + + EndFW end4 = endRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0101000000000004L) // REP + .sequence(703) + .acknowledge(704) + .maximum(4444) + .timestamp(0x0000000000000003L) + .traceId(0x0100000000000003L) + .build(); + streams[1].write(EndFW.TYPE_ID, end4.buffer(), 0, end4.sizeof()); - streams.write(DataFW.TYPE_ID, data2.buffer(), 0, data2.sizeof()); - - - EndFW end1 = new EndFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) + // worker 2 + SignalFW signal4 = signalRW.wrap(frameBuffer, 0, frameBuffer.capacity()) .originId(0) .routedId(0) .streamId(0) .sequence(0) .acknowledge(0) .maximum(0) + .timestamp(0x0000000000000001L) + .traceId(0x0200000000000001L) + .cancelId(0x0000000000008801L) + .signalId(0x00009902) + .contextId(0x00009903) .build(); + streams[2].write(SignalFW.TYPE_ID, signal4.buffer(), 0, signal4.sizeof()); - streams.write(EndFW.TYPE_ID, end1.buffer(), 0, end1.sizeof()); - - EndFW end2 = new EndFW.Builder().wrap(frameBuffer, 0, frameBuffer.capacity()) - .originId(0) - .routedId(1) - .streamId(1) - .sequence(1) + BeginFW begin10 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0202000000000005L) // INI + .sequence(0) .acknowledge(0) .maximum(0) + .timestamp(0x0000000000000002L) + .traceId(0x0200000000000003L) + .affinity(0x0202000000000005L) .build(); - - streams.write(EndFW.TYPE_ID, end2.buffer(), 0, end2.sizeof()); - + streams[2].write(BeginFW.TYPE_ID, begin10.buffer(), 0, begin10.sizeof()); + + EndFW end5 = endRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000000bL) // north_tcp_server + .routedId(0x000000090000000dL) // north_http_server + .streamId(0x0202000000000004L) // REP + .sequence(703) + .acknowledge(704) + .maximum(4444) + .timestamp(0x0000000000000003L) + .traceId(0x0200000000000003L) + .build(); + streams[2].write(EndFW.TYPE_ID, end5.buffer(), 0, end5.sizeof()); } @BeforeEach @@ -194,36 +687,54 @@ public void init() command = new ZillaDumpCommand(); command.verbose = true; command.continuous = false; - command.properties = List.of(String.format("zilla.engine.directory=%s", Paths.get(baseDir, "engine"))); - command.output = Paths.get(tempDir.getPath(), "test.pcap"); + command.properties = List.of(String.format("zilla.engine.directory=%s", ENGINE_PATH)); + command.output = Paths.get(tempDir.getPath(), "actual.pcap"); } @Test - public void shouldDumpWithoutFilter() throws IOException + public void shouldWritePcap() throws IOException { + // GIVEN + byte[] expected = getResourceAsBytes("expected_dump.pcap"); + + // WHEN command.run(); + // THEN File[] files = tempDir.listFiles(); - assertEquals(1, files.length); - - File expectedDump = new File(baseDir + "/expected_dump_without_filter.pcap"); - byte[] expected = Files.readAllBytes(expectedDump.toPath()); + assert files != null; byte[] actual = Files.readAllBytes(files[0].toPath()); - assertArrayEquals(expected, actual); + assertThat(files.length, equalTo(1)); + assertThat(actual, equalTo(expected)); } @Test - public void shouldDumpWithKafkaFilter() throws IOException + public void shouldWriteFilteredPcap() throws IOException { - command.bindings = singletonList("test.kafka0"); + // GIVEN + byte[] expected = getResourceAsBytes("expected_filtered_dump.pcap"); + + // WHEN + command.bindings = singletonList("example.north_tls_server"); command.run(); + // THEN File[] files = tempDir.listFiles(); - assertEquals(1, files.length); - - File expectedDump = new File(baseDir + "/expected_dump_with_kafka_filter.pcap"); - byte[] expected = Files.readAllBytes(expectedDump.toPath()); + assert files != null; byte[] actual = Files.readAllBytes(files[0].toPath()); - assertArrayEquals(expected, actual); + assertThat(files.length, equalTo(1)); + assertThat(actual, equalTo(expected)); + } + + private static byte[] getResourceAsBytes( + String resourceName) throws IOException + { + byte[] bytes; + try (InputStream is = ZillaDumpCommandTest.class.getResourceAsStream(resourceName)) + { + assert is != null; + bytes = is.readAllBytes(); + } + return bytes; } } diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/Dockerfile b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/Dockerfile new file mode 100644 index 0000000000..3bcc88e4de --- /dev/null +++ b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/Dockerfile @@ -0,0 +1,23 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +FROM ubuntu:24.04 + +RUN apt update +RUN DEBIAN_FRONTEND=noninteractive apt install -y tshark +RUN useradd -ms /bin/bash tshark + +USER tshark +WORKDIR /home/tshark diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/bindings b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/bindings new file mode 100644 index 0000000000000000000000000000000000000000..9ef435b69224920a0303aa85c709f74efc520e80 GIT binary patch literal 320 zcmZ{gTMB?M3>aT5JRjIsKc43! l`x7=$2$|IK-5Op{2$|Ks-c1jZ%2Iew(e1Cy{V(>sH(#t<0)_wp literal 0 HcmV?d00001 diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data0 b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data0 new file mode 100644 index 0000000000000000000000000000000000000000..985f17b6c675ee19fd73cb3a2b8776cd3747e122 GIT binary patch literal 8960 zcmeHMO>7fK6n^WqlX?p{h5m79wc)1+iq}7Z#`r|iA_7DrQe0Y9t;)(7#a1_K*It*T zKWa;Vpr{v+xFA*P1%cp>s-l)iTu3YR+*>bIg?evq(7w0(#&Onb69*wK^Q6(6nSJxk z_r7^MYsn`8KnFO8Zr!GFr1Wy3b}Hz_(CgU#LvwIyQ2dw#40&yl@zLwpHsNqeI8M!c zqtEy)gaD5VO)vd>3i{(7-6kx zt>o7azZY+b+sPs5YcRx<{cz>FFmE~&(w$2I4s+lX`y=RwxgVPhIy(C}dz$?N8|vNj z96zEUv^y+J63IRhOi{h9F+IV+L+DTAqnYEgB{O4Al}a<2oRu@CYE7?bI<>OxRH$3X z7P7|cP0>hC%nKJEm0JxbGj0|3TUleGTo!el+mqR2yjpWT3`m!j>Y`|RV$sXg9lPqb zA505(-m4VNT;4GJQr&BwqFRM3NFypgc`i};k*;KY^E-+GGBGos&6>xLwb?wF=2)91 zzf#i(hn%|VUh-TaLTJAP4t_fUU~pgZoRr0Y^B1s1xy|_so%xFQ2=+{aR{s zESC=;zC{0O-Z0cphucd;Ov+}7pu}O^>tA*2MRK;b3@}awq ztS=uT9lkVi>P>8P2I2cn=AY*G%wj)+n{B~(vhaQ|#`Ea8e!6hwd7o#z3+z963Lq6M z@5aS>!o$$6dX#t8KaBG)`;}(^Mjn7i{KI)mem~J6p#99=eh~mE`qq^<&Jw>UJgMU? z##v_nHiB&p;3D%qjn60*+LPXYiX~62mu=$*y<&pgHbL${-pajFu(HMbSWuyx;w#cUE> zdqFhoc3GIC!=>rj4|3L+xg+jRn>&Zf)p|uV%w5T5b>6kTRzsM(_4mZm*BjuErQ=&a z9b<5hcwO?vp=d2M_Vbdb4^TuA2i5V}fJVETx^yr zVnM{A;(7Jq;)1|JpVQ&+p;Dq)x4p^`WGeLAmN7p^j}*J^J-OEk$8~;(xAUBgk>BBm z;c*c$soui6$U8RbJ7I=+@NkVIPLn*d5sgS6tcxyvB(JFN!YJ=2_2Hp^J{#dc>xl>D z64poV@fY9w*O4sQ$-e=11l{&`g@+HtLt-ee6i^B%1(X6x0i}RaKq;UUPzopolmbct ZrGQdEDWDX1oC^Go|05|=3Op_a{s#?I8Fc^v literal 0 HcmV?d00001 diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/data0 b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data1 similarity index 87% rename from incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/data0 rename to incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data1 index 7ab9eb3c0d28de56845e367bae39e46164b4276f..d3baacb795a90adda938a90cbfb2422ef5a11b86 100644 GIT binary patch literal 8960 zcmeI%Jqm2ZWFB%82TBd#jV;J*;Jgu{tRc52o-%&(o z+c8z5I_I{1Q0*~0R#|0009ILKmY**5I_I{1Q0*~0R#|0009IL$QSsezx(++ Jm_#5~-~jgc2~z+7 literal 8960 zcmeI%yK2KQ6b4}TGU+Kame5#sp~QG<$l@W;K-IBBa77XjmT^?lu6fbCN>3mv?tx&t zWa#i4j4nRdET30UZ`q<5qED^6;(~PGpQ_-jL zqp@ldXOD3rre$ernj5K+n7PVR!B~IQCYRoPdR5!yruz9XH`U6obD2H}Q5b98z1+FR zzDN9i!Hc);qo3>l$NSCcu)ofA?(jY5c^-EP8V#) diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data2 b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data2 new file mode 100644 index 0000000000000000000000000000000000000000..e5b3ff595d7d83f7908660a113db2d195642234e GIT binary patch literal 8960 zcmeI&F%E+;425A6K%zn&xKR(l$jHEPdIe4cH>1zRsSs0@`L`5I;@Cpp%wlG>*-Po~ zsN!bilpCw}`Ic7A)H)QCj{IJ)_0W1oZk5f_ulKu+M?TbddE~8Kdqx$!exKWThvsh4 zwMU+Z^S)Q_bN!4!009ILKmY**5I_I{1Q0*~0R#|0009ILKmY**5I_I{1Q0*~fpUQ^ N|4dLmf=&dA1wO{q34QTiTVqPhWf)ugdYSGB#Me5A)pB%gkL5m)F>$$euxi#Sv+Uvp4r)*M@QSKC%Jp> zYwq0dJLlee?(Byr&R$^>lbIp6Z$p+FMaIrS{+#ku=lWizba!suz~1~J-n6)ryzd*EI~ zZRdggP(M{v1`K?ON%*i{kU$3@-3i4mHJ#2X&t&uI?M3#<1%X%E<$$`yo9JsRoid93RZ3RRo;L=8MU`Vj|a9Q1iRgys3G%(VQ$6 zsr?S9tb;U5Xm~G(n3R?;{SYCr)KT<_L&oNr$$?9fJ{$q3vMX?Wq#u%Rz{RBC6=tab zPDKH{?3u}d)4&9r%C5k%(Q%Tcf@H=MX>PIcEURB}hvgtTE z9Gh<(Cx)w^f}wo?F4h$PTG;c9(9gp{A;3Z#u5N-nIbg%31z;+>0>(-B3Rsdn05)9Q z1o$T8Z`xS+v|(ZD?Bv>qu>)<_@QNsIW>~ir2=>9kHg1Y<1K~z!M3&a;-G99=Zt`&& z&t!7Gkr+U)A_hkMVL$UjHic>7_Hog_Bv72k zWd>3Q=C0MV#`Z3XEKntoSA%{PYGd2Fdz4nCtEVT{8VN;$UD-mhLrG^7@pKZi?cw%t z@M#FKTGkGz8E8rj<7m$9IzBQDp`su%U(I1gj8IuHBJ;yexuSlS7IFWEUy&L6;ZF4;K` z?s6yuST8}jYJ;A|1-w$rF5@sg#$VgN_Q2>*56u0b?$r3R1Fye0vgBm!?00YMe5E@8 z>$7kFroA5>7@z-1{VXZcMx()FO_*$G`_)35lb=Ai9@uI}TP*gxKDako_)Cm_K)w<>zK}8eForTM zfE|tl8TLncFIm_OIOY#vTs0_mm;E_Y1-pKB*$`5QO{VZ7JM6IVR*bP-3i<7p|d z6@@kv4ZibqH%K<((+7Dj< zEHALK%&vK5nSYN1*|9wSKd=m&tR`+OOYCoC?~w7ComZ4K_Gy)i0YPzyJNYFmSNxDy zuB2l)njKd;m~a%@X3`_);bcJExC-#0Olr6VHi&#e)w}!ntG#QxS}3N#TT|JLkFPSm zQkvdz3-Y(D_GRCAwXfWUquJT_INT?r&^D9yy%#3~;$~mj#?9f}<_m3T7`M>SP;o%P zxnX}mQ3%oqw@e>G5DGJNyyd@e+-l;~2dCBoJuq;n=_n+U>Yyq!{2#BTV^D<+cYA|0DGw@t4CY;`40Sy6Ty&D>x2aXTcsugnGnZwl3g%LCl{$=Id2P z;6|T4rpi(?u+(hB(jOL@%BL&>A~D6xbwC;3zuE{i_+6vjm;cDFV~Ybk}dqFAPI zdh0~Z%=niRb60`;QHqbvH=y(WGG})KY7&f8uEweQ*OXTw9|e|<5ldya2)L&E;9tbR THA$!BsJJKg|H9a!>1632sc3S@ literal 0 HcmV?d00001 diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt new file mode 100644 index 0000000000..bda0361b9d --- /dev/null +++ b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt @@ -0,0 +1,1433 @@ +Frame 1: 198 bytes on wire (1584 bits), 198 bytes captured (1584 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::1, Dst: fe80:: +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 1, Len: 124 +Zilla Frame + Frame Type ID: 0x40000003 + Frame Type: SIGNAL + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00000000 + Origin ID: 0x0000000000000000 + Routed ID: 0x0000000000000000 + Stream ID: 0x0000000000000000 + Direction: + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000001 + Trace ID: 0x0000000000000001 + Authorization: 0x0000000000000000 + Cancel ID: 0x0000000000007701 + Signal ID: 30466 + Context ID: 30467 + Payload + Length: -1 + +Frame 2: 198 bytes on wire (1584 bits), 198 bytes captured (1584 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80:0:0:1::1, Dst: fe80:0:0:1:: +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 1, Len: 124 +Zilla Frame + Frame Type ID: 0x40000003 + Frame Type: SIGNAL + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 1 + Offset: 0x00000000 + Origin ID: 0x0000000000000000 + Routed ID: 0x0000000000000000 + Stream ID: 0x0000000000000000 + Direction: + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000001 + Trace ID: 0x0100000000000001 + Authorization: 0x0000000000000000 + Cancel ID: 0x0000000000008801 + Signal ID: 34818 + Context ID: 34819 + Payload + Length: -1 + +Frame 3: 198 bytes on wire (1584 bits), 198 bytes captured (1584 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80:0:0:2::1, Dst: fe80:0:0:2:: +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 1, Len: 124 +Zilla Frame + Frame Type ID: 0x40000003 + Frame Type: SIGNAL + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 2 + Offset: 0x00000000 + Origin ID: 0x0000000000000000 + Routed ID: 0x0000000000000000 + Stream ID: 0x0000000000000000 + Direction: + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000001 + Trace ID: 0x0200000000000001 + Authorization: 0x0000000000000000 + Cancel ID: 0x0000000000008801 + Signal ID: 39170 + Context ID: 39171 + Payload + Length: -1 + +Frame 4: 210 bytes on wire (1680 bits), 210 bytes captured (1680 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::1, Dst: fe80:: +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 125, Ack: 1, Len: 136 +Zilla Frame + Frame Type ID: 0x40000003 + Frame Type: SIGNAL + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00000060 + Origin ID: 0x0000000000000000 + Routed ID: 0x0000000000000000 + Stream ID: 0x0000000000000000 + Direction: + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000002 + Trace ID: 0x0000000000000000 + Authorization: 0x0000000000000000 + Cancel ID: 0x0000000000007801 + Signal ID: 30722 + Context ID: 30723 + Payload + Length: 12 + Payload + +Frame 5: 233 bytes on wire (1864 bits), 233 bytes captured (1864 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::1:101:0:0:4, Dst: fe80::1:101:0:0:5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 159 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 1 + Offset: 0x00000060 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0101000000000005 + Initial ID: 0x0101000000000005 + Reply ID: 0x0101000000000004 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000002 + Trace ID: 0x0100000000000003 + Authorization: 0x0000000000000000 + Affinity: 0x0101000000000005 + +Frame 6: 233 bytes on wire (1864 bits), 233 bytes captured (1864 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::2:202:0:0:4, Dst: fe80::2:202:0:0:5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 159 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 2 + Offset: 0x00000060 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0202000000000005 + Initial ID: 0x0202000000000005 + Reply ID: 0x0202000000000004 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000002 + Trace ID: 0x0200000000000003 + Authorization: 0x0000000000000000 + Affinity: 0x0202000000000005 + +Frame 7: 233 bytes on wire (1864 bits), 233 bytes captured (1864 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::4, Dst: fe80::5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 159 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x000000d0 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000005 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000003 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000005 + +Frame 8: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::1:101:0:0:5, Dst: fe80::1:101:0:0:4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 159, Len: 151 +Zilla Frame + Frame Type ID: 0x00000003 + Frame Type: END + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 1 + Offset: 0x000000b8 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0101000000000004 + Initial ID: 0x0101000000000005 + Reply ID: 0x0101000000000004 + Direction: REP + Sequence: 703 + Acknowledge: 704 + Maximum: 4444 + Timestamp: 0x0000000000000003 + Trace ID: 0x0100000000000003 + Authorization: 0x0000000000000000 + +Frame 9: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::2:202:0:0:5, Dst: fe80::2:202:0:0:4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 159, Len: 151 +Zilla Frame + Frame Type ID: 0x00000003 + Frame Type: END + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 2 + Offset: 0x000000b8 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0202000000000004 + Initial ID: 0x0202000000000005 + Reply ID: 0x0202000000000004 + Direction: REP + Sequence: 703 + Acknowledge: 704 + Maximum: 4444 + Timestamp: 0x0000000000000003 + Trace ID: 0x0200000000000003 + Authorization: 0x0000000000000000 + +Frame 10: 242 bytes on wire (1936 bits), 242 bytes captured (1936 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::4, Dst: fe80::5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 159, Ack: 1, Len: 168 +Zilla Frame + Frame Type ID: 0x40000002 + Frame Type: WINDOW + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000128 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000005 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 65536 + Timestamp: 0x0000000000000004 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Budget ID: 0x0000000000000000 + Padding: 0 + Minimum: 0 + Capabilities: 0x00 + Progress: 0 + Progress/Maximum: 0/65536 + +Frame 11: 233 bytes on wire (1864 bits), 233 bytes captured (1864 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 327, Len: 159 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000188 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 1 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000005 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + +Frame 12: 242 bytes on wire (1936 bits), 242 bytes captured (1936 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 160, Ack: 327, Len: 168 +Zilla Frame + Frame Type ID: 0x40000002 + Frame Type: WINDOW + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x000001e0 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 0 + Acknowledge: 0 + Maximum: 65536 + Timestamp: 0x0000000000000006 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Budget ID: 0x0000000000000000 + Padding: 0 + Minimum: 0 + Capabilities: 0x00 + Progress: 0 + Progress/Maximum: 0/65536 + +Frame 13: 232 bytes on wire (1856 bits), 232 bytes captured (1856 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::76, Dst: fe80::77 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 158 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x99f321bc + Protocol Type: tls + Worker: 0 + Offset: 0x00000240 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000c + Routed Namespace: example + Routed Binding: north_tls_server + Stream ID: 0x0000000000000077 + Initial ID: 0x0000000000000077 + Reply ID: 0x0000000000000076 + Direction: INI + Sequence: 71 + Acknowledge: 72 + Maximum: 73 + Timestamp: 0x0000000000000007 + Trace ID: 0x0000000000004202 + Authorization: 0x0000000000004203 + Affinity: 0x0000000000004204 + +Frame 14: 372 bytes on wire (2976 bits), 372 bytes captured (2976 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::4, Dst: fe80::5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 327, Ack: 328, Len: 298 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000298 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000005 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: INI + Sequence: 123 + Acknowledge: 456 + Maximum: 777 + Timestamp: 0x0000000000000008 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000004205 + Reserved: 16902 + Progress: 16569 + Progress/Maximum: 16569/777 + Payload + Length: 130 + Payload +Hypertext Transfer Protocol + POST / HTTP/1.1\n + [Expert Info (Chat/Sequence): POST / HTTP/1.1\n] + [POST / HTTP/1.1\n] + [Severity level: Chat] + [Group: Sequence] + Request Method: POST + Request URI: / + Request Version: HTTP/1.1 + Host: localhost:8080\n + User-Agent: curl/7.85.0\n + Accept: */*\n + Content-Type: text/plain\n + Content-Length: 12\n + [Content length: 12] + \n + [Full request URI: http://localhost:8080/] + [HTTP request 1/1] + File Data: 12 bytes +Line-based text data: text/plain (1 lines) + +Frame 15: 316 bytes on wire (2528 bits), 316 bytes captured (2528 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 328, Ack: 625, Len: 242 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000378 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 123 + Acknowledge: 456 + Maximum: 777 + Timestamp: 0x0000000000000009 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000004205 + Reserved: 16902 + Progress: 16569 + Progress/Maximum: 16569/777 + Payload + Length: 74 + Payload +Hypertext Transfer Protocol + HTTP/1.1 200 OK\n + [Expert Info (Chat/Sequence): HTTP/1.1 200 OK\n] + [HTTP/1.1 200 OK\n] + [Severity level: Chat] + [Group: Sequence] + Response Version: HTTP/1.1 + Status Code: 200 + [Status Code Description: OK] + Response Phrase: OK + Content-Type: text/plain\n + Content-Length: 13\n + [Content length: 13] + \n + [HTTP response 1/1] + [Time since request: 0.000000000 seconds] + [Request in frame: 14] + [Request URI: http://localhost:8080/] + File Data: 13 bytes +Line-based text data: text/plain (1 lines) + +Frame 16: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 570, Ack: 625, Len: 151 +Zilla Frame + Frame Type ID: 0x40000004 + Frame Type: CHALLENGE + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000420 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 201 + Acknowledge: 202 + Maximum: 22222 + Timestamp: 0x000000000000000a + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000007742 + +Frame 17: 295 bytes on wire (2360 bits), 295 bytes captured (2360 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::4, Dst: fe80::5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 625, Ack: 721, Len: 221 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000470 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000005 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: INI + Sequence: 123 + Acknowledge: 456 + Maximum: 777 + Timestamp: 0x000000000000000b + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000004405 + Reserved: 16902 + Progress: 16569 + Progress/Maximum: 16569/777 + Payload + Length: 53 + Payload +HyperText Transfer Protocol 2 + Stream: HEADERS, Stream ID: 1, Length 44, POST / + Length: 44 + Type: HEADERS (1) + Flags: 0x04, End Headers + 00.0 ..0. = Unused: 0x00 + ..0. .... = Priority: False + .... 0... = Padded: False + .... .1.. = End Headers: True + .... ...0 = End Stream: False + 0... .... .... .... .... .... .... .... = Reserved: 0x0 + .000 0000 0000 0000 0000 0000 0000 0001 = Stream Identifier: 1 + [Pad Length: 0] + Header Block Fragment: 8387418aa0e41d139d09b8e85a67847a8825b650c3cb85717f53032a2f2a5f87497ca58ae819aa0f0d023132 + [Header Length: 184] + [Header Count: 8] + Header: :method: POST + Name Length: 7 + Name: :method + Value Length: 4 + Value: POST + :method: POST + [Unescaped: POST] + Representation: Indexed Header Field + Index: 3 + Header: :scheme: https + Name Length: 7 + Name: :scheme + Value Length: 5 + Value: https + :scheme: https + [Unescaped: https] + Representation: Indexed Header Field + Index: 7 + Header: :authority: localhost:7143 + Name Length: 10 + Name: :authority + Value Length: 14 + Value: localhost:7143 + :authority: localhost:7143 + [Unescaped: localhost:7143] + Representation: Literal Header Field with Incremental Indexing - Indexed Name + Index: 1 + Header: :path: / + Name Length: 5 + Name: :path + Value Length: 1 + Value: / + :path: / + [Unescaped: /] + Representation: Indexed Header Field + Index: 4 + Header: user-agent: curl/8.1.2 + Name Length: 10 + Name: user-agent + Value Length: 10 + Value: curl/8.1.2 + user-agent: curl/8.1.2 + [Unescaped: curl/8.1.2] + Representation: Literal Header Field with Incremental Indexing - Indexed Name + Index: 58 + Header: accept: */* + Name Length: 6 + Name: accept + Value Length: 3 + Value: */* + accept: */* + [Unescaped: */*] + Representation: Literal Header Field with Incremental Indexing - Indexed Name + Index: 19 + Header: content-type: text/plain + Name Length: 12 + Name: content-type + Value Length: 10 + Value: text/plain + content-type: text/plain + [Unescaped: text/plain] + Representation: Literal Header Field with Incremental Indexing - Indexed Name + Index: 31 + Header: content-length: 12 + Name Length: 14 + Name: content-length + Value Length: 2 + Value: 12 + content-length: 12 + [Unescaped: 12] + Representation: Literal Header Field without Indexing - Indexed Name + Index: 28 + [Full request URI: https://localhost:7143/] + +Frame 18: 289 bytes on wire (2312 bits), 289 bytes captured (2312 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 721, Ack: 846, Len: 215 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000508 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 123 + Acknowledge: 456 + Maximum: 777 + Timestamp: 0x000000000000000c + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000004405 + Reserved: 16902 + Progress: 16569 + Progress/Maximum: 16569/777 + Payload + Length: 47 + Payload +HyperText Transfer Protocol 2 + Stream: HEADERS, Stream ID: 1, Length 38, 200 OK + Length: 38 + Type: HEADERS (1) + Flags: 0x04, End Headers + 00.0 ..0. = Unused: 0x00 + ..0. .... = Priority: False + .... 0... = Padded: False + .... .1.. = End Headers: True + .... ...0 = End Stream: False + 0... .... .... .... .... .... .... .... = Reserved: 0x0 + .000 0000 0000 0000 0000 0000 0000 0001 = Stream Identifier: 1 + [Pad Length: 0] + Header Block Fragment: 880f2b0a6375726c2f382e312e320f04032a2f2a0f100a746578742f706c61696e0f0d023132 + [Header Length: 117] + [Header Count: 5] + Header: :status: 200 OK + Name Length: 7 + Name: :status + Value Length: 3 + Value: 200 + :status: 200 + [Unescaped: 200] + Representation: Indexed Header Field + Index: 8 + Header: user-agent: curl/8.1.2 + Name Length: 10 + Name: user-agent + Value Length: 10 + Value: curl/8.1.2 + user-agent: curl/8.1.2 + [Unescaped: curl/8.1.2] + Representation: Literal Header Field without Indexing - Indexed Name + Index: 58 + Header: accept: */* + Name Length: 6 + Name: accept + Value Length: 3 + Value: */* + accept: */* + [Unescaped: */*] + Representation: Literal Header Field without Indexing - Indexed Name + Index: 19 + Header: content-type: text/plain + Name Length: 12 + Name: content-type + Value Length: 10 + Value: text/plain + content-type: text/plain + [Unescaped: text/plain] + Representation: Literal Header Field without Indexing - Indexed Name + Index: 31 + Header: content-length: 12 + Name Length: 14 + Name: content-length + Value Length: 2 + Value: 12 + content-length: 12 + [Unescaped: 12] + Representation: Literal Header Field without Indexing - Indexed Name + Index: 28 + [Time since request: 0.000000000 seconds] + [Request in frame: 17] + +Frame 19: 254 bytes on wire (2032 bits), 254 bytes captured (2032 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 936, Ack: 846, Len: 180 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000598 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 123 + Acknowledge: 456 + Maximum: 777 + Timestamp: 0x000000000000000d + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000004405 + Reserved: 16902 + Progress: 16569 + Progress/Maximum: 16569/777 + Payload + Length: 12 + Payload + +Frame 20: 237 bytes on wire (1896 bits), 237 bytes captured (1896 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1116, Ack: 846, Len: 163 +Zilla Frame + Frame Type ID: 0x00000005 + Frame Type: FLUSH + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000608 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 301 + Acknowledge: 302 + Maximum: 3344 + Timestamp: 0x000000000000000e + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + Budget ID: 0x0000000000003300 + Reserved: 13059 + +Frame 21: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::4, Dst: fe80::5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 846, Ack: 1279, Len: 151 +Zilla Frame + Frame Type ID: 0x00000004 + Frame Type: ABORT + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000660 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000005 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: INI + Sequence: 401 + Acknowledge: 402 + Maximum: 4477 + Timestamp: 0x000000000000000f + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + +Frame 22: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::7, Dst: fe80::6 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 1, Len: 151 +Zilla Frame + Frame Type ID: 0x40000001 + Frame Type: RESET + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x000006b0 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000006 + Initial ID: 0x0000000000000007 + Reply ID: 0x0000000000000006 + Direction: REP + Sequence: 501 + Acknowledge: 502 + Maximum: 5577 + Timestamp: 0x0000000000000010 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + +Frame 23: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::4, Dst: fe80::5 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 997, Ack: 1279, Len: 151 +Zilla Frame + Frame Type ID: 0x00000003 + Frame Type: END + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000700 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000005 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: INI + Sequence: 701 + Acknowledge: 702 + Maximum: 7777 + Timestamp: 0x0000000000000011 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + +Frame 24: 225 bytes on wire (1800 bits), 225 bytes captured (1800 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::5, Dst: fe80::4 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1279, Ack: 1148, Len: 151 +Zilla Frame + Frame Type ID: 0x00000003 + Frame Type: END + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000750 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000004 + Initial ID: 0x0000000000000005 + Reply ID: 0x0000000000000004 + Direction: REP + Sequence: 703 + Acknowledge: 704 + Maximum: 4444 + Timestamp: 0x0000000000000012 + Trace ID: 0x0000000000000003 + Authorization: 0x0000000000000000 + +Frame 25: 280 bytes on wire (2240 bits), 280 bytes captured (2240 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::8, Dst: fe80::9 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 206 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x084b20e1 + Protocol Type: kafka + Worker: 0 + Offset: 0x000007a0 + Origin ID: 0x0000000900000011 + Origin Namespace: example + Origin Binding: south_kafka_client + Routed ID: 0x0000000900000012 + Routed Namespace: example + Routed Binding: south_tcp_client + Stream ID: 0x0000000000000009 + Initial ID: 0x0000000000000009 + Reply ID: 0x0000000000000008 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000013 + Trace ID: 0x0000000000000009 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: proxy + Stream Type ID: 0x50a8ce8d + Stream Type: proxy + Address: INET + Family: INET (0) + Protocol: STREAM (0) + Source: 192.168.0.77 + Source Port: 12345 + Destination: 192.168.0.42 + Destination Port: 442 + Info (0 items) + Length: 4 + Size: 0 + +Frame 26: 342 bytes on wire (2736 bits), 342 bytes captured (2736 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::8, Dst: fe80::9 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 268 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x084b20e1 + Protocol Type: kafka + Worker: 0 + Offset: 0x00000828 + Origin ID: 0x0000000900000011 + Origin Namespace: example + Origin Binding: south_kafka_client + Routed ID: 0x0000000900000012 + Routed Namespace: example + Routed Binding: south_tcp_client + Stream ID: 0x0000000000000009 + Initial ID: 0x0000000000000009 + Reply ID: 0x0000000000000008 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000014 + Trace ID: 0x0000000000000009 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: proxy + Stream Type ID: 0x50a8ce8d + Stream Type: proxy + Address: INET4 + Family: INET4 (1) + Protocol: STREAM (0) + Source: 192.168.0.1 + Source Port: 32768 + Destination: 192.168.0.254 + Destination Port: 443 + Info (9 items) + Length: 86 + Size: 9 + Info: ALPN: alpn + Type: ALPN (0x01) + Length: 4 + Value: alpn + Info: AUTHORITY: authority + Type: AUTHORITY (0x02) + Length: 9 + Value: authority + Info: IDENTITY: 0x12345678 + Type: IDENTITY (0x05) + Length: 4 + Value: 12345678 + Info: NAMESPACE: namespace + Type: NAMESPACE (0x30) + Length: 9 + Value: namespace + Info: SECURE: VERSION: TLSv1.3 + Type: SECURE (0x20) + Secure Type: VERSION (0x21) + Length: 7 + Value: TLSv1.3 + Info: SECURE: NAME: name + Type: SECURE (0x20) + Secure Type: NAME (0x22) + Length: 4 + Value: name + Info: SECURE: CIPHER: cipher + Type: SECURE (0x20) + Secure Type: CIPHER (0x23) + Length: 6 + Value: cipher + Info: SECURE: SIGNATURE: signature + Type: SECURE (0x20) + Secure Type: SIGNATURE (0x24) + Length: 9 + Value: signature + Info: SECURE: KEY: key + Type: SECURE (0x20) + Secure Type: KEY (0x25) + Length: 3 + Value: key + +Frame 27: 284 bytes on wire (2272 bits), 284 bytes captured (2272 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::8, Dst: fe80::9 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 210 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x084b20e1 + Protocol Type: kafka + Worker: 0 + Offset: 0x000008e8 + Origin ID: 0x0000000900000011 + Origin Namespace: example + Origin Binding: south_kafka_client + Routed ID: 0x0000000900000012 + Routed Namespace: example + Routed Binding: south_tcp_client + Stream ID: 0x0000000000000009 + Initial ID: 0x0000000000000009 + Reply ID: 0x0000000000000008 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000015 + Trace ID: 0x0000000000000009 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: proxy + Stream Type ID: 0x50a8ce8d + Stream Type: proxy + Address: INET6 + Family: INET6 (2) + Protocol: STREAM (0) + Source: fd12:3456:789a:1::1 + Source Port: 32768 + Destination: fd12:3456:789a:1::fe + Destination Port: 443 + Info (0 items) + Length: 4 + Size: 0 + +Frame 28: 464 bytes on wire (3712 bits), 464 bytes captured (3712 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::8, Dst: fe80::9 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 390 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x084b20e1 + Protocol Type: kafka + Worker: 0 + Offset: 0x00000970 + Origin ID: 0x0000000900000011 + Origin Namespace: example + Origin Binding: south_kafka_client + Routed ID: 0x0000000900000012 + Routed Namespace: example + Routed Binding: south_tcp_client + Stream ID: 0x0000000000000009 + Initial ID: 0x0000000000000009 + Reply ID: 0x0000000000000008 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000016 + Trace ID: 0x0000000000000009 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: proxy + Stream Type ID: 0x50a8ce8d + Stream Type: proxy + Address: UNIX + Family: UNIX (3) + Protocol: DATAGRAM (1) + Source: unix-source + Destination: unix-destination + Info (0 items) + Length: 4 + Size: 0 + +Frame 29: 247 bytes on wire (1976 bits), 247 bytes captured (1976 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::8, Dst: fe80::9 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 173 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x084b20e1 + Protocol Type: kafka + Worker: 0 + Offset: 0x00000ab0 + Origin ID: 0x0000000900000011 + Origin Namespace: example + Origin Binding: south_kafka_client + Routed ID: 0x0000000900000012 + Routed Namespace: example + Routed Binding: south_tcp_client + Stream ID: 0x0000000000000009 + Initial ID: 0x0000000000000009 + Reply ID: 0x0000000000000008 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000017 + Trace ID: 0x0000000000000009 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: proxy + Stream Type ID: 0x50a8ce8d + Stream Type: proxy + Address: NONE + Family: NONE (4) + Info (0 items) + Length: 4 + Size: 0 + +Frame 30: 286 bytes on wire (2288 bits), 286 bytes captured (2288 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::10, Dst: fe80::11 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 212 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000b18 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000011 + Initial ID: 0x0000000000000011 + Reply ID: 0x0000000000000010 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000018 + Trace ID: 0x0000000000000011 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: http + Stream Type ID: 0x4620b68a + Stream Type: http + Headers (3 items) + Length: 45 + Size: 3 + Header: :scheme: http + Length: 7 + Name: :scheme + Length: 4 + Value: http + Header: :method: GET + Length: 7 + Name: :method + Length: 3 + Value: GET + Header: :path: /hello + Length: 5 + Name: :path + Length: 6 + Value: /hello + +Frame 31: 278 bytes on wire (2224 bits), 278 bytes captured (2224 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::10, Dst: fe80::11 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 212, Ack: 1, Len: 204 +Zilla Frame + Frame Type ID: 0x40000004 + Frame Type: CHALLENGE + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000ba8 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000011 + Initial ID: 0x0000000000000011 + Reply ID: 0x0000000000000010 + Direction: INI + Sequence: 201 + Acknowledge: 202 + Maximum: 22222 + Timestamp: 0x0000000000000019 + Trace ID: 0x0000000000000011 + Authorization: 0x0000000000007742 + Extension: http + Stream Type ID: 0x4620b68a + Stream Type: http + Headers (3 items) + Length: 45 + Size: 3 + Header: :scheme: http + Length: 7 + Name: :scheme + Length: 4 + Value: http + Header: :method: GET + Length: 7 + Name: :method + Length: 3 + Value: GET + Header: :path: /hello + Length: 5 + Name: :path + Length: 6 + Value: /hello + +Frame 32: 298 bytes on wire (2384 bits), 298 bytes captured (2384 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::11, Dst: fe80::10 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 416, Len: 224 +Zilla Frame + Frame Type ID: 0x00000005 + Frame Type: FLUSH + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000c30 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000010 + Initial ID: 0x0000000000000011 + Reply ID: 0x0000000000000010 + Direction: REP + Sequence: 301 + Acknowledge: 302 + Maximum: 3344 + Timestamp: 0x0000000000000020 + Trace ID: 0x0000000000000011 + Authorization: 0x0000000000000000 + Budget ID: 0x0000000000000000 + Reserved: 0 + Extension: http + Stream Type ID: 0x4620b68a + Stream Type: http + Promise ID: 0x0000000000000042 + Promises (3 items) + Length: 45 + Size: 3 + Promise: :scheme: http + Length: 7 + Name: :scheme + Length: 4 + Value: http + Promise: :method: GET + Length: 7 + Name: :method + Length: 3 + Value: GET + Promise: :path: /hello + Length: 5 + Name: :path + Length: 6 + Value: /hello + +Frame 33: 278 bytes on wire (2224 bits), 278 bytes captured (2224 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::11, Dst: fe80::10 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 225, Ack: 416, Len: 204 +Zilla Frame + Frame Type ID: 0x40000001 + Frame Type: RESET + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000cc8 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000010 + Initial ID: 0x0000000000000011 + Reply ID: 0x0000000000000010 + Direction: REP + Sequence: 501 + Acknowledge: 502 + Maximum: 5577 + Timestamp: 0x0000000000000021 + Trace ID: 0x0000000000000011 + Authorization: 0x0000000000000000 + Extension: http + Stream Type ID: 0x4620b68a + Stream Type: http + Headers (3 items) + Length: 45 + Size: 3 + Header: :scheme: http + Length: 7 + Name: :scheme + Length: 4 + Value: http + Header: :method: GET + Length: 7 + Name: :method + Length: 3 + Value: GET + Header: :path: /hello + Length: 5 + Name: :path + Length: 6 + Value: /hello + +Frame 34: 278 bytes on wire (2224 bits), 278 bytes captured (2224 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::10, Dst: fe80::11 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 416, Ack: 429, Len: 204 +Zilla Frame + Frame Type ID: 0x00000003 + Frame Type: END + Protocol Type ID: 0x8ab62046 + Protocol Type: http + Worker: 0 + Offset: 0x00000d50 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000d + Routed Namespace: example + Routed Binding: north_http_server + Stream ID: 0x0000000000000011 + Initial ID: 0x0000000000000011 + Reply ID: 0x0000000000000010 + Direction: INI + Sequence: 742 + Acknowledge: 427 + Maximum: 60000 + Timestamp: 0x0000000000000022 + Trace ID: 0x0000000000000011 + Authorization: 0x0000000000000000 + Extension: http + Stream Type ID: 0x4620b68a + Stream Type: http + Trailers (3 items) + Length: 45 + Size: 3 + Trailer: :scheme: http + Length: 7 + Name: :scheme + Length: 4 + Value: http + Trailer: :method: GET + Length: 7 + Name: :method + Length: 3 + Value: GET + Trailer: :path: /hello + Length: 5 + Name: :path + Length: 6 + Value: /hello + diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.pcap b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.pcap new file mode 100644 index 0000000000000000000000000000000000000000..ef04621b3dabf4c54259b880549791b9c9687c31 GIT binary patch literal 272 zcmZ3u>F^Z>CI%J;IQah`$Yg|b85mvw*)J4=T%E%h6oOs-To~H!CMqhsGHhaV_}74> zj)9>JjbF~dAbkp^B0vga3CQR@il1kK#2uIz80>&FI}oQp8Sy2_ y1@XnHMP;c)*rjudq0-zyEu28i1Eqo1f`L1f_JGo!KpJEe2rxN8Xl5wQ0;K`f$SSh{ literal 0 HcmV?d00001 diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.txt b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.txt new file mode 100644 index 0000000000..e4c943083e --- /dev/null +++ b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_filtered_dump.txt @@ -0,0 +1,29 @@ +Frame 1: 232 bytes on wire (1856 bits), 232 bytes captured (1856 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::76, Dst: fe80::77 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 158 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x99f321bc + Protocol Type: tls + Worker: 0 + Offset: 0x00000240 + Origin ID: 0x000000090000000b + Origin Namespace: example + Origin Binding: north_tcp_server + Routed ID: 0x000000090000000c + Routed Namespace: example + Routed Binding: north_tls_server + Stream ID: 0x0000000000000077 + Initial ID: 0x0000000000000077 + Reply ID: 0x0000000000000076 + Direction: INI + Sequence: 71 + Acknowledge: 72 + Maximum: 73 + Timestamp: 0x0000000000000007 + Trace ID: 0x0000000000004202 + Authorization: 0x0000000000004203 + Affinity: 0x0000000000004204 + diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/bindings b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/bindings deleted file mode 100644 index 68e81ae32e26a8d4a1809c519310eff618f57901..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 320 zcmZ{gNeX~45Cn5j4?e(s*Z;rK4pf5^uptyZQ!tP&rPS*6aDYO{sFuAMmY(Mm`|8K@ nd||)B1_~jYTE1Ju9SR|b+SfbjK~lL2?=HIihq?d7p7-VpJoW== diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/labels b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/labels deleted file mode 100644 index 22335feb7a..0000000000 --- a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/engine/labels +++ /dev/null @@ -1,5 +0,0 @@ -test -kafka0 -http -kafka -http0 diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_with_kafka_filter.pcap b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_with_kafka_filter.pcap deleted file mode 100644 index 96e66fe158f709217bacf49f944e3c76719bea7a..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 236 zcmZ3u>F^Z>CI%J;IQah`$Yg|b85oWL*+&$DT%E%h6oOs-To~H!CMqhsGW4-I{A)l` z$H2gf#%GZ}g^&-BfLMZT^ah}`6haBu86~O3C2T;k?8LO}L<5*46OaMY33DinhRG8{ F0{{sf6;}WN diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_without_filter.pcap b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/expected_dump_without_filter.pcap deleted file mode 100644 index f68205f9cbb10bf838f50ed5860366a698976ade..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 2148 zcmZ3u>F^Z>CI%J;IQah`$Yg|b85ni}*}D{iT%E%h6oOs-To~H!CMqhsGPJNc{A)l` z2h@eeXOKRHkPnc6Sb}UcNLB!$gx0KmKnwO^@ks}UPZ-dA0(3OoF9iWom_CUB8ZCn6 zevqn?)Z!ADFwE!ZG)$gE`Up_{5iGvx!|)9&nr~R(egPVREnYSN#ifv(1M>+RP%Jw! zEj!TwCdmY3fcygq5d;mBCy_o3RDT$YpL#L;ge$ET08J=?`3dMc2bc>ufX<|2T7y~3 za2&`wj>St8F}#E;(SZ`sOKe`s0D6hei4Nv1Mpt0GyJC8aksrfbxMJ!h(5#P0-hvs; zaDs+0#SFIv$Y=uM0RP|+1$_mNkdOdc9sVqpfQYcBSDA6y-NzBZH zOZcSbrI%z_DHs}Yae1WXIz_9 zpk-Pa)B($|2^h$mFawsM1|wi`q*lf!z<~V_APFhwkUiT0 Date: Fri, 22 Dec 2023 14:59:25 +0100 Subject: [PATCH 12/16] Implement mqtt message expiry (#640) --- .../config/MqttKafkaHeaderHelper.java | 2 +- .../stream/MqttKafkaPublishFactory.java | 2 +- .../stream/MqttKafkaSessionFactory.java | 3 +- .../stream/MqttKafkaSubscribeFactory.java | 82 ++++++++++++-- .../stream/MqttKafkaSubscribeProxyIT.java | 44 +++++++ .../client.rpt | 2 +- .../server.rpt | 2 +- .../kafka/publish.one.message/client.rpt | 2 +- .../kafka/publish.one.message/server.rpt | 2 +- .../client.rpt | 6 +- .../server.rpt | 6 +- .../client.rpt | 4 +- .../server.rpt | 4 +- .../client.rpt | 70 ++++++++++++ .../server.rpt | 79 +++++++++++++ .../kafka/subscribe.expire.message/client.rpt | 69 +++++++++++ .../kafka/subscribe.expire.message/server.rpt | 74 ++++++++++++ .../client.rpt | 55 +++++++++ .../server.rpt | 61 ++++++++++ .../client.rpt | 1 - .../server.rpt | 1 - .../subscribe.retain.fragmented/client.rpt | 103 +++++++++++++++++ .../subscribe.retain.fragmented/server.rpt | 107 ++++++++++++++++++ .../mqtt/subscribe.expire.message/client.rpt | 33 ++++++ .../mqtt/subscribe.expire.message/server.rpt | 34 ++++++ .../client.rpt | 1 - .../server.rpt | 1 - .../binding/mqtt/kafka/streams/KafkaIT.java | 36 ++++++ .../binding/mqtt/kafka/streams/MqttIT.java | 9 ++ 29 files changed, 862 insertions(+), 33 deletions(-) create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/server.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/client.rpt create mode 100644 specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/server.rpt diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/config/MqttKafkaHeaderHelper.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/config/MqttKafkaHeaderHelper.java index 71be641871..4032e365a1 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/config/MqttKafkaHeaderHelper.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/config/MqttKafkaHeaderHelper.java @@ -34,7 +34,7 @@ public class MqttKafkaHeaderHelper private static final String KAFKA_LOCAL_HEADER_NAME = "zilla:local"; private static final String KAFKA_QOS_HEADER_NAME = "zilla:qos"; - private static final String KAFKA_TIMEOUT_HEADER_NAME = "zilla:timeout-ms"; + private static final String KAFKA_TIMEOUT_HEADER_NAME = "zilla:expiry"; private static final String KAFKA_CONTENT_TYPE_HEADER_NAME = "zilla:content-type"; diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaPublishFactory.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaPublishFactory.java index f99f590726..40d74512f3 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaPublishFactory.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaPublishFactory.java @@ -386,7 +386,7 @@ private void onMqttData( if (mqttPublishDataEx.expiryInterval() != -1) { final MutableDirectBuffer expiryBuffer = new UnsafeBuffer(new byte[4]); - expiryBuffer.putInt(0, mqttPublishDataEx.expiryInterval() * 1000, ByteOrder.BIG_ENDIAN); + expiryBuffer.putInt(0, mqttPublishDataEx.expiryInterval(), ByteOrder.BIG_ENDIAN); kafkaHeadersRW.item(h -> { h.nameLen(helper.kafkaTimeoutHeaderName.sizeof()); diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java index 19ff8861fe..ebc439f253 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSessionFactory.java @@ -540,8 +540,7 @@ private void onMqttData( MqttWillMessageFW will = mqttWillRO.tryWrap(buffer, offset, limit); this.delay = (int) Math.min(SECONDS.toMillis(will.delay()), sessionExpiryMillis); - final int expiryInterval = will.expiryInterval() == -1 ? -1 : - (int) TimeUnit.SECONDS.toMillis(will.expiryInterval()); + final int expiryInterval = will.expiryInterval() == -1 ? -1 : will.expiryInterval(); final MqttWillMessageFW.Builder willMessageBuilder = mqttMessageRW.wrap(willMessageBuffer, 0, willMessageBuffer.capacity()) .topic(will.topic()) diff --git a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java index 89123b909f..3ad06d127d 100644 --- a/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java +++ b/runtime/binding-mqtt-kafka/src/main/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeFactory.java @@ -23,6 +23,7 @@ import static io.aklivity.zilla.runtime.engine.buffer.BufferPool.NO_SLOT; import static io.aklivity.zilla.runtime.engine.concurrent.Signaler.NO_CANCEL_ID; import static java.lang.System.currentTimeMillis; +import static java.time.Instant.now; import static java.util.concurrent.TimeUnit.SECONDS; @@ -104,7 +105,10 @@ public class MqttKafkaSubscribeFactory implements MqttKafkaStreamFactory private static final int RETAIN_FLAG = 1 << RETAIN.ordinal(); private static final int RETAIN_AS_PUBLISHED_FLAG = 1 << RETAIN_AS_PUBLISHED.ordinal(); private static final int SIGNAL_CONNECT_BOOTSTRAP_STREAM = 1; - private static final int DATA_FIN_FLAG = 0x03; + private static final int DATA_FLAG_INIT = 0x02; + private static final int DATA_FLAG_FIN = 0x01; + private static final OctetsFW EMPTY_OCTETS = new OctetsFW().wrap(new UnsafeBuffer(new byte[0]), 0, 0); + private final OctetsFW emptyRO = new OctetsFW().wrap(new UnsafeBuffer(0L, 0), 0, 0); private final BeginFW beginRO = new BeginFW(); private final DataFW dataRO = new DataFW(); @@ -1096,6 +1100,7 @@ final class KafkaMessagesProxy extends KafkaProxy private long replyAck; private int replyMax; private int replyPad; + private boolean expiredMessage; private KafkaMessagesProxy( long originId, @@ -1420,6 +1425,7 @@ private void onKafkaData( assert replyAck <= replySeq; + sendData: if (replySeq > replyAck + replyMax) { doKafkaReset(traceId); @@ -1439,13 +1445,31 @@ private void onKafkaData( final OctetsFW key = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().key().value() : null; final long filters = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().filters() : 0; final KafkaOffsetFW partition = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().partition() : null; + final long timestamp = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().timestamp() : 0; + - if (key != null) + Flyweight mqttSubscribeDataEx = EMPTY_OCTETS; + if ((flags & DATA_FLAG_INIT) != 0x00 && key != null) { String topicName = kafkaMergedDataEx.fetch().key().value() .get((b, o, m) -> b.getStringWithoutLengthUtf8(o, m - o)); helper.visit(kafkaMergedDataEx); + long expireInterval; + if (helper.timeout != -1) + { + expireInterval = timestamp + helper.timeout - now().toEpochMilli(); + if (expireInterval < 0) + { + expiredMessage = true; + break sendData; + } + } + else + { + expireInterval = helper.timeout; + } + // If the qos it was created for is 0, set the high watermark, as we won't receive ack if (mqtt.qos == MqttQoS.AT_MOST_ONCE.value()) { @@ -1457,7 +1481,7 @@ private void onKafkaData( } } - final MqttDataExFW mqttSubscribeDataEx = mqttDataExRW.wrap(extBuffer, 0, extBuffer.capacity()) + mqttSubscribeDataEx = mqttDataExRW.wrap(extBuffer, 0, extBuffer.capacity()) .typeId(mqttTypeId) .subscribe(b -> { @@ -1487,9 +1511,10 @@ private void onKafkaData( } b.flags(flag); b.subscriptionIds(subscriptionIdsRW.build()); - if (helper.timeout != -1) + + if (expireInterval != -1) { - b.expiryInterval(helper.timeout / 1000); + b.expiryInterval((int) expireInterval); } if (helper.contentType != null) { @@ -1525,7 +1550,10 @@ private void onKafkaData( } }); }).build(); + } + if (!expiredMessage) + { if (!MqttKafkaState.initialOpened(mqtt.retained.state) || MqttKafkaState.replyClosed(mqtt.retained.state)) { @@ -1555,6 +1583,11 @@ private void onKafkaData( messageSlotReserved += reserved; } } + + if ((flags & DATA_FLAG_FIN) != 0x00) + { + expiredMessage = false; + } } } @@ -1573,7 +1606,7 @@ private void flushData( { final MqttSubscribeMessageFW message = mqttSubscribeMessageRO.wrap(dataBuffer, messageSlotOffset, dataBuffer.capacity()); - mqtt.doMqttData(traceId, authorization, budgetId, reserved, DATA_FIN_FLAG, message.payload(), + mqtt.doMqttData(traceId, authorization, budgetId, reserved, DATA_FLAG_FIN, message.payload(), message.extension()); messageSlotOffset += message.sizeof(); @@ -1834,6 +1867,7 @@ final class KafkaRetainedProxy extends KafkaProxy private int replyPad; private int unAckedPackets; + private boolean expiredMessage; private KafkaRetainedProxy( long originId, @@ -2126,6 +2160,7 @@ private void onKafkaData( assert replyAck <= replySeq; + sendData: if (replySeq > replyAck + replyMax) { doKafkaReset(traceId); @@ -2145,13 +2180,31 @@ private void onKafkaData( final OctetsFW key = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().key().value() : null; final long filters = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().filters() : 0; final KafkaOffsetFW partition = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().partition() : null; + final long timestamp = kafkaMergedDataEx != null ? kafkaMergedDataEx.fetch().timestamp() : 0; - if (key != null) + Flyweight mqttSubscribeDataEx = EMPTY_OCTETS; + if ((flags & DATA_FLAG_INIT) != 0x00 && key != null) { String topicName = kafkaMergedDataEx.fetch().key().value() .get((b, o, m) -> b.getStringWithoutLengthUtf8(o, m - o)); helper.visit(kafkaMergedDataEx); - final Flyweight mqttSubscribeDataEx = mqttDataExRW.wrap(extBuffer, 0, extBuffer.capacity()) + + long expireInterval; + if (helper.timeout != -1) + { + expireInterval = timestamp + helper.timeout - now().toEpochMilli(); + if (expireInterval < 0) + { + expiredMessage = true; + break sendData; + } + } + else + { + expireInterval = helper.timeout; + } + + mqttSubscribeDataEx = mqttDataExRW.wrap(extBuffer, 0, extBuffer.capacity()) .typeId(mqttTypeId) .subscribe(b -> { @@ -2187,9 +2240,9 @@ private void onKafkaData( } b.flags(flag); b.subscriptionIds(subscriptionIdsRW.build()); - if (helper.timeout != -1) + if (expireInterval != -1) { - b.expiryInterval(helper.timeout / 1000); + b.expiryInterval((int) expireInterval); } if (helper.contentType != null) { @@ -2225,11 +2278,18 @@ private void onKafkaData( } }); }).build(); + } + if (!expiredMessage) + { mqtt.doMqttData(traceId, authorization, budgetId, reserved, flags, payload, mqttSubscribeDataEx); - mqtt.mqttSharedBudget -= length; } + + if ((flags & DATA_FLAG_FIN) != 0x00) + { + expiredMessage = false; + } } } diff --git a/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeProxyIT.java b/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeProxyIT.java index 194d071a67..62e2ac00fc 100644 --- a/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeProxyIT.java +++ b/runtime/binding-mqtt-kafka/src/test/java/io/aklivity/zilla/runtime/binding/mqtt/kafka/internal/stream/MqttKafkaSubscribeProxyIT.java @@ -152,6 +152,17 @@ public void shouldReceiveOneMessage() throws Exception k3po.finish(); } + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/subscribe.one.message/client", + "${kafka}/subscribe.one.message.fragmented/server"}) + public void shouldReceiveOneMessageFragmented() throws Exception + { + k3po.finish(); + } + @Test @Configuration("proxy.options.yaml") @Configure(name = WILL_AVAILABLE_NAME, value = "false") @@ -251,6 +262,17 @@ public void shouldReceiveRetainedNoRetainAsPublished() throws Exception k3po.finish(); } + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/subscribe.retain/client", + "${kafka}/subscribe.retain.fragmented/server"}) + public void shouldReceiveRetainedFragmented() throws Exception + { + k3po.finish(); + } + @Test @Configuration("proxy.yaml") @Configure(name = WILL_AVAILABLE_NAME, value = "false") @@ -580,4 +602,26 @@ public void shouldReplayRetainedQos2() throws Exception { k3po.finish(); } + + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/subscribe.expire.message/client", + "${kafka}/subscribe.expire.message/server"}) + public void shouldExpireMessage() throws Exception + { + k3po.finish(); + } + + @Test + @Configuration("proxy.yaml") + @Configure(name = WILL_AVAILABLE_NAME, value = "false") + @Specification({ + "${mqtt}/subscribe.expire.message/client", + "${kafka}/subscribe.expire.message.fragmented/server"}) + public void shouldExpireMessageFragmented() throws Exception + { + k3po.finish(); + } } diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/client.rpt index 7af4769612..6faa447bb7 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/client.rpt @@ -39,7 +39,7 @@ write zilla:data.ext ${kafka:dataEx() .header("zilla:filter", "sensor") .header("zilla:filter", "one") .header("zilla:local", "client") - .headerInt("zilla:timeout-ms", 15000) + .headerInt("zilla:expiry", 15) .header("zilla:content-type", "message") .header("zilla:format", "TEXT") .header("zilla:reply-to", "messages") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/server.rpt index 6a6cc098b0..a9653e2d70 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message.changed.topic.name/server.rpt @@ -42,7 +42,7 @@ read zilla:data.ext ${kafka:matchDataEx() .header("zilla:filter", "sensor") .header("zilla:filter", "one") .header("zilla:local", "client") - .headerInt("zilla:timeout-ms", 15000) + .headerInt("zilla:expiry", 15) .header("zilla:content-type", "message") .header("zilla:format", "TEXT") .header("zilla:reply-to", "messages") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/client.rpt index 49f76cf963..66637714da 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/client.rpt @@ -39,7 +39,7 @@ write zilla:data.ext ${kafka:dataEx() .header("zilla:filter", "sensor") .header("zilla:filter", "one") .header("zilla:local", "client") - .headerInt("zilla:timeout-ms", 15000) + .headerInt("zilla:expiry", 15) .header("zilla:content-type", "message") .header("zilla:format", "TEXT") .header("zilla:reply-to", "mqtt-messages") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/server.rpt index 82b379a218..468e8b279f 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/publish.one.message/server.rpt @@ -42,7 +42,7 @@ read zilla:data.ext ${kafka:matchDataEx() .header("zilla:filter", "sensor") .header("zilla:filter", "one") .header("zilla:local", "client") - .headerInt("zilla:timeout-ms", 15000) + .headerInt("zilla:expiry", 15) .header("zilla:content-type", "message") .header("zilla:format", "TEXT") .header("zilla:reply-to", "mqtt-messages") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt index 1f33e2a94e..b237afd9f6 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/client.rpt @@ -295,7 +295,7 @@ write zilla:data.ext ${kafka:dataEx() write ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") @@ -427,7 +427,7 @@ read zilla:data.ext ${kafka:matchDataEx() read ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") @@ -467,7 +467,7 @@ write zilla:data.ext ${kafka:dataEx() .partition(-1, -1) .key("obituaries") .header("zilla:filter", "obituaries") - .headerInt("zilla:timeout-ms", 15000) + .headerInt("zilla:expiry", 15) .header("zilla:format", "TEXT") .header("zilla:reply-to", "mqtt-messages") .header("zilla:reply-key", "responses/client1") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt index f2e9fcf615..206d00b608 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.abort.deliver.will/server.rpt @@ -298,7 +298,7 @@ read zilla:data.ext ${kafka:matchDataEx() read ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") @@ -428,7 +428,7 @@ write zilla:data.ext ${kafka:dataEx() write ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") @@ -466,7 +466,7 @@ read zilla:data.ext ${kafka:matchDataEx() .partition(-1, -1) .key("obituaries") .header("zilla:filter", "obituaries") - .headerInt("zilla:timeout-ms", 15000) + .headerInt("zilla:expiry", 15) .header("zilla:format", "TEXT") .header("zilla:reply-to", "mqtt-messages") .header("zilla:reply-key", "responses/client1") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/client.rpt index 03006dbc80..e558c9c0a8 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/client.rpt @@ -269,7 +269,7 @@ write zilla:data.ext ${kafka:dataEx() write ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") @@ -399,7 +399,7 @@ read zilla:data.ext ${kafka:matchDataEx() read ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/server.rpt index 5c0d7a4597..5ae6d8c246 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/session.will.message.will.id.mismatch.skip.delivery/server.rpt @@ -269,7 +269,7 @@ read zilla:data.ext ${kafka:matchDataEx() read ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") @@ -399,7 +399,7 @@ write zilla:data.ext ${kafka:dataEx() write ${mqtt:will() .topic("obituaries") .delay(1000) - .expiryInterval(15000) + .expiryInterval(15) .format("TEXT") .responseTopic("responses/client1") .lifetimeId("1e6a1eb5-810a-459d-a12c-a6fa08f228d1") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/client.rpt new file mode 100644 index 0000000000..079b44646c --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/client.rpt @@ -0,0 +1,70 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .headerNot("zilla:qos", "1") + .headerNot("zilla:qos", "2") + .build() + .evaluation("EAGER") + .build() + .build()} + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .partition(0, 0, 1, 1) + .build() + .build()} + +connected + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(timestamp) + .filters(1) + .partition(0, 2, 2) + .progress(0, 3) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .headerInt("zilla:expiry", 1) + .header("zilla:format", "TEXT") + .build() + .build()} +read "mess" + +read "age" + +write close +read closed diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/server.rpt new file mode 100644 index 0000000000..5887c752ea --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message.fragmented/server.rpt @@ -0,0 +1,79 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +property deltaMillis 1000L +property timestamp ${kafka:timestamp() - deltaMillis} + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .headerNot("zilla:qos", "1") + .headerNot("zilla:qos", "2") + .build() + .evaluation("EAGER") + .build() + .build()} + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .partition(0, 0, 1, 1) + .build() + .build()} + +connected + +write option zilla:flags "init" +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(timestamp) + .filters(1) + .partition(0, 2, 2) + .progress(0, 3) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .headerInt("zilla:expiry", 1) + .header("zilla:format", "TEXT") + .build() + .build()} +write "mess" +write flush + +write option zilla:flags "fin" +write "age" +write flush + +read closed +write close diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/client.rpt new file mode 100644 index 0000000000..3a2100ce41 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/client.rpt @@ -0,0 +1,69 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .headerNot("zilla:qos", "1") + .headerNot("zilla:qos", "2") + .build() + .evaluation("EAGER") + .build() + .build()} + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .partition(0, 0, 1, 1) + .build() + .build()} + +connected + + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(timestamp) + .filters(1) + .partition(0, 2, 2) + .progress(0, 3) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .headerInt("zilla:expiry", 1) + .header("zilla:format", "TEXT") + .build() + .build()} +read "message" + +write close +read closed diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/server.rpt new file mode 100644 index 0000000000..ef0389a20e --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.expire.message/server.rpt @@ -0,0 +1,74 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +property deltaMillis 1000L +property timestamp ${kafka:timestamp() - deltaMillis} + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .headerNot("zilla:qos", "1") + .headerNot("zilla:qos", "2") + .build() + .evaluation("EAGER") + .build() + .build()} + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .partition(0, 0, 1, 1) + .build() + .build()} + +connected + +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(timestamp) + .filters(1) + .partition(0, 2, 2) + .progress(0, 3) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .headerInt("zilla:expiry", 1) + .header("zilla:format", "TEXT") + .build() + .build()} +write "message" +write flush + +read closed +write close diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/client.rpt new file mode 100644 index 0000000000..cb8138e477 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/client.rpt @@ -0,0 +1,55 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .build() + .evaluation("EAGER") + .build() + .build()} + +connected + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .filters(1) + .partition(0, 1, 2) + .progress(0, 2) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .header("zilla:format", "TEXT") + .build() + .build()} + +read "mess" + +read "age" diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/server.rpt new file mode 100644 index 0000000000..b70fdeac42 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.fragmented/server.rpt @@ -0,0 +1,61 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .build() + .evaluation("EAGER") + .build() + .build()} + +connected + +write option zilla:flags "init" +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(kafka:timestamp()) + .filters(1) + .partition(0, 1, 2) + .progress(0, 2) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .header("zilla:format", "TEXT") + .build() + .build()} +write "mess" +write flush + +write option zilla:flags "fin" +write "age" +write flush diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt index de8fbc0dc3..1b56acd62d 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt @@ -46,7 +46,6 @@ read zilla:data.ext ${kafka:matchDataEx() .header("zilla:filter", "sensor") .header("zilla:filter", "one") .header("zilla:local", "client") - .headerInt("zilla:timeout-ms", 15000) .header("zilla:content-type", "message") .header("zilla:format", "TEXT") .header("zilla:reply-to", "sensor/one") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt index 9742cf9769..ec25d52edd 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt @@ -49,7 +49,6 @@ write zilla:data.ext ${kafka:dataEx() .header("zilla:filter", "sensor") .header("zilla:filter", "one") .header("zilla:local", "client") - .headerInt("zilla:timeout-ms", 15000) .header("zilla:content-type", "message") .header("zilla:format", "TEXT") .header("zilla:reply-to", "sensor/one") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/client.rpt new file mode 100644 index 0000000000..b6624d3f9a --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/client.rpt @@ -0,0 +1,103 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-retained") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .build() + .evaluation("EAGER") + .build() + .build()} + +connected + + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .filters(1) + .partition(0, 1, 2) + .progress(0, 2) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .header("zilla:format", "TEXT") + .build() + .build()} + +read "mess" + +read "age" + +read advised zilla:flush + +write close +read closed + +write notify RETAINED_FINISHED + +connect await RETAINED_FINISHED + "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${kafka:beginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .build() + .evaluation("EAGER") + .build() + .build()} + +connected + +read zilla:data.ext ${kafka:matchDataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .filters(1) + .partition(0, 1, 2) + .progress(0, 2) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .header("zilla:format", "TEXT") + .build() + .build()} + +read "message2" diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/server.rpt new file mode 100644 index 0000000000..88749b722e --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/kafka/subscribe.retain.fragmented/server.rpt @@ -0,0 +1,107 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/kafka0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-retained") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .build() + .evaluation("EAGER") + .build() + .build()} + +connected + +write option zilla:flags "init" +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(kafka:timestamp()) + .filters(1) + .partition(0, 1, 2) + .progress(0, 2) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .header("zilla:format", "TEXT") + .build() + .build()} + +write "mess" +write flush + +write option zilla:flags "fin" +write "age" +write flush + +write advise zilla:flush + +read closed +write close + +accepted + +read zilla:begin.ext ${kafka:matchBeginEx() + .typeId(zilla:id("kafka")) + .merged() + .capabilities("FETCH_ONLY") + .topic("mqtt-messages") + .filter() + .headers("zilla:filter") + .sequence("sensor") + .sequence("one") + .build() + .build() + .evaluation("EAGER") + .build() + .build()} + +connected + +write zilla:data.ext ${kafka:dataEx() + .typeId(zilla:id("kafka")) + .merged() + .fetch() + .timestamp(kafka:timestamp()) + .filters(1) + .partition(0, 1, 2) + .progress(0, 2) + .progress(1, 1) + .key("sensor/one") + .header("zilla:filter", "sensor") + .header("zilla:filter", "one") + .header("zilla:local", "client") + .header("zilla:format", "TEXT") + .build() + .build()} + +write "message2" +write flush + diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/client.rpt new file mode 100644 index 0000000000..e4a549d274 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/client.rpt @@ -0,0 +1,33 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +connect "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +write zilla:begin.ext ${mqtt:beginEx() + .typeId(zilla:id("mqtt")) + .subscribe() + .clientId("client") + .qos("AT_MOST_ONCE") + .filter("sensor/one", 1, "AT_LEAST_ONCE") + .build() + .build()} + +connected + + +write close +read closed diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/server.rpt new file mode 100644 index 0000000000..6bdcfae9e6 --- /dev/null +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.expire.message/server.rpt @@ -0,0 +1,34 @@ +# +# Copyright 2021-2023 Aklivity Inc +# +# Licensed under the Aklivity Community License (the "License"); you may not use +# this file except in compliance with the License. You may obtain a copy of the +# License at +# +# https://www.aklivity.io/aklivity-community-license/ +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT +# WARRANTIES OF ANY KIND, either express or implied. See the License for the +# specific language governing permissions and limitations under the License. +# + +accept "zilla://streams/mqtt0" + option zilla:window 8192 + option zilla:transmission "duplex" + +accepted + +read zilla:begin.ext ${mqtt:matchBeginEx() + .typeId(zilla:id("mqtt")) + .subscribe() + .clientId("client") + .qos("AT_MOST_ONCE") + .filter("sensor/one", 1, "AT_LEAST_ONCE") + .build() + .build()} + +connected + +read closed +write close diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt index 0cf15cfa82..ea79a52fda 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/client.rpt @@ -32,7 +32,6 @@ read zilla:data.ext ${mqtt:matchDataEx() .subscribe() .topic("sensor/one") .subscriptionId(1) - .expiryInterval(15) .contentType("message") .format("TEXT") .responseTopic("sensor/one") diff --git a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt index d173fa405a..71c80a12ea 100644 --- a/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt +++ b/specs/binding-mqtt-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/mqtt/subscribe.one.message.receive.response.topic.and.correlation.data/server.rpt @@ -34,7 +34,6 @@ write zilla:data.ext ${mqtt:dataEx() .subscribe() .topic("sensor/one") .subscriptionId(1) - .expiryInterval(15) .contentType("message") .format("TEXT") .responseTopic("sensor/one") diff --git a/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/KafkaIT.java b/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/KafkaIT.java index b777b39bac..ecfb8a7917 100644 --- a/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/KafkaIT.java +++ b/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/KafkaIT.java @@ -341,6 +341,15 @@ public void shouldReceiveOneMessage() throws Exception k3po.finish(); } + @Test + @Specification({ + "${kafka}/subscribe.one.message.fragmented/client", + "${kafka}/subscribe.one.message.fragmented/server"}) + public void shouldReceiveOneMessageFragmented() throws Exception + { + k3po.finish(); + } + @Test @Specification({ "${kafka}/subscribe.one.message.changed.topic.name/client", @@ -386,6 +395,15 @@ public void shouldReceiveRetained() throws Exception k3po.finish(); } + @Test + @Specification({ + "${kafka}/subscribe.retain.fragmented/client", + "${kafka}/subscribe.retain.fragmented/server"}) + public void shouldReceiveRetainedFragmented() throws Exception + { + k3po.finish(); + } + @Test @Specification({ "${kafka}/subscribe.receive.message.wildcard/client", @@ -917,4 +935,22 @@ public void shouldReceiveMessageOverlappingWildcardMixedQos() throws Exception { k3po.finish(); } + + @Test + @Specification({ + "${kafka}/subscribe.expire.message/client", + "${kafka}/subscribe.expire.message/server"}) + public void shouldExpireMessage() throws Exception + { + k3po.finish(); + } + + @Test + @Specification({ + "${kafka}/subscribe.expire.message.fragmented/client", + "${kafka}/subscribe.expire.message.fragmented/server"}) + public void shouldExpireMessageFragmented() throws Exception + { + k3po.finish(); + } } diff --git a/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/MqttIT.java b/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/MqttIT.java index 837ef28fbe..995d5edc53 100644 --- a/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/MqttIT.java +++ b/specs/binding-mqtt-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/mqtt/kafka/streams/MqttIT.java @@ -757,4 +757,13 @@ public void shouldReceiveMessageOverlappingWildcardMixedQos() throws Exception { k3po.finish(); } + + @Test + @Specification({ + "${mqtt}/subscribe.expire.message/client", + "${mqtt}/subscribe.expire.message/server"}) + public void shouldExpireMessage() throws Exception + { + k3po.finish(); + } } From 4ff723bc609b2bd999ace5db6f5b18b249ccd67b Mon Sep 17 00:00:00 2001 From: Attila Kreiner Date: Fri, 22 Dec 2023 18:44:40 +0100 Subject: [PATCH 13/16] Add grpc extension parsing to the dump command (#652) --- incubator/command-dump/pom.xml | 6 + .../command/dump/internal/airline/zilla.lua | 150 +++++++- .../airline/ZillaDumpCommandTest.java | 143 +++++++- .../dump/internal/airline/engine/data0 | Bin 8960 -> 8960 bytes .../dump/internal/airline/engine/labels | 2 + .../dump/internal/airline/expected_dump.pcap | Bin 9393 -> 11689 bytes .../dump/internal/airline/expected_dump.txt | 332 ++++++++++++++++++ 7 files changed, 628 insertions(+), 5 deletions(-) diff --git a/incubator/command-dump/pom.xml b/incubator/command-dump/pom.xml index 943835040a..f893082a2c 100644 --- a/incubator/command-dump/pom.xml +++ b/incubator/command-dump/pom.xml @@ -61,6 +61,12 @@ ${project.version} test + + io.aklivity.zilla + binding-grpc.spec + ${project.version} + test + org.junit.jupiter junit-jupiter-engine diff --git a/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua b/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua index 4645b8fae5..5e8aea7035 100644 --- a/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua +++ b/incubator/command-dump/src/main/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/zilla.lua @@ -85,6 +85,11 @@ local proxy_ext_secure_info_types = { [0x25] = "KEY", } +local grpc_types = { + [0] = "TEXT", + [1] = "BASE64" +} + local fields = { -- header frame_type_id = ProtoField.uint32("zilla.frame_type_id", "Frame Type ID", base.HEX), @@ -187,6 +192,29 @@ local fields = { http_ext_header_value = ProtoField.string("zilla.http_ext.header_value", "Value", base.NONE), -- promise id http_ext_promise_id = ProtoField.uint64("zilla.promise_id", "Promise ID", base.HEX), + + -- grpc extension + grpc_ext_scheme_length = ProtoField.uint16("zilla.grpc_ext.scheme_length", "Length", base.DEC), + grpc_ext_scheme = ProtoField.string("zilla.grpc_ext.scheme", "Scheme", base.NONE), + grpc_ext_authority_length = ProtoField.uint16("zilla.grpc_ext.authority_length", "Length", base.DEC), + grpc_ext_authority = ProtoField.string("zilla.grpc_ext.authority", "Authority", base.NONE), + grpc_ext_service_length = ProtoField.uint16("zilla.grpc_ext.service_length", "Length", base.DEC), + grpc_ext_service = ProtoField.string("zilla.grpc_ext.service", "Service", base.NONE), + grpc_ext_method_length = ProtoField.uint16("zilla.grpc_ext.method_length", "Length", base.DEC), + grpc_ext_method = ProtoField.string("zilla.grpc_ext.method", "Method", base.NONE), + grpc_ext_deferred = ProtoField.uint32("zilla.grpc_ext.deferred", "Deferred", base.DEC), + grpc_ext_status_length = ProtoField.uint16("zilla.grpc_ext.status_length", "Length", base.DEC), + grpc_ext_status = ProtoField.string("zilla.grpc_ext.status", "Status", base.NONE), + -- metadata + grpc_ext_metadata_array_length = ProtoField.uint8("zilla.grpc_ext.metadata_array_length", "Length", base.DEC), + grpc_ext_metadata_array_size = ProtoField.uint8("zilla.grpc_ext.metadata_array_size", "Size", base.DEC), + grpc_ext_metadata_type = ProtoField.uint32("zilla.grpc_ext.metadata_type", "Type", base.DEC, grpc_types), + grpc_ext_metadata_name_length_varint = ProtoField.bytes("zilla.grpc_ext.metadata_name_varint", "Length (Varint)", base.NONE), + grpc_ext_metadata_name_length = ProtoField.uint32("zilla.grpc_ext.metadata_name_length", "Length", base.DEC), + grpc_ext_metadata_name = ProtoField.string("zilla.grpc_ext.metadata_name", "Name", base.NONE), + grpc_ext_metadata_value_length_varint = ProtoField.bytes("zilla.grpc_ext.metadata_value_length_varint", "Length (Varint)", base.NONE), + grpc_ext_metadata_value_length = ProtoField.uint32("zilla.grpc_ext.metadata_value_length", "Length", base.DEC), + grpc_ext_metadata_value = ProtoField.string("zilla.grpc_ext.metadata_value", "Value", base.NONE), } zilla_protocol.fields = fields; @@ -502,6 +530,8 @@ function handle_extension(buffer, subtree, pinfo, info, offset, frame_type_id) handle_proxy_extension(buffer, extension_subtree, offset + 4) elseif stream_type_id == HTTP_ID then handle_http_extension(buffer, extension_subtree, offset + 4, frame_type_id) + elseif stream_type_id == GRPC_ID then + handle_grpc_extension(buffer, extension_subtree, offset + 4, frame_type_id) end if stream_type and stream_type ~= "" then @@ -601,12 +631,12 @@ function handle_proxy_extension(buffer, extension_subtree, offset) item_offset = item_offset + 1 if type == "ALPN" then local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 1) - add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, + add_proxy_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, slice_length, slice_text, fields.proxy_ext_info_type, fields.proxy_ext_info_length, fields.proxy_ext_info_alpn) item_offset = item_offset + item_length elseif type == "AUTHORITY" then local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 2) - add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, + add_proxy_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, slice_length, slice_text, fields.proxy_ext_info_type, fields.proxy_ext_info_length, fields.proxy_ext_info_authority) item_offset = item_offset + item_length elseif type == "IDENTITY" then @@ -638,7 +668,7 @@ function handle_proxy_extension(buffer, extension_subtree, offset) item_offset = item_offset + item_length elseif type == "NAMESPACE" then local item_length, slice_length, slice_text = dissect_length_value(buffer, item_offset, 2) - add_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, + add_proxy_string_as_subtree(buffer(item_offset - 1, item_length + 1), extension_subtree, label_format, slice_type_id, slice_length, slice_text, fields.proxy_ext_info_type, fields.proxy_ext_info_length, fields.proxy_ext_info_namespace) item_offset = item_offset + item_length end @@ -653,7 +683,7 @@ function dissect_length_value(buffer, item_offset, length_length) return item_length, slice_length, slice_value end -function add_string_as_subtree(buffer, tree, label_format, slice_type_id, slice_length, slice_text, field_type, field_length, +function add_proxy_string_as_subtree(buffer, tree, label_format, slice_type_id, slice_length, slice_text, field_type, field_length, field_text) local type_id = slice_type_id:le_int() local type = proxy_ext_info_types[type_id] @@ -702,5 +732,117 @@ function dissect_and_add_http_headers(buffer, extension_subtree, offset, plural_ end end +function handle_grpc_extension(buffer, extension_subtree, offset, frame_type_id) + if frame_type_id == BEGIN_ID then + -- scheme + local scheme_offset = offset + local scheme_length, slice_scheme_length, slice_scheme_text = dissect_length_value(buffer, scheme_offset, 2) + add_simple_string_as_subtree(buffer(scheme_offset, scheme_length), extension_subtree, "Scheme: %s", slice_scheme_length, + slice_scheme_text, fields.grpc_ext_scheme_length, fields.grpc_ext_scheme) + -- authority + local authority_offset = scheme_offset + scheme_length + local authority_length, slice_authority_length, slice_authority_text = dissect_length_value(buffer, authority_offset, 2) + add_simple_string_as_subtree(buffer(authority_offset, authority_length), extension_subtree, "Authority: %s", slice_authority_length, + slice_authority_text, fields.grpc_ext_authority_length, fields.grpc_ext_authority) + -- service + local service_offset = authority_offset + authority_length + local service_length, slice_service_length, slice_service_text = dissect_length_value(buffer, service_offset, 2) + add_simple_string_as_subtree(buffer(service_offset, service_length), extension_subtree, "Service: %s", slice_service_length, + slice_service_text, fields.grpc_ext_service_length, fields.grpc_ext_service) + -- method + local method_offset = service_offset + service_length + local method_length, slice_method_length, slice_method_text = dissect_length_value(buffer, method_offset, 2) + add_simple_string_as_subtree(buffer(method_offset, method_length), extension_subtree, "Method: %s", slice_method_length, + slice_method_text, fields.grpc_ext_method_length, fields.grpc_ext_method) + -- metadata array + local metadata_array_offset = method_offset + method_length + local slice_metadata_array_length = buffer(metadata_array_offset, 4) + local slice_metadata_array_size = buffer(metadata_array_offset + 4, 4) + local metadata_array_length = slice_metadata_array_length:le_int() + local metadata_array_size = slice_metadata_array_size:le_int() + local length = 8 + local label = string.format("Metadata (%d items)", metadata_array_size) + local metadata_array_subtree = extension_subtree:add(zilla_protocol, buffer(metadata_array_offset, length), label) + metadata_array_subtree:add_le(fields.grpc_ext_metadata_array_length, slice_metadata_array_length) + metadata_array_subtree:add_le(fields.grpc_ext_metadata_array_size, slice_metadata_array_size) + local item_offset = metadata_array_offset + length + for i = 1, metadata_array_size do + local record_length = dissect_and_add_grpc_metadata(buffer, extension_subtree, item_offset) + item_offset = item_offset + record_length + end + elseif frame_type_id == DATA_ID then + local slice_deferred = buffer(offset, 4) + extension_subtree:add_le(fields.grpc_ext_deferred, slice_deferred) + elseif frame_type_id == ABORT_ID or frame_type_id == RESET_ID then + local status_length, slice_status_length, slice_status_text = dissect_length_value(buffer, offset, 2) + add_simple_string_as_subtree(buffer(offset, status_length), extension_subtree, "Status: %s", slice_status_length, + slice_status_text, fields.grpc_ext_status_length, fields.grpc_ext_status) + end +end + +function add_simple_string_as_subtree(buffer, tree, label_format, slice_length, slice_text, field_length, field_text) + local text = slice_text:string() + local label = string.format(label_format, text) + local subtree = tree:add(zilla_protocol, buffer, label) + subtree:add_le(field_length, slice_length) + subtree:add(field_text, slice_text) +end + +function dissect_and_add_grpc_metadata(buffer, extension_subtree, metadata_offset) + local offset = metadata_offset + -- type + local slice_type_id = buffer(offset, 1) + local type = grpc_types[slice_type_id:le_int()] + offset = offset + 1 + -- name_length + local name_length, slice_name_length_varint, length_name_length = decode_varint32(buffer, offset) + offset = offset + length_name_length + -- name + local slice_name = buffer(offset, name_length) + local name = slice_name:string() + offset = offset + name_length + -- value_length + local value_length, slice_value_length_varint, length_value_length = decode_varint32(buffer, offset) + offset = offset + length_value_length + -- value + local slice_value = buffer(offset, value_length) + local value = slice_value:string() + -- add subtree + local record_length = 1 + length_name_length + name_length + length_value_length + value_length + local label = string.format("Metadata: [%s] %s: %s", type, name, value) + local metadata_subtree = extension_subtree:add(zilla_protocol, buffer(metadata_offset, record_length), label) + metadata_subtree:add(fields.grpc_ext_metadata_type, slice_type_id) + metadata_subtree:add(fields.grpc_ext_metadata_name_length_varint, slice_name_length_varint) + metadata_subtree:add(fields.grpc_ext_metadata_name_length, name_length) + metadata_subtree:add(fields.grpc_ext_metadata_name, slice_name) + metadata_subtree:add(fields.grpc_ext_metadata_value_length_varint, slice_value_length_varint) + metadata_subtree:add(fields.grpc_ext_metadata_value_length, value_length) + metadata_subtree:add(fields.grpc_ext_metadata_value, slice_value) + return record_length +end + +function decode_varint32(buffer, offset) + local value = 0 + local i = 0 + local pos = offset + local b = buffer(pos, 1):le_int() + + while bit.band(b, 0x80) ~= 0 do + value = bit.bor(value, bit.lshift(bit.band(b, 0x7F), i)) + i = i + 7 + if i > 35 then + error("varint32 value too long") + end + pos = pos + 1 + b = buffer(pos, 1):le_int() + end + + local unsigned = bit.bor(value, bit.lshift(b, i)) + local result = bit.rshift(bit.bxor(bit.rshift(bit.lshift(unsigned, 31), 31), unsigned), 1) + result = bit.bxor(result, bit.band(unsigned, bit.lshift(1, 31))) + local length = pos - offset + 1 + return result, buffer(offset, length), length +end + local data_dissector = DissectorTable.get("tcp.port") data_dissector:add(7114, zilla_protocol) diff --git a/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java b/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java index 7a87f4a11d..6d3b4e22b2 100644 --- a/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java +++ b/incubator/command-dump/src/test/java/io/aklivity/zilla/runtime/command/dump/internal/airline/ZillaDumpCommandTest.java @@ -22,6 +22,7 @@ import java.io.File; import java.io.IOException; import java.io.InputStream; +import java.nio.charset.StandardCharsets; import java.nio.file.Files; import java.nio.file.Path; import java.nio.file.Paths; @@ -47,6 +48,7 @@ import io.aklivity.zilla.runtime.command.dump.internal.types.stream.ResetFW; import io.aklivity.zilla.runtime.command.dump.internal.types.stream.SignalFW; import io.aklivity.zilla.runtime.engine.internal.layouts.StreamsLayout; +import io.aklivity.zilla.specs.binding.grpc.internal.GrpcFunctions; import io.aklivity.zilla.specs.binding.http.internal.HttpFunctions; import io.aklivity.zilla.specs.binding.proxy.internal.ProxyFunctions; import io.aklivity.zilla.specs.engine.internal.types.stream.BeginFW; @@ -59,8 +61,9 @@ public class ZillaDumpCommandTest private static final int STREAMS_CAPACITY = 8 * 1024; private static final Path ENGINE_PATH = Path.of("src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine"); - private static final int PROXY_TYPE_ID = 5; + private static final int GRPC_TYPE_ID = 2; private static final int HTTP_TYPE_ID = 3; + private static final int PROXY_TYPE_ID = 5; private final BeginFW.Builder beginRW = new BeginFW.Builder(); private final DataFW.Builder dataRW = new DataFW.Builder(); @@ -679,6 +682,144 @@ public void generateStreamsBuffer() throws Exception .traceId(0x0200000000000003L) .build(); streams[2].write(EndFW.TYPE_ID, end5.buffer(), 0, end5.sizeof()); + + // worker 0 + // grpc extension + DirectBuffer grpcBeginEx1 = new UnsafeBuffer(GrpcFunctions.beginEx() + .typeId(GRPC_TYPE_ID) + .scheme("http") + .authority("localhost:7153") + .service("example.EchoService") + .method("EchoUnary") + .metadata("grpc-accept-encoding", "gzip") + .metadata("metadata-2", "hello") + .metadata("BASE64", "metadata-3", "4242") + .build()); + BeginFW begin11 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000013L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000023L) + .traceId(0x0000000000000013L) + .affinity(0x0000000000000000L) + .extension(grpcBeginEx1, 0, grpcBeginEx1.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin11.buffer(), 0, begin11.sizeof()); + + DirectBuffer grpcBeginEx2 = new UnsafeBuffer(GrpcFunctions.beginEx() + .typeId(GRPC_TYPE_ID) + .scheme("http") + .authority("localhost:7153") + .service("example.EchoService") + .method("EchoUnary") + .metadata("long field", "Z".repeat(200)) + .metadata("metadata-2", "hello") + .build()); + BeginFW begin12 = beginRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000012L) // REP + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000024L) + .traceId(0x0000000000000013L) + .affinity(0x0000000000000000L) + .extension(grpcBeginEx2, 0, grpcBeginEx2.capacity()) + .build(); + streams[0].write(BeginFW.TYPE_ID, begin12.buffer(), 0, begin12.sizeof()); + + // data frame with extension, without payload, payload length is -1 + DirectBuffer grpcDataEx1 = new UnsafeBuffer(new byte[]{GRPC_TYPE_ID, 0, 0, 0, 42, 0, 0, 0}); + DataFW data6 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000013L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000025L) + .traceId(0x0000000000000013L) + .budgetId(0x0000000000000013L) + .reserved(0x00000042) + .extension(grpcDataEx1, 0, grpcDataEx1.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data6.buffer(), 0, data6.sizeof()); + + // data frame with extension, without payload, payload length is 0 + DirectBuffer grpcDataPayload1 = new UnsafeBuffer(); + DirectBuffer grpcDataEx2 = new UnsafeBuffer(new byte[]{GRPC_TYPE_ID, 0, 0, 0, 77, 0, 0, 0}); + DataFW data7 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000012L) // REP + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000026L) + .traceId(0x0000000000000013L) + .budgetId(0x0000000000000013L) + .reserved(0x00000042) + .payload(grpcDataPayload1, 0, grpcDataPayload1.capacity()) + .extension(grpcDataEx2, 0, grpcDataEx2.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data7.buffer(), 0, data7.sizeof()); + + // data frame with extension, with payload + DirectBuffer grpcDataPayload2 = new UnsafeBuffer("Hello World!".getBytes(StandardCharsets.UTF_8)); + DirectBuffer grpcDataEx3 = new UnsafeBuffer(new byte[]{GRPC_TYPE_ID, 0, 0, 0, 88, 0, 0, 0}); + DataFW data8 = dataRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000013L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000027L) + .traceId(0x0000000000000013L) + .budgetId(0x0000000000000013L) + .reserved(0x00000042) + .payload(grpcDataPayload2, 0, grpcDataPayload2.capacity()) + .extension(grpcDataEx3, 0, grpcDataEx3.capacity()) + .build(); + streams[0].write(DataFW.TYPE_ID, data8.buffer(), 0, data8.sizeof()); + + DirectBuffer grpcAbortEx1 = new UnsafeBuffer(GrpcFunctions.abortEx() + .typeId(GRPC_TYPE_ID) + .status("aborted") + .build()); + AbortFW abort2 = abortRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000013L) // INI + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000028L) + .traceId(0x0000000000000013L) + .extension(grpcAbortEx1, 0, grpcAbortEx1.capacity()) + .build(); + streams[0].write(AbortFW.TYPE_ID, abort2.buffer(), 0, abort2.sizeof()); + + DirectBuffer grpcResetEx1 = new UnsafeBuffer(GrpcFunctions.abortEx() + .typeId(GRPC_TYPE_ID) + .status("reset") + .build()); + ResetFW reset3 = resetRW.wrap(frameBuffer, 0, frameBuffer.capacity()) + .originId(0x000000090000001aL) // north_grpc_server + .routedId(0x000000090000001bL) // north_grpc_kafka_mapping + .streamId(0x0000000000000012L) // REP + .sequence(0) + .acknowledge(0) + .maximum(0) + .timestamp(0x0000000000000029L) + .traceId(0x0000000000000013L) + .extension(grpcResetEx1, 0, grpcResetEx1.capacity()) + .build(); + streams[0].write(ResetFW.TYPE_ID, reset3.buffer(), 0, reset3.sizeof()); } @BeforeEach diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data0 b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/data0 index 985f17b6c675ee19fd73cb3a2b8776cd3747e122..7b01191159e91437a07390af9812f1bf5353de28 100644 GIT binary patch delta 936 zcmZp0YjE3egIDqj0|Nsi5K93uClE_RY2k^2(wxdb4hR4_;`K~G1`9(*Nl5`8Lr#8j zVopYWafy|=p{cPjLuy50Zb43}o@;VOesF40S!Qx7Cj*ERnwMBq=>*it3^GR}y{I5r zH!(RmwV*^dH7_|oB{MIbBfToKfI%cTwInemu_RH~h$|yCCnui~A!5v7Vq_v`1Tvux z=vHjb6#_X|1*8H9D0J={pb;R?GKl2l=cOy8Wv1q&Okj>84b+pSoa(CGahr%4)(i}( zP(Nc!2EMAGzyJba2n8pZVFI8C{tpD8P}71)<1!EwQNC(WBVhWWTm}>aL4qIyeIc@i zP%btX#;QZq;CCSpP>}~HX(@!~7v-cVf((yfT}}xF~|&dhQy@& sqLS1UsG4vf4NRjB=mvqjuB?g2AXbK=)Z)~V%@=tC`IroZfOH)b08JFJd;kCd delta 25 fcmZp0YjE3egLkuqkO$vp2cZNOCLqU9sE!E$ciad& diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/labels b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/labels index eeff1939ea..8b7de2bd28 100644 --- a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/labels +++ b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/engine/labels @@ -23,3 +23,5 @@ http-kafka cache_client cache_server client +north_grpc_server +north_grpc_kafka_mapping diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.pcap b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.pcap index df24de985337db8220748a4a8f42f3003d1cb9ee..ef47fe0a9d5279a418c309feb1a500397cb62e89 100644 GIT binary patch delta 1975 zcmdn!xiWggMwQ9hirm(P3=E8g3PG;UVGIhvu6`~IZFdtDm0cOF*&O~gFdzdVG`{d; zS$PQon2H;`3=Hl-&g6?+qR#0>14GcsXDIl~!@D96Yrz*G&4bVhX`z8D}4jdO57Ld`b- z<{~QRoqAQM*}@1vfLY8i0Z^{^4+NlmrG=u11i#`)-i#L&fS$b%OW(+Tok3l{g3@=r z8r1nPufcqS;#ZI$$gjRISuo8A%x;W)SmN~t(eZj;0hld1vH6ujkoxfoOhsUT*RMQ4 zB_5zsOd&kKC?`b`KG4nHGcnEeR>ZASA@_3L5xZ z1L|&ce}lZn&XAY{tXEP~plU$W7ZAqczkL|~!;yxWI)Sx@e*n~bBET}*0c0)++@P-i YKxtT66Jj(da8Urrf2<5esl}-!0CCEqw*UYD delta 7 OcmZ1(z0q^SMil@K_XC6g diff --git a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt index bda0361b9d..84ac74c530 100644 --- a/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt +++ b/incubator/command-dump/src/test/resources/io/aklivity/zilla/runtime/command/dump/internal/airline/expected_dump.txt @@ -1431,3 +1431,335 @@ Zilla Frame Length: 6 Value: /hello +Frame 35: 369 bytes on wire (2952 bits), 369 bytes captured (2952 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::12, Dst: fe80::13 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 0, Ack: 1, Len: 295 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00000dd8 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000013 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000023 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Scheme: http + Length: 4 + Scheme: http + Authority: localhost:7153 + Length: 14 + Authority: localhost:7153 + Service: example.EchoService + Length: 19 + Service: example.EchoService + Method: EchoUnary + Length: 9 + Method: EchoUnary + Metadata (3 items) + Length: 66 + Size: 3 + Metadata: [TEXT] grpc-accept-encoding: gzip + Type: TEXT (0) + Length (Varint): 28 + Length: 20 + Name: grpc-accept-encoding + Length (Varint): 08 + Length: 4 + Value: gzip + Metadata: [TEXT] metadata-2: hello + Type: TEXT (0) + Length (Varint): 14 + Length: 10 + Name: metadata-2 + Length (Varint): 0a + Length: 5 + Value: hello + Metadata: [BASE64] metadata-3: 4242 + Type: BASE64 (1) + Length (Varint): 14 + Length: 10 + Name: metadata-3 + Length (Varint): 08 + Length: 4 + Value: 4242 + +Frame 36: 539 bytes on wire (4312 bits), 539 bytes captured (4312 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::13, Dst: fe80::12 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 1, Ack: 295, Len: 465 +Zilla Frame + Frame Type ID: 0x00000001 + Frame Type: BEGIN + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00000eb0 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000012 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: REP + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000024 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Affinity: 0x0000000000000000 + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Scheme: http + Length: 4 + Scheme: http + Authority: localhost:7153 + Length: 14 + Authority: localhost:7153 + Service: example.EchoService + Length: 19 + Service: example.EchoService + Method: EchoUnary + Length: 9 + Method: EchoUnary + Metadata (2 items) + Length: 236 + Size: 2 + Metadata: [TEXT] long field: ZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZ + Type: TEXT (0) + Length (Varint): 14 + Length: 10 + Name: long field + Length (Varint): 9003 + Length: 200 + Value: ZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZZ + Metadata: [TEXT] metadata-2: hello + Type: TEXT (0) + Length (Varint): 14 + Length: 10 + Name: metadata-2 + Length (Varint): 0a + Length: 5 + Value: hello + +Frame 37: 258 bytes on wire (2064 bits), 258 bytes captured (2064 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::12, Dst: fe80::13 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 295, Ack: 466, Len: 184 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00001030 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000013 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000025 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000000013 + Reserved: 66 + Progress: 66 + Progress/Maximum: 66/0 + Payload + Length: -1 + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Deferred: 42 + +Frame 38: 258 bytes on wire (2064 bits), 258 bytes captured (2064 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::13, Dst: fe80::12 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 466, Ack: 479, Len: 184 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00001098 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000012 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: REP + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000026 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000000013 + Reserved: 66 + Progress: 66 + Progress/Maximum: 66/0 + Payload + Length: 0 + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Deferred: 77 + +Frame 39: 270 bytes on wire (2160 bits), 270 bytes captured (2160 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::12, Dst: fe80::13 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 479, Ack: 650, Len: 196 +Zilla Frame + Frame Type ID: 0x00000002 + Frame Type: DATA + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00001100 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000013 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000027 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Flags: 0x03 + .... ...1 = FIN: Set (1) + .... ..1. = INIT: Set (1) + .... .0.. = INCOMPLETE: Not set (0) + .... 0... = SKIP: Not set (0) + Budget ID: 0x0000000000000013 + Reserved: 66 + Progress: 66 + Progress/Maximum: 66/0 + Payload + Length: 12 + Payload + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Deferred: 88 + +Frame 40: 246 bytes on wire (1968 bits), 246 bytes captured (1968 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::12, Dst: fe80::13 +Transmission Control Protocol, Src Port: 0, Dst Port: 7114, Seq: 675, Ack: 650, Len: 172 +Zilla Frame + Frame Type ID: 0x00000004 + Frame Type: ABORT + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x00001178 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000013 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: INI + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000028 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Status: aborted + Length: 7 + Status: aborted + +Frame 41: 244 bytes on wire (1952 bits), 244 bytes captured (1952 bits) +Ethernet II, Src: Send_00 (20:53:45:4e:44:00), Dst: Receive_00 (20:52:45:43:56:00) +Internet Protocol Version 6, Src: fe80::13, Dst: fe80::12 +Transmission Control Protocol, Src Port: 7114, Dst Port: 0, Seq: 650, Ack: 847, Len: 170 +Zilla Frame + Frame Type ID: 0x40000001 + Frame Type: RESET + Protocol Type ID: 0x00000000 + Protocol Type: + Worker: 0 + Offset: 0x000011d8 + Origin ID: 0x000000090000001a + Origin Namespace: example + Origin Binding: north_grpc_server + Routed ID: 0x000000090000001b + Routed Namespace: example + Routed Binding: north_grpc_kafka_mapping + Stream ID: 0x0000000000000012 + Initial ID: 0x0000000000000013 + Reply ID: 0x0000000000000012 + Direction: REP + Sequence: 0 + Acknowledge: 0 + Maximum: 0 + Timestamp: 0x0000000000000029 + Trace ID: 0x0000000000000013 + Authorization: 0x0000000000000000 + Extension: grpc + Stream Type ID: 0x3a58c7f9 + Stream Type: grpc + Status: reset + Length: 5 + Status: reset + From ae64ed60c0ce5ca887e7bbd08502fd465827b4fc Mon Sep 17 00:00:00 2001 From: Akram Yakubov Date: Sun, 24 Dec 2023 09:54:36 -0800 Subject: [PATCH 14/16] OffsetFetch Request should connect to the coordinator instead of a random member of cluster (#654) --- .../KafkaCacheClientConsumerFactory.java | 21 ++++++- .../stream/KafkaCacheOffsetFetchFactory.java | 1 - .../KafkaCacheServerConsumerFactory.java | 15 ++++- .../stream/KafkaClientGroupFactory.java | 18 ++++-- .../stream/KafkaClientOffsetFetchFactory.java | 34 ++++++++++- .../internal/stream/KafkaMergedFactory.java | 13 +++++ .../kafka/internal/KafkaFunctions.java | 58 +++++++++++++++++++ .../main/resources/META-INF/zilla/kafka.idl | 6 ++ .../client.rpt | 2 + .../server.rpt | 2 + .../client.rpt | 2 + .../server.rpt | 2 + .../client.rpt | 2 + .../server.rpt | 2 + .../client.rpt | 2 + .../server.rpt | 2 + .../client.rpt | 2 + .../server.rpt | 2 + .../group/leader.assignment/client.rpt | 2 + .../group/leader.assignment/server.rpt | 2 + .../client.rpt | 4 ++ .../server.rpt | 4 ++ .../client.rpt | 2 + .../server.rpt | 2 + .../client.rpt | 2 + .../server.rpt | 2 + .../client.rpt | 2 + .../server.rpt | 2 + .../rebalance.protocol.highlander/client.rpt | 2 + .../rebalance.protocol.highlander/server.rpt | 2 + .../rebalance.protocol.unknown/client.rpt | 2 + .../rebalance.protocol.unknown/server.rpt | 2 + .../group/rebalance.sync.group/client.rpt | 2 + .../group/rebalance.sync.group/server.rpt | 2 + .../client.rpt | 4 ++ .../server.rpt | 4 ++ .../topic.offset.info.incomplete/client.rpt | 2 + .../topic.offset.info.incomplete/server.rpt | 2 + .../offset.fetch/topic.offset.info/client.rpt | 2 + .../offset.fetch/topic.offset.info/server.rpt | 2 + .../topic.offset.no.partition/client.rpt | 2 + .../topic.offset.no.partition/server.rpt | 2 + .../kafka/internal/KafkaFunctionsTest.java | 13 +++++ 43 files changed, 244 insertions(+), 11 deletions(-) diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheClientConsumerFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheClientConsumerFactory.java index b82ad9a201..086205beef 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheClientConsumerFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheClientConsumerFactory.java @@ -453,6 +453,8 @@ final class KafkaCacheClientConsumerFan private long replySeq; private long replyAck; private int replyMax; + private String host; + private int port; private KafkaCacheClientConsumerFan( @@ -720,6 +722,14 @@ private void onConsumerFanReplyBegin( BeginFW begin) { final long traceId = begin.traceId(); + final OctetsFW extension = begin.extension(); + + final ExtensionFW beginEx = extensionRO.tryWrap(extension.buffer(), extension.offset(), extension.limit()); + final KafkaBeginExFW kafkaBeginEx = beginEx.typeId() == kafkaTypeId ? extension.get(kafkaBeginExRO::wrap) : null; + final KafkaConsumerBeginExFW kafkaConsumerBeginEx = kafkaBeginEx != null ? kafkaBeginEx.consumer() : null; + + host = kafkaConsumerBeginEx.host().asString(); + port = kafkaConsumerBeginEx.port(); state = KafkaState.openingReply(state); @@ -1029,7 +1039,16 @@ private void doConsumerReplyBegin( state = KafkaState.openingReply(state); doBegin(sender, originId, routedId, replyId, replySeq, replyAck, replyMax, - traceId, authorization, affinity, EMPTY_EXTENSION); + traceId, authorization, affinity, ex -> ex.set((b, o, l) -> kafkaBeginExRW.wrap(b, o, l) + .typeId(kafkaTypeId) + .consumer(c -> c + .groupId(fan.groupId) + .consumerId(fan.consumerId) + .host(fan.host) + .port(fan.port) + .timeout(fan.timeout) + .topic(fan.topic)) + .build().sizeof())); } private void doConsumerReplyDataIfNecessary( diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheOffsetFetchFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheOffsetFetchFactory.java index 8862c28106..9a4d17fa17 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheOffsetFetchFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheOffsetFetchFactory.java @@ -815,7 +815,6 @@ private void onOffsetFetchInitialBegin( final long sequence = begin.sequence(); final long acknowledge = begin.acknowledge(); final long traceId = begin.traceId(); - final long authorization = begin.authorization(); final long affinity = begin.affinity(); final OctetsFW extension = begin.extension(); diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheServerConsumerFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheServerConsumerFactory.java index c9cf72831d..3fdb17dccc 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheServerConsumerFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaCacheServerConsumerFactory.java @@ -557,6 +557,8 @@ final class KafkaCacheServerConsumerFanout private String leaderId; private String memberId; private String instanceId; + private String host; + private int port; private int timeout; private int generationId; @@ -846,6 +848,8 @@ private void onConsumerReplyBegin( final KafkaGroupBeginExFW kafkaGroupBeginEx = kafkaBeginEx != null ? kafkaBeginEx.group() : null; instanceId = kafkaGroupBeginEx.instanceId().asString(); + host = kafkaGroupBeginEx.host().asString(); + port = kafkaGroupBeginEx.port(); state = KafkaState.openedReply(state); @@ -1353,7 +1357,16 @@ private void doConsumerReplyBegin( state = KafkaState.openingReply(state); doBegin(sender, originId, routedId, replyId, replySeq, replyAck, replyMax, - traceId, authorization, affinity, EMPTY_OCTETS); + traceId, authorization, affinity, ex -> ex.set((b, o, l) -> kafkaBeginExRW.wrap(b, o, l) + .typeId(kafkaTypeId) + .consumer(c -> c + .groupId(fanout.groupId) + .consumerId(fanout.consumerId) + .host(fanout.host) + .port(fanout.port) + .timeout(fanout.timeout) + .topic(topic)) + .build().sizeof())); } private void doConsumerReplyData( diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientGroupFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientGroupFactory.java index b796f407cf..0ef75d5307 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientGroupFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientGroupFactory.java @@ -95,7 +95,6 @@ import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.ExtensionFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.FlushFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaBeginExFW; -import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaDataExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaFlushExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaGroupBeginExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaGroupFlushExFW; @@ -172,7 +171,6 @@ public final class KafkaClientGroupFactory extends KafkaClientSaslHandshaker imp private final ResetFW.Builder resetRW = new ResetFW.Builder(); private final WindowFW.Builder windowRW = new WindowFW.Builder(); private final KafkaBeginExFW.Builder kafkaBeginExRW = new KafkaBeginExFW.Builder(); - private final KafkaDataExFW.Builder kafkaDataExRW = new KafkaDataExFW.Builder(); private final KafkaFlushExFW.Builder kafkaFlushExRW = new KafkaFlushExFW.Builder(); private final KafkaResetExFW.Builder kafkaResetExRW = new KafkaResetExFW.Builder(); private final ProxyBeginExFW.Builder proxyBeginExRW = new ProxyBeginExFW.Builder(); @@ -1405,7 +1403,7 @@ private void onStreamFlush( final long sequence = flush.sequence(); final long acknowledge = flush.acknowledge(); final long traceId = flush.traceId(); - final long authorizationId = flush.authorization(); + final long budgetId = flush.budgetId(); final int reserved = flush.reserved(); final OctetsFW extension = flush.extension(); @@ -1440,7 +1438,14 @@ private void onStreamFlush( } }); - coordinatorClient.doJoinGroupRequest(traceId); + if (host != null) + { + coordinatorClient.doJoinGroupRequest(traceId); + } + else + { + clusterClient.doEncodeRequestIfNecessary(traceId, budgetId); + } } else { @@ -1525,6 +1530,8 @@ private void doStreamBegin( .groupId(groupId) .protocol(protocol) .instanceId(groupMembership.instanceId) + .host(host) + .port(port) .timeout(timeout)) .build(); @@ -2709,6 +2716,7 @@ private void doNetworkBegin( final KafkaClientRoute clientRoute = supplyClientRoute.apply(routedId); final KafkaBrokerInfo broker = clientRoute.brokers.get(Long.parseLong(delegate.nodeId)); + if (broker != null) { extension = e -> e.set((b, o, l) -> proxyBeginExRW.wrap(b, o, l) @@ -4008,7 +4016,7 @@ private void doJoinGroupRequest( encoders.add(encodeJoinGroupRequest); signaler.signalNow(originId, routedId, initialId, traceId, SIGNAL_NEXT_REQUEST, 0); } - else + else if (delegate.host != null) { delegate.doStreamBeginIfNecessary(traceId, authorization); } diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientOffsetFetchFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientOffsetFetchFactory.java index 418147253e..fea3d3ec1f 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientOffsetFetchFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientOffsetFetchFactory.java @@ -15,6 +15,7 @@ */ package io.aklivity.zilla.runtime.binding.kafka.internal.stream; +import static io.aklivity.zilla.runtime.binding.kafka.internal.types.ProxyAddressProtocol.STREAM; import static io.aklivity.zilla.runtime.engine.buffer.BufferPool.NO_SLOT; import static java.util.Objects.requireNonNull; @@ -53,6 +54,7 @@ import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaDataExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaOffsetFetchBeginExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaResetExFW; +import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.ProxyBeginExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.ResetFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.SignalFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.WindowFW; @@ -93,7 +95,7 @@ public final class KafkaClientOffsetFetchFactory extends KafkaClientSaslHandshak private final AbortFW.Builder abortRW = new AbortFW.Builder(); private final ResetFW.Builder resetRW = new ResetFW.Builder(); private final WindowFW.Builder windowRW = new WindowFW.Builder(); - private final KafkaBeginExFW.Builder kafkaBeginExRW = new KafkaBeginExFW.Builder(); + private final ProxyBeginExFW.Builder proxyBeginExRW = new ProxyBeginExFW.Builder(); private final KafkaDataExFW.Builder kafkaDataExRW = new KafkaDataExFW.Builder(); private final KafkaResetExFW.Builder kafkaResetExRW = new KafkaResetExFW.Builder(); @@ -127,6 +129,7 @@ public final class KafkaClientOffsetFetchFactory extends KafkaClientSaslHandshak private final KafkaOffsetFetchClientDecoder decodeReject = this::decodeReject; private final int kafkaTypeId; + private final int proxyTypeId; private final MutableDirectBuffer writeBuffer; private final MutableDirectBuffer extBuffer; private final BufferPool decodePool; @@ -142,6 +145,7 @@ public KafkaClientOffsetFetchFactory( { super(config, context); this.kafkaTypeId = context.supplyTypeId(KafkaBinding.NAME); + this.proxyTypeId = context.supplyTypeId("proxy"); this.signaler = context.signaler(); this.streamFactory = context.streamFactory(); this.writeBuffer = new UnsafeBuffer(new byte[context.writeBuffer().capacity()]); @@ -173,6 +177,8 @@ public MessageConsumer newStream( assert kafkaBeginEx.kind() == KafkaBeginExFW.KIND_OFFSET_FETCH; final KafkaOffsetFetchBeginExFW kafkaOffsetFetchBeginEx = kafkaBeginEx.offsetFetch(); final String groupId = kafkaOffsetFetchBeginEx.groupId().asString(); + final String host = kafkaOffsetFetchBeginEx.host().asString(); + final int port = kafkaOffsetFetchBeginEx.port(); final String topic = kafkaOffsetFetchBeginEx.topic().asString(); IntHashSet partitions = new IntHashSet(); kafkaOffsetFetchBeginEx.partitions().forEach(p -> partitions.add(p.partitionId())); @@ -196,6 +202,8 @@ public MessageConsumer newStream( affinity, resolvedId, groupId, + host, + port, topic, partitions, sasl)::onApplication; @@ -757,6 +765,8 @@ private final class KafkaOffsetFetchStream long affinity, long resolvedId, String groupId, + String host, + int port, String topic, IntHashSet partitions, KafkaSaslConfig sasl) @@ -767,7 +777,8 @@ private final class KafkaOffsetFetchStream this.initialId = initialId; this.replyId = supplyReplyId.applyAsLong(initialId); this.affinity = affinity; - this.client = new KafkaOffsetFetchClient(this, routedId, resolvedId, groupId, topic, partitions, sasl); + this.client = new KafkaOffsetFetchClient(this, routedId, resolvedId, groupId, host, port, + topic, partitions, sasl); } private void onApplication( @@ -1020,6 +1031,8 @@ private final class KafkaOffsetFetchClient extends KafkaSaslClient private final KafkaOffsetFetchStream delegate; private final String groupId; + private final String host; + private final int port; private final String topic; private final IntHashSet partitions; private final ObjectHashSet topicPartitions; @@ -1060,6 +1073,8 @@ private final class KafkaOffsetFetchClient extends KafkaSaslClient long originId, long routedId, String groupId, + String host, + int port, String topic, IntHashSet partitions, KafkaSaslConfig sasl) @@ -1067,6 +1082,8 @@ private final class KafkaOffsetFetchClient extends KafkaSaslClient super(sasl, originId, routedId); this.delegate = delegate; this.groupId = requireNonNull(groupId); + this.host = host; + this.port = port; this.topic = topic; this.partitions = partitions; this.topicPartitions = new ObjectHashSet<>(); @@ -1274,8 +1291,19 @@ private void doNetworkBegin( { state = KafkaState.openingInitial(state); + Consumer extension = e -> e.set((b, o, l) -> proxyBeginExRW.wrap(b, o, l) + .typeId(proxyTypeId) + .address(a -> a.inet(i -> i.protocol(p -> p.set(STREAM)) + .source("0.0.0.0") + .destination(host) + .sourcePort(0) + .destinationPort(port))) + .infos(i -> i.item(ii -> ii.authority(host))) + .build() + .sizeof()); + network = newStream(this::onNetwork, originId, routedId, initialId, initialSeq, initialAck, initialMax, - traceId, authorization, affinity, EMPTY_EXTENSION); + traceId, authorization, affinity, extension); } @Override diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaMergedFactory.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaMergedFactory.java index 80887cd342..651d33e4ac 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaMergedFactory.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaMergedFactory.java @@ -75,6 +75,7 @@ import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.FlushFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaBeginExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaConsumerAssignmentFW; +import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaConsumerBeginExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaConsumerDataExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaConsumerFlushExFW; import io.aklivity.zilla.runtime.binding.kafka.internal.types.stream.KafkaDataExFW; @@ -2776,6 +2777,8 @@ private final class KafkaUnmergedConsumerStream private long replySeq; private long replyAck; private int replyMax; + private String host; + private int port; private KafkaUnmergedConsumerStream( KafkaMergedStream merged) @@ -2926,9 +2929,17 @@ private void onConsumerReplyBegin( BeginFW begin) { final long traceId = begin.traceId(); + final OctetsFW extension = begin.extension(); state = KafkaState.openingReply(state); + final ExtensionFW beginEx = extensionRO.tryWrap(extension.buffer(), extension.offset(), extension.limit()); + final KafkaBeginExFW kafkaBeginEx = beginEx.typeId() == kafkaTypeId ? extension.get(kafkaBeginExRO::wrap) : null; + final KafkaConsumerBeginExFW kafkaConsumerBeginEx = kafkaBeginEx != null ? kafkaBeginEx.consumer() : null; + + host = kafkaConsumerBeginEx.host().asString(); + port = kafkaConsumerBeginEx.port(); + doConsumerReplyWindow(traceId, 0, 8192); } @@ -3148,6 +3159,8 @@ private void doOffsetFetchInitialBegin( .typeId(kafkaTypeId) .offsetFetch(c -> c .groupId(merged.groupId) + .host(merged.consumerStream.host) + .port(merged.consumerStream.port) .topic(merged.topic) .partitions(p -> merged.leadersByAssignedId.forEach((k, v) -> p.item(tp -> tp.partitionId(k)))) diff --git a/specs/binding-kafka.spec/src/main/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctions.java b/specs/binding-kafka.spec/src/main/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctions.java index f6c58c2bc7..b49479eeb1 100644 --- a/specs/binding-kafka.spec/src/main/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctions.java +++ b/specs/binding-kafka.spec/src/main/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctions.java @@ -1417,6 +1417,20 @@ public KafkaGroupBeginExBuilder instanceId( return this; } + public KafkaGroupBeginExBuilder host( + String host) + { + groupBeginExRW.host(host); + return this; + } + + public KafkaGroupBeginExBuilder port( + int port) + { + groupBeginExRW.port(port); + return this; + } + public KafkaGroupBeginExBuilder timeout( int timeout) { @@ -1514,6 +1528,20 @@ public KafkaOffsetFetchBeginExBuilder groupId( return this; } + public KafkaOffsetFetchBeginExBuilder host( + String host) + { + offsetFetchBeginExRW.host(host); + return this; + } + + public KafkaOffsetFetchBeginExBuilder port( + int port) + { + offsetFetchBeginExRW.port(port); + return this; + } + public KafkaOffsetFetchBeginExBuilder topic( String topic) { @@ -5357,6 +5385,8 @@ public final class KafkaGroupBeginExMatcherBuilder private String16FW groupId; private String16FW protocol; private String16FW instanceId; + private String16FW host; + private Integer port; private Integer timeout; private byte[] metadata; @@ -5393,6 +5423,20 @@ public KafkaGroupBeginExMatcherBuilder instanceId( return this; } + public KafkaGroupBeginExMatcherBuilder host( + String host) + { + this.host = new String16FW(host); + return this; + } + + public KafkaGroupBeginExMatcherBuilder port( + int port) + { + this.port = port; + return this; + } + public KafkaGroupBeginExMatcherBuilder metadata( byte[] metadata) { @@ -5413,6 +5457,8 @@ private boolean match( matchProtocol(groupBeginEx) && matchTimeout(groupBeginEx) && matchInstanceId(groupBeginEx) && + matchHost(groupBeginEx) && + matchPort(groupBeginEx) && matchMetadata(groupBeginEx); } @@ -5440,6 +5486,18 @@ private boolean matchInstanceId( return instanceId == null || instanceId.equals(groupBeginExFW.instanceId()); } + private boolean matchHost( + final KafkaGroupBeginExFW groupBeginExFW) + { + return host == null || host.equals(groupBeginExFW.host()); + } + + private boolean matchPort( + final KafkaGroupBeginExFW groupBeginExFW) + { + return port == null || port == groupBeginExFW.port(); + } + private boolean matchMetadata( final KafkaGroupBeginExFW groupBeginExFW) { diff --git a/specs/binding-kafka.spec/src/main/resources/META-INF/zilla/kafka.idl b/specs/binding-kafka.spec/src/main/resources/META-INF/zilla/kafka.idl index ab26e9ccb6..b9bc62e50c 100644 --- a/specs/binding-kafka.spec/src/main/resources/META-INF/zilla/kafka.idl +++ b/specs/binding-kafka.spec/src/main/resources/META-INF/zilla/kafka.idl @@ -400,6 +400,8 @@ scope kafka string16 groupId; string16 protocol; string16 instanceId = null; + string16 host = null; + int32 port = 0; int32 timeout; varint32 metadataLen; octets[metadataLen] metadata = null; @@ -424,6 +426,8 @@ scope kafka { string16 groupId; string16 consumerId; + string16 host = null; + int32 port = 0; int32 timeout; string16 topic; KafkaTopicPartition[] partitionIds; @@ -457,6 +461,8 @@ scope kafka struct KafkaOffsetFetchBeginEx { string16 groupId; + string16 host = null; + int32 port = 0; string16 topic; KafkaTopicPartition[] partitions; } diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/client.rpt index 3db9611ec3..bb7635fdba 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/client.rpt @@ -42,6 +42,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("client-1") .protocol("rebalance") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/server.rpt index 5174434b63..93f0a7753e 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/consumer/commit.acknowledge.message.offset/server.rpt @@ -46,6 +46,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("client-1") .protocol("rebalance") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/client.rpt index 2dc3be52c5..a549d08744 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/server.rpt index a293f4dee1..c7cce87c75 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.read.abort.after.sync.group.response/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/client.rpt index 4329b6a927..49d7c86c06 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/server.rpt index 1378dc8569..85ebf4994f 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.join.group.response/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/client.rpt index a3cb890870..45761ae379 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/server.rpt index e250ecc951..24d8fa5314 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/client.sent.write.abort.after.sync.group.response/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/client.rpt index 531aae7049..77d1e5a543 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/client.rpt @@ -36,6 +36,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/server.rpt index 4c54c801ea..053771f954 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/ignore.heartbeat.before.handshake/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/client.rpt index b2985823ab..0681f574df 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/server.rpt index bde6ec6d0c..190f5d143e 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/leader.assignment/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/client.rpt index 268d5827eb..7b80d69206 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} @@ -80,6 +82,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/server.rpt index 847812fbe4..45a9295835 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.multiple.members.with.same.group.id/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} @@ -81,6 +83,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/client.rpt index 9c599cd1dc..f7e8a73b5f 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/server.rpt index e31f5270a4..37853f30cd 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.heartbeat.unknown.member/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/client.rpt index fb16829e78..02b8d2ee7f 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/client.rpt @@ -43,6 +43,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(45000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/server.rpt index dbf1f773d7..9d4a24ccf4 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader.in.parallel/server.rpt @@ -54,6 +54,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/client.rpt index 6b02b9ec46..9d0671ff4d 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/server.rpt index 2527180360..ab1377d3cc 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander.migrate.leader/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/client.rpt index db1cfbc9db..bb64576edb 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/server.rpt index 4365349c6c..bd287c531f 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.highlander/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/client.rpt index 38d15fe42a..12932685e8 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("unknown") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/server.rpt index 8a426fc6aa..797cd3814a 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.protocol.unknown/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("unknown") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/client.rpt index 1f64ba2095..bed3ada860 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/client.rpt @@ -35,6 +35,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/server.rpt index b0ccda7c59..a6a033eee2 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/group/rebalance.sync.group/server.rpt @@ -39,6 +39,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("test") .protocol("highlander") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/client.rpt index 608dc73d7a..5bf4738102 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/client.rpt @@ -135,6 +135,8 @@ read zilla:begin.ext ${kafka:matchBeginEx() .group() .groupId("client-1") .protocol("rebalance") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} @@ -193,6 +195,8 @@ write zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/server.rpt index 71b5c0264b..07c865357d 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/merged/unmerged.group.fetch.message.ack/server.rpt @@ -134,6 +134,8 @@ write zilla:begin.ext ${kafka:beginEx() .groupId("client-1") .protocol("rebalance") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(30000) .build() .build()} @@ -188,6 +190,8 @@ read zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/client.rpt index c0b4da2a16..726e94ed6d 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/client.rpt @@ -22,6 +22,8 @@ write zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/server.rpt index eabe9ae2d4..a750c62abc 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info.incomplete/server.rpt @@ -26,6 +26,8 @@ read zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/client.rpt index 822de76544..9f8784881c 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/client.rpt @@ -22,6 +22,8 @@ write zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/server.rpt index ae5f883176..ee6d437f1e 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.info/server.rpt @@ -26,6 +26,8 @@ read zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/client.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/client.rpt index 3872fd9934..7bb6c2991f 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/client.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/client.rpt @@ -22,6 +22,8 @@ write zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/server.rpt b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/server.rpt index 0b19ef32cf..672d3870e4 100644 --- a/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/server.rpt +++ b/specs/binding-kafka.spec/src/main/scripts/io/aklivity/zilla/specs/binding/kafka/streams/application/offset.fetch/topic.offset.no.partition/server.rpt @@ -26,6 +26,8 @@ read zilla:begin.ext ${kafka:beginEx() .typeId(zilla:id("kafka")) .offsetFetch() .groupId("client-1") + .host("localhost") + .port(9092) .topic("test") .partition(0) .build() diff --git a/specs/binding-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctionsTest.java b/specs/binding-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctionsTest.java index 9b29fff00c..4e8c7318ae 100644 --- a/specs/binding-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctionsTest.java +++ b/specs/binding-kafka.spec/src/test/java/io/aklivity/zilla/specs/binding/kafka/internal/KafkaFunctionsTest.java @@ -4167,6 +4167,8 @@ public void shouldGenerateGroupBeginExtension() .groupId("test") .protocol("roundrobin") .instanceId("client-1") + .host("localhost") + .port(9092) .timeout(10) .metadata("test".getBytes()) .build() @@ -4180,6 +4182,9 @@ public void shouldGenerateGroupBeginExtension() final KafkaGroupBeginExFW groupBeginEx = beginEx.group(); assertEquals("test", groupBeginEx.groupId().asString()); assertEquals("roundrobin", groupBeginEx.protocol().asString()); + assertEquals("client-1", groupBeginEx.instanceId().asString()); + assertEquals("localhost", groupBeginEx.host().asString()); + assertEquals(9092, groupBeginEx.port()); assertEquals(10, groupBeginEx.timeout()); } @@ -4238,6 +4243,8 @@ public void shouldGenerateOffsetFetchBeginExtension() .typeId(0x01) .offsetFetch() .groupId("test") + .host("localhost") + .port(9092) .topic("topic") .partition(0) .build() @@ -4250,6 +4257,8 @@ public void shouldGenerateOffsetFetchBeginExtension() final KafkaOffsetFetchBeginExFW offsetFetchBeginEx = beginEx.offsetFetch(); assertEquals("topic", offsetFetchBeginEx.topic().asString()); + assertEquals("localhost", offsetFetchBeginEx.host().asString()); + assertEquals(9092, offsetFetchBeginEx.port()); assertEquals(1, offsetFetchBeginEx.partitions().fieldCount()); } @@ -4285,6 +4294,8 @@ public void shouldMatchGroupBeginExtension() throws Exception .groupId("test") .protocol("roundrobin") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(10) .metadata("meta".getBytes()) .build() @@ -4299,6 +4310,8 @@ public void shouldMatchGroupBeginExtension() throws Exception .groupId("test") .protocol("roundrobin") .instanceId("zilla") + .host("localhost") + .port(9092) .timeout(10) .metadataLen("meta".length()) .metadata(m -> m.set("test".getBytes()))) From 724bb582b505e83b16e00b050b3f826849916d10 Mon Sep 17 00:00:00 2001 From: Akram Yakubov Date: Sun, 24 Dec 2023 15:38:19 -0800 Subject: [PATCH 15/16] Fix static member (#655) --- .../stream/KafkaClientConnectionPool.java | 15 +++++++-------- 1 file changed, 7 insertions(+), 8 deletions(-) diff --git a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientConnectionPool.java b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientConnectionPool.java index 47440a09ce..89b5c15fbf 100644 --- a/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientConnectionPool.java +++ b/runtime/binding-kafka/src/main/java/io/aklivity/zilla/runtime/binding/kafka/internal/stream/KafkaClientConnectionPool.java @@ -78,7 +78,6 @@ public final class KafkaClientConnectionPool extends KafkaClientSaslHandshaker private static final int SIGNAL_STREAM_WINDOW = 0x80000006; private static final int SIGNAL_CONNECTION_CLEANUP = 0x80000007; private static final int SIGNAL_NEXT_REQUEST = 0x80000008; - private static final StringBuilder CLUSTER = new StringBuilder(""); private final BeginFW beginRO = new BeginFW(); private final DataFW dataRO = new DataFW(); @@ -173,7 +172,7 @@ private MessageConsumer newStream( final ProxyBeginExFW proxyBeginEx = extension.get(proxyBeginExRO::tryWrap); MessageConsumer newStream = null; - CLUSTER.setLength(0); + final StringBuilder cluster = new StringBuilder(); if (proxyBeginEx != null) { @@ -181,21 +180,21 @@ private MessageConsumer newStream( String host = inet.destination().asString(); int port = inet.destinationPort(); - CLUSTER.append(host); - CLUSTER.append(":"); - CLUSTER.append(port); + cluster.append(host); + cluster.append(":"); + cluster.append(port); if (proxyBeginEx.infos() != null) { proxyBeginEx.infos().forEach(i -> { - CLUSTER.append(":"); - CLUSTER.append(i.authority().asString()); + cluster.append(":"); + cluster.append(i.authority().asString()); }); } } - final KafkaClientConnection connection = connectionPool.computeIfAbsent(CLUSTER.toString(), s -> + final KafkaClientConnection connection = connectionPool.computeIfAbsent(cluster.toString(), s -> newConnection(originId, routedId, authorization)); newStream = connection.newStream(msgTypeId, buffer, index, length, sender); From 4b315a8d0404c04de7caa423f7a643fa4169e8f7 Mon Sep 17 00:00:00 2001 From: John Fallows Date: Sun, 24 Dec 2023 16:17:46 -0800 Subject: [PATCH 16/16] Prepare release 0.9.63 --- CHANGELOG.md | 34 +++++++++++++++++++ build/flyweight-maven-plugin/pom.xml | 2 +- build/pom.xml | 2 +- cloud/docker-image/pom.xml | 2 +- cloud/helm-chart/pom.xml | 2 +- cloud/pom.xml | 2 +- conf/pom.xml | 2 +- incubator/binding-amqp.spec/pom.xml | 2 +- incubator/binding-amqp/pom.xml | 2 +- incubator/catalog-inline.spec/pom.xml | 2 +- incubator/catalog-inline/pom.xml | 2 +- .../catalog-schema-registry.spec/pom.xml | 2 +- incubator/catalog-schema-registry/pom.xml | 2 +- incubator/command-dump/pom.xml | 2 +- incubator/command-generate/pom.xml | 2 +- incubator/command-log/pom.xml | 2 +- incubator/command-tune/pom.xml | 2 +- incubator/exporter-otlp.spec/pom.xml | 2 +- incubator/exporter-otlp/pom.xml | 2 +- incubator/pom.xml | 2 +- incubator/validator-avro.spec/pom.xml | 2 +- incubator/validator-avro/pom.xml | 2 +- incubator/validator-core.spec/pom.xml | 2 +- incubator/validator-core/pom.xml | 2 +- incubator/validator-json.spec/pom.xml | 2 +- incubator/validator-json/pom.xml | 2 +- manager/pom.xml | 2 +- pom.xml | 2 +- runtime/binding-echo/pom.xml | 2 +- runtime/binding-fan/pom.xml | 2 +- runtime/binding-filesystem/pom.xml | 2 +- runtime/binding-grpc-kafka/pom.xml | 2 +- runtime/binding-grpc/pom.xml | 2 +- runtime/binding-http-filesystem/pom.xml | 2 +- runtime/binding-http-kafka/pom.xml | 2 +- runtime/binding-http/pom.xml | 2 +- runtime/binding-kafka-grpc/pom.xml | 2 +- runtime/binding-kafka/pom.xml | 2 +- runtime/binding-mqtt-kafka/pom.xml | 2 +- runtime/binding-mqtt/pom.xml | 2 +- runtime/binding-proxy/pom.xml | 2 +- runtime/binding-sse-kafka/pom.xml | 2 +- runtime/binding-sse/pom.xml | 2 +- runtime/binding-tcp/pom.xml | 2 +- runtime/binding-tls/pom.xml | 2 +- runtime/binding-ws/pom.xml | 2 +- runtime/command-metrics/pom.xml | 2 +- runtime/command-start/pom.xml | 2 +- runtime/command-stop/pom.xml | 2 +- runtime/command/pom.xml | 2 +- runtime/engine/pom.xml | 2 +- runtime/exporter-prometheus/pom.xml | 2 +- runtime/guard-jwt/pom.xml | 2 +- runtime/metrics-grpc/pom.xml | 2 +- runtime/metrics-http/pom.xml | 2 +- runtime/metrics-stream/pom.xml | 2 +- runtime/pom.xml | 2 +- runtime/vault-filesystem/pom.xml | 2 +- specs/binding-echo.spec/pom.xml | 2 +- specs/binding-fan.spec/pom.xml | 2 +- specs/binding-filesystem.spec/pom.xml | 2 +- specs/binding-grpc-kafka.spec/pom.xml | 2 +- specs/binding-grpc.spec/pom.xml | 2 +- specs/binding-http-filesystem.spec/pom.xml | 2 +- specs/binding-http-kafka.spec/pom.xml | 2 +- specs/binding-http.spec/pom.xml | 2 +- specs/binding-kafka-grpc.spec/pom.xml | 2 +- specs/binding-kafka.spec/pom.xml | 2 +- specs/binding-mqtt-kafka.spec/pom.xml | 2 +- specs/binding-mqtt.spec/pom.xml | 2 +- specs/binding-proxy.spec/pom.xml | 2 +- specs/binding-sse-kafka.spec/pom.xml | 2 +- specs/binding-sse.spec/pom.xml | 2 +- specs/binding-tcp.spec/pom.xml | 2 +- specs/binding-tls.spec/pom.xml | 2 +- specs/binding-ws.spec/pom.xml | 2 +- specs/engine.spec/pom.xml | 2 +- specs/exporter-prometheus.spec/pom.xml | 2 +- specs/guard-jwt.spec/pom.xml | 2 +- specs/metrics-grpc.spec/pom.xml | 2 +- specs/metrics-http.spec/pom.xml | 2 +- specs/metrics-stream.spec/pom.xml | 2 +- specs/pom.xml | 2 +- specs/vault-filesystem.spec/pom.xml | 2 +- 84 files changed, 117 insertions(+), 83 deletions(-) diff --git a/CHANGELOG.md b/CHANGELOG.md index dc5b6a3850..bb06b35580 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -1,5 +1,39 @@ # Changelog +## [Unreleased](https://github.com/aklivity/zilla/tree/HEAD) + +[Full Changelog](https://github.com/aklivity/zilla/compare/0.9.62...HEAD) + +**Implemented enhancements:** + +- Support MQTT message expiry in `mqtt-kafka` mapping [\#631](https://github.com/aklivity/zilla/issues/631) +- Implement mqtt message expiry [\#640](https://github.com/aklivity/zilla/pull/640) ([bmaidics](https://github.com/bmaidics)) +- Improve server sent DISCONNECT reasonCodes [\#634](https://github.com/aklivity/zilla/pull/634) ([bmaidics](https://github.com/bmaidics)) + +**Fixed bugs:** + +- OffsetFetch Request should connect to the coordinator instead of a random member of cluster [\#653](https://github.com/aklivity/zilla/issues/653) +- Mqtt-kakfa will message bugfixes [\#644](https://github.com/aklivity/zilla/pull/644) ([bmaidics](https://github.com/bmaidics)) + +**Closed issues:** + +- gRPC remote\_server gets duplicate messages [\#480](https://github.com/aklivity/zilla/issues/480) +- Log compaction behavior with or without bootstrap is not consistent [\#389](https://github.com/aklivity/zilla/issues/389) + +**Merged pull requests:** + +- Fix static field [\#655](https://github.com/aklivity/zilla/pull/655) ([akrambek](https://github.com/akrambek)) +- OffsetFetch Request should connect to the coordinator instead of a random member of cluster [\#654](https://github.com/aklivity/zilla/pull/654) ([akrambek](https://github.com/akrambek)) +- Add grpc extension parsing to the dump command [\#652](https://github.com/aklivity/zilla/pull/652) ([attilakreiner](https://github.com/attilakreiner)) +- Add end-to-end testing for the `dump` command [\#646](https://github.com/aklivity/zilla/pull/646) ([attilakreiner](https://github.com/attilakreiner)) +- Bump actions/upload-artifact from 3 to 4 [\#645](https://github.com/aklivity/zilla/pull/645) ([dependabot[bot]](https://github.com/apps/dependabot)) +- Bump github/codeql-action from 2 to 3 [\#643](https://github.com/aklivity/zilla/pull/643) ([dependabot[bot]](https://github.com/apps/dependabot)) +- Fix `java.util.MissingFormatArgumentException` when using Kafka debugging. [\#639](https://github.com/aklivity/zilla/pull/639) ([voutilad](https://github.com/voutilad)) +- Json schema errors [\#638](https://github.com/aklivity/zilla/pull/638) ([vordimous](https://github.com/vordimous)) +- Add jumbograms and proxy extension parsing to dump command [\#635](https://github.com/aklivity/zilla/pull/635) ([attilakreiner](https://github.com/attilakreiner)) +- Bump ubuntu from jammy-20230916 to jammy-20231128 in /cloud/docker-image/src/main/docker/incubator [\#608](https://github.com/aklivity/zilla/pull/608) ([dependabot[bot]](https://github.com/apps/dependabot)) +- Bump ubuntu from jammy-20230916 to jammy-20231128 in /cloud/docker-image/src/main/docker/release [\#607](https://github.com/aklivity/zilla/pull/607) ([dependabot[bot]](https://github.com/apps/dependabot)) + ## [0.9.62](https://github.com/aklivity/zilla/tree/0.9.62) (2023-12-13) [Full Changelog](https://github.com/aklivity/zilla/compare/0.9.61...0.9.62) diff --git a/build/flyweight-maven-plugin/pom.xml b/build/flyweight-maven-plugin/pom.xml index 74d6a13033..c4ace0a2f8 100644 --- a/build/flyweight-maven-plugin/pom.xml +++ b/build/flyweight-maven-plugin/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla build - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/build/pom.xml b/build/pom.xml index 99a8e7a8fa..25bfcb6bc6 100644 --- a/build/pom.xml +++ b/build/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/cloud/docker-image/pom.xml b/cloud/docker-image/pom.xml index 4d3ace0346..45c763586a 100644 --- a/cloud/docker-image/pom.xml +++ b/cloud/docker-image/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla cloud - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/cloud/helm-chart/pom.xml b/cloud/helm-chart/pom.xml index 853e06803a..ea6d606c9b 100644 --- a/cloud/helm-chart/pom.xml +++ b/cloud/helm-chart/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla cloud - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/cloud/pom.xml b/cloud/pom.xml index 68c51f05c8..f631997f5e 100644 --- a/cloud/pom.xml +++ b/cloud/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/conf/pom.xml b/conf/pom.xml index 86622b6574..c857d0acef 100644 --- a/conf/pom.xml +++ b/conf/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/binding-amqp.spec/pom.xml b/incubator/binding-amqp.spec/pom.xml index 40846d1a35..e5e8540189 100644 --- a/incubator/binding-amqp.spec/pom.xml +++ b/incubator/binding-amqp.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/binding-amqp/pom.xml b/incubator/binding-amqp/pom.xml index 71c9c61d90..0770322188 100644 --- a/incubator/binding-amqp/pom.xml +++ b/incubator/binding-amqp/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/catalog-inline.spec/pom.xml b/incubator/catalog-inline.spec/pom.xml index e6494bfdc2..578807fa71 100644 --- a/incubator/catalog-inline.spec/pom.xml +++ b/incubator/catalog-inline.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/catalog-inline/pom.xml b/incubator/catalog-inline/pom.xml index d96f0e1b74..46bad00268 100644 --- a/incubator/catalog-inline/pom.xml +++ b/incubator/catalog-inline/pom.xml @@ -6,7 +6,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/catalog-schema-registry.spec/pom.xml b/incubator/catalog-schema-registry.spec/pom.xml index 6e529c8f30..4ddded993e 100644 --- a/incubator/catalog-schema-registry.spec/pom.xml +++ b/incubator/catalog-schema-registry.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/catalog-schema-registry/pom.xml b/incubator/catalog-schema-registry/pom.xml index a8b9867eba..ad7a1e03e0 100644 --- a/incubator/catalog-schema-registry/pom.xml +++ b/incubator/catalog-schema-registry/pom.xml @@ -6,7 +6,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/command-dump/pom.xml b/incubator/command-dump/pom.xml index f893082a2c..cb78128383 100644 --- a/incubator/command-dump/pom.xml +++ b/incubator/command-dump/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/command-generate/pom.xml b/incubator/command-generate/pom.xml index c98be759eb..f7e8028b22 100644 --- a/incubator/command-generate/pom.xml +++ b/incubator/command-generate/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/command-log/pom.xml b/incubator/command-log/pom.xml index f21b067fca..226d537333 100644 --- a/incubator/command-log/pom.xml +++ b/incubator/command-log/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/command-tune/pom.xml b/incubator/command-tune/pom.xml index 7374c89ed9..e94f2f1ca7 100644 --- a/incubator/command-tune/pom.xml +++ b/incubator/command-tune/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/exporter-otlp.spec/pom.xml b/incubator/exporter-otlp.spec/pom.xml index c23892479f..22b33c14d1 100644 --- a/incubator/exporter-otlp.spec/pom.xml +++ b/incubator/exporter-otlp.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/exporter-otlp/pom.xml b/incubator/exporter-otlp/pom.xml index 48b162cc1b..4009769d5f 100644 --- a/incubator/exporter-otlp/pom.xml +++ b/incubator/exporter-otlp/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/pom.xml b/incubator/pom.xml index 4db4a32fd0..82bd774216 100644 --- a/incubator/pom.xml +++ b/incubator/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/validator-avro.spec/pom.xml b/incubator/validator-avro.spec/pom.xml index 3511201d78..e5b891fe39 100644 --- a/incubator/validator-avro.spec/pom.xml +++ b/incubator/validator-avro.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/validator-avro/pom.xml b/incubator/validator-avro/pom.xml index 69a8b30f72..54c02d3ae0 100644 --- a/incubator/validator-avro/pom.xml +++ b/incubator/validator-avro/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/validator-core.spec/pom.xml b/incubator/validator-core.spec/pom.xml index 8f089c8d6e..16eaaeea38 100644 --- a/incubator/validator-core.spec/pom.xml +++ b/incubator/validator-core.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/validator-core/pom.xml b/incubator/validator-core/pom.xml index 893a4008d4..09af093ec2 100644 --- a/incubator/validator-core/pom.xml +++ b/incubator/validator-core/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/validator-json.spec/pom.xml b/incubator/validator-json.spec/pom.xml index 939483e174..4b288cf59c 100644 --- a/incubator/validator-json.spec/pom.xml +++ b/incubator/validator-json.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/incubator/validator-json/pom.xml b/incubator/validator-json/pom.xml index 67de7ba3a0..b21c7f13ad 100644 --- a/incubator/validator-json/pom.xml +++ b/incubator/validator-json/pom.xml @@ -6,7 +6,7 @@ io.aklivity.zilla incubator - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/manager/pom.xml b/manager/pom.xml index bbbb802f77..5ea29e78d9 100644 --- a/manager/pom.xml +++ b/manager/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/pom.xml b/pom.xml index 2d47198a53..b6a4b847b1 100644 --- a/pom.xml +++ b/pom.xml @@ -7,7 +7,7 @@ 4.0.0 io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 pom zilla https://github.com/aklivity/zilla diff --git a/runtime/binding-echo/pom.xml b/runtime/binding-echo/pom.xml index 37bc15776e..9b4341e7dc 100644 --- a/runtime/binding-echo/pom.xml +++ b/runtime/binding-echo/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-fan/pom.xml b/runtime/binding-fan/pom.xml index 77b5e0aab5..53c223c78a 100644 --- a/runtime/binding-fan/pom.xml +++ b/runtime/binding-fan/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-filesystem/pom.xml b/runtime/binding-filesystem/pom.xml index 19dead7771..ebba393970 100644 --- a/runtime/binding-filesystem/pom.xml +++ b/runtime/binding-filesystem/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-grpc-kafka/pom.xml b/runtime/binding-grpc-kafka/pom.xml index a9952b0a68..920458aa56 100644 --- a/runtime/binding-grpc-kafka/pom.xml +++ b/runtime/binding-grpc-kafka/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-grpc/pom.xml b/runtime/binding-grpc/pom.xml index 8bf0b5f396..3da727a410 100644 --- a/runtime/binding-grpc/pom.xml +++ b/runtime/binding-grpc/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-http-filesystem/pom.xml b/runtime/binding-http-filesystem/pom.xml index 19d46db62e..c6346460bb 100644 --- a/runtime/binding-http-filesystem/pom.xml +++ b/runtime/binding-http-filesystem/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-http-kafka/pom.xml b/runtime/binding-http-kafka/pom.xml index dabc54fb58..c2a85e612b 100644 --- a/runtime/binding-http-kafka/pom.xml +++ b/runtime/binding-http-kafka/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-http/pom.xml b/runtime/binding-http/pom.xml index 15111be380..5ffa5f63d4 100644 --- a/runtime/binding-http/pom.xml +++ b/runtime/binding-http/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-kafka-grpc/pom.xml b/runtime/binding-kafka-grpc/pom.xml index 41b94c3bcb..452d1bbf47 100644 --- a/runtime/binding-kafka-grpc/pom.xml +++ b/runtime/binding-kafka-grpc/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-kafka/pom.xml b/runtime/binding-kafka/pom.xml index c12e6cc57d..c5308f0c90 100644 --- a/runtime/binding-kafka/pom.xml +++ b/runtime/binding-kafka/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-mqtt-kafka/pom.xml b/runtime/binding-mqtt-kafka/pom.xml index 4c9910f84c..6de7db6daa 100644 --- a/runtime/binding-mqtt-kafka/pom.xml +++ b/runtime/binding-mqtt-kafka/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-mqtt/pom.xml b/runtime/binding-mqtt/pom.xml index b349482243..c3008ed623 100644 --- a/runtime/binding-mqtt/pom.xml +++ b/runtime/binding-mqtt/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-proxy/pom.xml b/runtime/binding-proxy/pom.xml index 38985b6961..db620650da 100644 --- a/runtime/binding-proxy/pom.xml +++ b/runtime/binding-proxy/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-sse-kafka/pom.xml b/runtime/binding-sse-kafka/pom.xml index 73486efd4d..ffc586be22 100644 --- a/runtime/binding-sse-kafka/pom.xml +++ b/runtime/binding-sse-kafka/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-sse/pom.xml b/runtime/binding-sse/pom.xml index 1d7aa891b8..501ca9ede8 100644 --- a/runtime/binding-sse/pom.xml +++ b/runtime/binding-sse/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-tcp/pom.xml b/runtime/binding-tcp/pom.xml index 7df01d00f5..fbf2fe88d0 100644 --- a/runtime/binding-tcp/pom.xml +++ b/runtime/binding-tcp/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-tls/pom.xml b/runtime/binding-tls/pom.xml index 6b6779e140..e30dd96e41 100644 --- a/runtime/binding-tls/pom.xml +++ b/runtime/binding-tls/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/binding-ws/pom.xml b/runtime/binding-ws/pom.xml index 6f846d1a83..8a34b13578 100644 --- a/runtime/binding-ws/pom.xml +++ b/runtime/binding-ws/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/command-metrics/pom.xml b/runtime/command-metrics/pom.xml index ad52828b76..ca105dbd71 100644 --- a/runtime/command-metrics/pom.xml +++ b/runtime/command-metrics/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/command-start/pom.xml b/runtime/command-start/pom.xml index 8ab765d93d..ff9b46ce3a 100644 --- a/runtime/command-start/pom.xml +++ b/runtime/command-start/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/command-stop/pom.xml b/runtime/command-stop/pom.xml index 9334bc51e1..19acc10fed 100644 --- a/runtime/command-stop/pom.xml +++ b/runtime/command-stop/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/command/pom.xml b/runtime/command/pom.xml index 6b4253202a..0be1f5cabc 100644 --- a/runtime/command/pom.xml +++ b/runtime/command/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/engine/pom.xml b/runtime/engine/pom.xml index c474c7bc27..debd07f368 100644 --- a/runtime/engine/pom.xml +++ b/runtime/engine/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/exporter-prometheus/pom.xml b/runtime/exporter-prometheus/pom.xml index dad973cdb8..012c1552a0 100644 --- a/runtime/exporter-prometheus/pom.xml +++ b/runtime/exporter-prometheus/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/guard-jwt/pom.xml b/runtime/guard-jwt/pom.xml index 512ee9f932..f6078d1207 100644 --- a/runtime/guard-jwt/pom.xml +++ b/runtime/guard-jwt/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/metrics-grpc/pom.xml b/runtime/metrics-grpc/pom.xml index 5713263b66..1f5f52c072 100644 --- a/runtime/metrics-grpc/pom.xml +++ b/runtime/metrics-grpc/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/metrics-http/pom.xml b/runtime/metrics-http/pom.xml index f505adfd82..9a7e96e71d 100644 --- a/runtime/metrics-http/pom.xml +++ b/runtime/metrics-http/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/metrics-stream/pom.xml b/runtime/metrics-stream/pom.xml index 9ccb8e23dd..4b6b9fc167 100644 --- a/runtime/metrics-stream/pom.xml +++ b/runtime/metrics-stream/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/pom.xml b/runtime/pom.xml index f56e111660..a6dca95af9 100644 --- a/runtime/pom.xml +++ b/runtime/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/runtime/vault-filesystem/pom.xml b/runtime/vault-filesystem/pom.xml index d5ab82cb01..591160e47b 100644 --- a/runtime/vault-filesystem/pom.xml +++ b/runtime/vault-filesystem/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla runtime - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-echo.spec/pom.xml b/specs/binding-echo.spec/pom.xml index d0bfed636e..30d6dc0700 100644 --- a/specs/binding-echo.spec/pom.xml +++ b/specs/binding-echo.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-fan.spec/pom.xml b/specs/binding-fan.spec/pom.xml index 027d3210d7..8fa4b0f72c 100644 --- a/specs/binding-fan.spec/pom.xml +++ b/specs/binding-fan.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-filesystem.spec/pom.xml b/specs/binding-filesystem.spec/pom.xml index cc20c4134b..010cde4f3f 100644 --- a/specs/binding-filesystem.spec/pom.xml +++ b/specs/binding-filesystem.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-grpc-kafka.spec/pom.xml b/specs/binding-grpc-kafka.spec/pom.xml index 546b34371a..ade82b51f8 100644 --- a/specs/binding-grpc-kafka.spec/pom.xml +++ b/specs/binding-grpc-kafka.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-grpc.spec/pom.xml b/specs/binding-grpc.spec/pom.xml index c75c35e62e..74792dd937 100644 --- a/specs/binding-grpc.spec/pom.xml +++ b/specs/binding-grpc.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-http-filesystem.spec/pom.xml b/specs/binding-http-filesystem.spec/pom.xml index b9499ae553..765523135d 100644 --- a/specs/binding-http-filesystem.spec/pom.xml +++ b/specs/binding-http-filesystem.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-http-kafka.spec/pom.xml b/specs/binding-http-kafka.spec/pom.xml index 456a3106b5..38bd2726de 100644 --- a/specs/binding-http-kafka.spec/pom.xml +++ b/specs/binding-http-kafka.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-http.spec/pom.xml b/specs/binding-http.spec/pom.xml index 38a7898be9..6839392af9 100644 --- a/specs/binding-http.spec/pom.xml +++ b/specs/binding-http.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-kafka-grpc.spec/pom.xml b/specs/binding-kafka-grpc.spec/pom.xml index 197265531f..5a5b0e154f 100644 --- a/specs/binding-kafka-grpc.spec/pom.xml +++ b/specs/binding-kafka-grpc.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-kafka.spec/pom.xml b/specs/binding-kafka.spec/pom.xml index c4559fdb23..58559fec3d 100644 --- a/specs/binding-kafka.spec/pom.xml +++ b/specs/binding-kafka.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-mqtt-kafka.spec/pom.xml b/specs/binding-mqtt-kafka.spec/pom.xml index f19bfcfb9d..59033c25e9 100644 --- a/specs/binding-mqtt-kafka.spec/pom.xml +++ b/specs/binding-mqtt-kafka.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-mqtt.spec/pom.xml b/specs/binding-mqtt.spec/pom.xml index f624bb85ae..a89a1cf473 100644 --- a/specs/binding-mqtt.spec/pom.xml +++ b/specs/binding-mqtt.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-proxy.spec/pom.xml b/specs/binding-proxy.spec/pom.xml index fcdb4b9723..5c47109d1d 100644 --- a/specs/binding-proxy.spec/pom.xml +++ b/specs/binding-proxy.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-sse-kafka.spec/pom.xml b/specs/binding-sse-kafka.spec/pom.xml index 20b099b140..cd0906f1ec 100644 --- a/specs/binding-sse-kafka.spec/pom.xml +++ b/specs/binding-sse-kafka.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-sse.spec/pom.xml b/specs/binding-sse.spec/pom.xml index 5cf8e9018c..0dd1d7aac6 100644 --- a/specs/binding-sse.spec/pom.xml +++ b/specs/binding-sse.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-tcp.spec/pom.xml b/specs/binding-tcp.spec/pom.xml index 3a64fc98ba..4ad08c1d3e 100644 --- a/specs/binding-tcp.spec/pom.xml +++ b/specs/binding-tcp.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-tls.spec/pom.xml b/specs/binding-tls.spec/pom.xml index dd0ca5341e..3872da0bef 100644 --- a/specs/binding-tls.spec/pom.xml +++ b/specs/binding-tls.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/binding-ws.spec/pom.xml b/specs/binding-ws.spec/pom.xml index d7f9373844..da5c8aaceb 100644 --- a/specs/binding-ws.spec/pom.xml +++ b/specs/binding-ws.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/engine.spec/pom.xml b/specs/engine.spec/pom.xml index 1d5bd3dafe..372ef1ffb7 100644 --- a/specs/engine.spec/pom.xml +++ b/specs/engine.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/exporter-prometheus.spec/pom.xml b/specs/exporter-prometheus.spec/pom.xml index ab815f1981..ec59e5de79 100644 --- a/specs/exporter-prometheus.spec/pom.xml +++ b/specs/exporter-prometheus.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/guard-jwt.spec/pom.xml b/specs/guard-jwt.spec/pom.xml index ebe02ac328..ee30a47cc7 100644 --- a/specs/guard-jwt.spec/pom.xml +++ b/specs/guard-jwt.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/metrics-grpc.spec/pom.xml b/specs/metrics-grpc.spec/pom.xml index 884c0b1751..8bfaa3e5ba 100644 --- a/specs/metrics-grpc.spec/pom.xml +++ b/specs/metrics-grpc.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/metrics-http.spec/pom.xml b/specs/metrics-http.spec/pom.xml index 7d6afa3aaa..3d0a167701 100644 --- a/specs/metrics-http.spec/pom.xml +++ b/specs/metrics-http.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/metrics-stream.spec/pom.xml b/specs/metrics-stream.spec/pom.xml index 5d51e42f16..cef234f692 100644 --- a/specs/metrics-stream.spec/pom.xml +++ b/specs/metrics-stream.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/pom.xml b/specs/pom.xml index 5979459274..06c65358f1 100644 --- a/specs/pom.xml +++ b/specs/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla zilla - develop-SNAPSHOT + 0.9.63 ../pom.xml diff --git a/specs/vault-filesystem.spec/pom.xml b/specs/vault-filesystem.spec/pom.xml index b248001b27..b2a2a82f59 100644 --- a/specs/vault-filesystem.spec/pom.xml +++ b/specs/vault-filesystem.spec/pom.xml @@ -8,7 +8,7 @@ io.aklivity.zilla specs - develop-SNAPSHOT + 0.9.63 ../pom.xml